N-(5-Amino-1-(4-methoxybenzyl)-1H-pyrazol-4-yl)-2-methyl-5-(3-(3-methylisoxazol-5-yl)ureido)benzamide

ID: ALA1684816

PubChem CID: 53320986

Max Phase: Preclinical

Molecular Formula: C24H25N7O4

Molecular Weight: 475.51

Molecule Type: Small molecule

This compound is available for customization.

Associated Items:

Names and Identifiers

Canonical SMILES:  COc1ccc(Cn2ncc(NC(=O)c3cc(NC(=O)Nc4cc(C)no4)ccc3C)c2N)cc1

Standard InChI:  InChI=1S/C24H25N7O4/c1-14-4-7-17(27-24(33)29-21-10-15(2)30-35-21)11-19(14)23(32)28-20-12-26-31(22(20)25)13-16-5-8-18(34-3)9-6-16/h4-12H,13,25H2,1-3H3,(H,28,32)(H2,27,29,33)

Standard InChI Key:  OUDIZFGOTMDWDV-UHFFFAOYSA-N

Molfile:  

     RDKit          2D

 35 38  0  0  0  0  0  0  0  0999 V2000
   -4.7765   -3.9275    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -4.7785   -4.7556    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -4.0619   -5.1691    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -3.3472   -4.7553    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -3.3485   -3.9241    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -4.0646   -3.5146    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -5.4944   -5.1681    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   -6.2102   -4.7554    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -2.6368   -3.5116    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.9230   -3.9233    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   -1.9223   -4.7480    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   -1.1394   -5.0057    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -0.6526   -4.3381    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.1369   -3.6701    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -0.8805   -2.8859    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    0.1724   -4.3393    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    0.5859   -3.6253    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.4109   -3.6265    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.1744   -2.9103    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    1.8194   -4.3466    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.6437   -4.3480    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.0580   -3.6336    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.6420   -2.9162    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.8192   -2.9182    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.4055   -2.2044    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.0548   -5.0633    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    3.8798   -5.0648    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.2910   -5.7800    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    4.2937   -4.3511    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    5.1160   -5.7816    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.6023   -6.4461    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.3874   -6.1926    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.3890   -5.3676    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    5.6048   -5.1111    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    7.0540   -6.6787    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
 16 17  1  0
  3  4  2  0
 17 18  1  0
  4  5  1  0
 17 19  2  0
  5  6  2  0
 18 20  2  0
  6  1  1  0
 20 21  1  0
  2  7  1  0
 21 22  2  0
  7  8  1  0
 22 23  1  0
  5  9  1  0
 23 24  2  0
 24 18  1  0
  9 10  1  0
 24 25  1  0
 13 14  2  0
 21 26  1  0
 11 12  2  0
 26 27  1  0
 10 11  1  0
 27 28  1  0
 12 13  1  0
 27 29  2  0
 14 10  1  0
 28 30  1  0
 33 34  1  0
 31 32  1  0
 14 15  1  0
  1  2  2  0
 13 16  1  0
 30 31  2  0
 32 33  2  0
 34 30  1  0
  2  3  1  0
 32 35  1  0
M  END

Associated Targets(Human)

HS27 (243 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Molecule Features

Natural Product: NoOral: NoChemical Probe: NoParenteral: No
Molecule Type: Small moleculeTopical: NoFirst In Class: NoBlack Box: No
Chirality: NoAvailability: NoProdrug: No

Drug Indications

MESH IDMESH Heading EFO IDsEFO TermsMax Phase for IndicationReferences

Mechanisms of Action

Mechanism of ActionAction Typetarget IDTarget NameTarget TypeTarget OrganismBinding Site NameReferences

Calculated Properties

Molecular Weight: 475.51Molecular Weight (Monoisotopic): 475.1968AlogP: 4.02#Rotatable Bonds: 7
Polar Surface Area: 149.33Molecular Species: NEUTRALHBA: 8HBD: 4
#RO5 Violations: HBA (Lipinski): 11HBD (Lipinski): 5#RO5 Violations (Lipinski): 1
CX Acidic pKa: 7.08CX Basic pKa: 2.69CX LogP: 2.56CX LogD: 2.11
Aromatic Rings: 4Heavy Atoms: 35QED Weighted: 0.32Np Likeness Score: -2.07

References

1. Kim MH, Kim M, Yu H, Kim H, Yoo KH, Sim T, Hah JM..  (2011)  Structure based design and syntheses of amino-1H-pyrazole amide derivatives as selective Raf kinase inhibitors in melanoma cells.,  19  (6): [PMID:21353571] [10.1016/j.bmc.2011.01.067]

Source