2-Amino-4-[2-benzyloxycarbonylsulfanyl-1-(carboxymethyl-carbamoyl)-ethylcarbamoyl]-butyric acid

ID: ALA169316

PubChem CID: 44380789

Max Phase: Preclinical

Molecular Formula: C18H23N3O8S

Molecular Weight: 441.46

Molecule Type: Small molecule

This compound is available for customization.

Associated Items:

Names and Identifiers

Canonical SMILES:  NC(CCC(=O)NC(CSC(=O)OCc1ccccc1)C(=O)NCC(=O)O)C(=O)O

Standard InChI:  InChI=1S/C18H23N3O8S/c19-12(17(26)27)6-7-14(22)21-13(16(25)20-8-15(23)24)10-30-18(28)29-9-11-4-2-1-3-5-11/h1-5,12-13H,6-10,19H2,(H,20,25)(H,21,22)(H,23,24)(H,26,27)

Standard InChI Key:  ASKLIFLGJJZFTM-UHFFFAOYSA-N

Molfile:  

     RDKit          2D

 30 30  0  0  0  0  0  0  0  0999 V2000
    1.2667   -1.1917    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.2667   -0.3667    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.4167   -1.6042    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.5542   -1.6042    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   -1.5875   -3.6792    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.5542   -2.4375    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.9792    0.0458    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    2.7042   -1.1917    0.0000 S   0  0  0  0  0  0  0  0  0  0  0  0
    2.6917    1.2875    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.9875   -1.6042    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.1292   -1.1917    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    0.5542    0.0458    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   -0.8708   -4.0917    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    3.4167   -2.4375    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   -1.5875   -2.8500    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.2750   -2.8500    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    2.6917    2.1208    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    1.9875    0.8750    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -0.8708   -2.4375    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -0.1583   -2.8500    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -2.3000   -4.0917    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   -2.3083   -2.4375    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    3.4125    0.8750    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    2.7042   -2.8500    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.7042   -3.6750    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.4250   -4.0875    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.9917   -4.0875    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.9917   -4.9167    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.4250   -4.9167    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.7042   -5.3292    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
  2  1  1  0
  3  8  1  0
  4  1  1  0
  5 15  1  0
  6  4  1  0
  7  2  1  0
  8 10  1  0
  9 18  1  0
 10  1  1  0
 11  3  2  0
 12  2  2  0
 13  5  2  0
 14  3  1  0
 15 19  1  0
 16  6  2  0
 17  9  2  0
 18  7  1  0
 19 20  1  0
 20  6  1  0
 21  5  1  0
 22 15  1  0
 23  9  1  0
 24 14  1  0
 25 24  1  0
 26 25  2  0
 27 25  1  0
 28 27  2  0
 29 26  1  0
 30 28  1  0
 29 30  2  0
M  END

Associated Targets(non-human)

Hagh Glyoxalase II (10 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Molecule Features

Natural Product: NoOral: NoChemical Probe: NoParenteral: No
Molecule Type: Small moleculeTopical: NoFirst In Class: NoBlack Box: No
Chirality: NoAvailability: NoProdrug: No

Drug Indications

MESH IDMESH Heading EFO IDsEFO TermsMax Phase for IndicationReferences

Mechanisms of Action

Mechanism of ActionAction Typetarget IDTarget NameTarget TypeTarget OrganismBinding Site NameReferences

Calculated Properties

Molecular Weight: 441.46Molecular Weight (Monoisotopic): 441.1206AlogP: -0.07#Rotatable Bonds: 12
Polar Surface Area: 185.12Molecular Species: ZWITTERIONHBA: 8HBD: 5
#RO5 Violations: HBA (Lipinski): 11HBD (Lipinski): 6#RO5 Violations (Lipinski): 2
CX Acidic pKa: 1.71CX Basic pKa: 9.31CX LogP: -2.79CX LogD: -6.04
Aromatic Rings: 1Heavy Atoms: 30QED Weighted: 0.28Np Likeness Score: 0.37

References

1. Bush PE, Norton SJ..  (1985)  S-(nitrocarbobenzoxy)glutathiones: potent competitive inhibitors of mammalian glyoxalase II.,  28  (6): [PMID:4009606] [10.1021/jm00383a025]

Source