N-(5-Amino-1-(4-methoxybenzyl)-1H-pyrazol-4-yl)-2-methyl-4-(3-(4-(trifluoromethyl)pyrimidin-2-yl)ureido)benzamide

ID: ALA1684817

PubChem CID: 53324962

Max Phase: Preclinical

Molecular Formula: C25H23F3N8O3

Molecular Weight: 540.51

Molecule Type: Small molecule

This compound is available for customization.

Associated Items:

Names and Identifiers

Canonical SMILES:  COc1ccc(Cn2ncc(NC(=O)c3ccc(NC(=O)Nc4nccc(C(F)(F)F)n4)cc3C)c2N)cc1

Standard InChI:  InChI=1S/C25H23F3N8O3/c1-14-11-16(32-24(38)35-23-30-10-9-20(34-23)25(26,27)28)5-8-18(14)22(37)33-19-12-31-36(21(19)29)13-15-3-6-17(39-2)7-4-15/h3-12H,13,29H2,1-2H3,(H,33,37)(H2,30,32,34,35,38)

Standard InChI Key:  XTKCXDSRAGBORX-UHFFFAOYSA-N

Molfile:  

     RDKit          2D

 39 42  0  0  0  0  0  0  0  0999 V2000
   11.1360   -4.3941    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   11.1340   -5.2223    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   11.8506   -5.6358    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   12.5653   -5.2220    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   12.5640   -4.3908    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   11.8479   -3.9812    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   10.4181   -5.6348    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    9.7061   -5.2221    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   13.2757   -3.9783    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   13.9895   -4.3900    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   13.9902   -5.2147    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   14.7731   -5.4723    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   15.2599   -4.8048    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   14.7756   -4.1368    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   15.0320   -3.3526    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   16.0849   -4.8059    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   16.4984   -4.0920    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   17.3234   -4.0931    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   16.0869   -3.3770    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   17.7319   -4.8132    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   18.5562   -4.8147    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   18.9705   -4.1003    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   18.5545   -3.3828    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   17.7317   -3.3849    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   17.3180   -2.6711    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   19.7955   -4.1003    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   20.2080   -3.3858    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   21.0330   -3.3859    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   19.7956   -2.6714    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   21.4455   -4.1004    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   21.0305   -4.8142    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   21.4423   -5.5282    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   22.2682   -5.5287    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   22.6805   -4.8092    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   22.2664   -4.0982    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   23.5055   -4.8064    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   23.9205   -5.5194    0.0000 F   0  0  0  0  0  0  0  0  0  0  0  0
   23.9155   -4.0904    0.0000 F   0  0  0  0  0  0  0  0  0  0  0  0
   24.3292   -4.8042    0.0000 F   0  0  0  0  0  0  0  0  0  0  0  0
 17 19  2  0
  5  6  2  0
 18 20  2  0
  6  1  1  0
 20 21  1  0
  2  7  1  0
 21 22  2  0
  7  8  1  0
 22 23  1  0
  5  9  1  0
 23 24  2  0
 24 18  1  0
  9 10  1  0
 24 25  1  0
 13 14  2  0
 22 26  1  0
 11 12  2  0
 26 27  1  0
 10 11  1  0
 27 28  1  0
 12 13  1  0
 27 29  2  0
 14 10  1  0
 28 30  1  0
 30 31  2  0
 14 15  1  0
 31 32  1  0
  1  2  2  0
 32 33  2  0
 13 16  1  0
 33 34  1  0
  2  3  1  0
 34 35  2  0
 35 30  1  0
 16 17  1  0
 34 36  1  0
  3  4  2  0
 36 37  1  0
 17 18  1  0
 36 38  1  0
  4  5  1  0
 36 39  1  0
M  END

Associated Targets(Human)

HS27 (243 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Molecule Features

Natural Product: NoOral: NoChemical Probe: NoParenteral: No
Molecule Type: Small moleculeTopical: NoFirst In Class: NoBlack Box: No
Chirality: NoAvailability: NoProdrug: No

Drug Indications

MESH IDMESH Heading EFO IDsEFO TermsMax Phase for IndicationReferences

Mechanisms of Action

Mechanism of ActionAction Typetarget IDTarget NameTarget TypeTarget OrganismBinding Site NameReferences

Calculated Properties

Molecular Weight: 540.51Molecular Weight (Monoisotopic): 540.1845AlogP: 4.54#Rotatable Bonds: 7
Polar Surface Area: 149.08Molecular Species: NEUTRALHBA: 8HBD: 4
#RO5 Violations: 1HBA (Lipinski): 11HBD (Lipinski): 5#RO5 Violations (Lipinski): 2
CX Acidic pKa: 10.36CX Basic pKa: 2.69CX LogP: 4.00CX LogD: 4.00
Aromatic Rings: 4Heavy Atoms: 39QED Weighted: 0.27Np Likeness Score: -1.91

References

1. Kim MH, Kim M, Yu H, Kim H, Yoo KH, Sim T, Hah JM..  (2011)  Structure based design and syntheses of amino-1H-pyrazole amide derivatives as selective Raf kinase inhibitors in melanoma cells.,  19  (6): [PMID:21353571] [10.1016/j.bmc.2011.01.067]

Source