The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
SID85272507 ID: ALA1701619
PubChem CID: 44246662
Max Phase: Preclinical
Molecular Formula: C24H26N8O5
Molecular Weight: 506.52
Molecule Type: Small molecule
Associated Items:
Names and Identifiers Canonical SMILES: Nc1ncnc2c1ncn2[C@@H]1O[C@H](CNCc2ccc(OCC(=O)Nc3ccccn3)cc2)[C@@H](O)[C@H]1O
Standard InChI: InChI=1S/C24H26N8O5/c25-22-19-23(29-12-28-22)32(13-30-19)24-21(35)20(34)16(37-24)10-26-9-14-4-6-15(7-5-14)36-11-18(33)31-17-3-1-2-8-27-17/h1-8,12-13,16,20-21,24,26,34-35H,9-11H2,(H2,25,28,29)(H,27,31,33)/t16-,20-,21-,24-/m1/s1
Standard InChI Key: GIRGWHQMUQZUOK-FZGCSJHNSA-N
Molfile:
RDKit 2D
37 41 0 0 1 0 0 0 0 0999 V2000
4.4230 1.5837 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
6.5175 1.1712 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
5.4625 -0.2809 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
2.6794 -3.1575 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
2.8518 -4.7985 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
5.4625 2.6233 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
5.4625 3.9581 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
6.9616 2.4657 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
7.6761 3.7032 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
6.9616 4.9407 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
3.0019 0.6093 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
1.4307 -4.9478 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
0.8495 -6.2532 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
5.2076 1.8386 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.2472 2.8782 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.2472 3.7032 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.6925 1.1712 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.2076 0.5038 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.4230 0.7587 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.9776 3.2907 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.9616 4.1157 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.7555 0.2738 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.6761 2.8782 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.3344 0.1244 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.4207 -0.6961 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.1743 -1.0316 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.7532 -1.1810 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.5931 -2.3370 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.2606 -1.8521 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.8395 -2.0015 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.0982 -4.4629 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.5170 -5.7683 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.0119 -3.6424 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.2706 -6.1039 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.9358 -7.0737 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.3569 -6.9243 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.6894 -7.4093 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1 14 1 0
1 19 1 0
17 2 1 6
18 3 1 6
4 28 1 0
4 33 1 0
5 31 2 0
14 6 1 1
6 15 1 0
6 20 1 0
7 16 1 0
7 20 2 0
8 15 1 0
8 23 2 0
9 21 2 0
9 23 1 0
10 21 1 0
11 22 1 0
11 24 1 0
12 31 1 0
12 32 1 0
13 32 1 0
13 35 2 0
14 17 1 0
15 16 2 0
16 21 1 0
17 18 1 0
18 19 1 0
19 22 1 1
24 25 1 0
25 26 2 0
25 27 1 0
26 29 1 0
27 30 2 0
28 29 2 0
28 30 1 0
31 33 1 0
32 34 2 0
34 36 1 0
35 37 1 0
36 37 2 0
M END Associated Targets(Human) Associated Targets(non-human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: Small moleculeTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 506.52Molecular Weight (Monoisotopic): 506.2026AlogP: 0.23#Rotatable Bonds: 9Polar Surface Area: 182.56Molecular Species: NEUTRALHBA: 12HBD: 5#RO5 Violations: 2HBA (Lipinski): 13HBD (Lipinski): 6#RO5 Violations (Lipinski): 3CX Acidic pKa: 11.53CX Basic pKa: 8.14CX LogP: 0.09CX LogD: -0.72Aromatic Rings: 4Heavy Atoms: 37QED Weighted: 0.21Np Likeness Score: -0.48
References 1. PubChem BioAssay data set, 2. Gibbons GS,Chakraborty A,Grigsby SM,Umeano AC,Liao C,Moukha-Chafiq O,Pathak V,Mathew B,Lee YT,Dou Y,Schürer SC,Reynolds RC,Snowden TS,Nikolovska-Coleska Z. (2020) Identification of DOT1L inhibitors by structure-based virtual screening adapted from a nucleoside-focused library., 189 [PMID:31978781 ] [10.1016/j.ejmech.2019.112023 ]