The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
(S)-2-((S)-4-Carboxy-4-{4-[(2-methyl-4-oxo-3,4-dihydro-quinazolin-6-ylmethyl)-prop-2-ynyl-amino]-benzoylamino}-butyrylamino)-hexanedioic acid ID: ALA170494
PubChem CID: 135405129
Max Phase: Preclinical
Molecular Formula: C31H33N5O9
Molecular Weight: 619.63
Molecule Type: Small molecule
Associated Items:
Names and Identifiers Canonical SMILES: C#CCN(Cc1ccc2nc(C)nc(O)c2c1)c1ccc(C(=O)N[C@@H](CCC(=O)N[C@@H](CCCC(=O)O)C(=O)O)C(=O)O)cc1
Standard InChI: InChI=1S/C31H33N5O9/c1-3-15-36(17-19-7-12-23-22(16-19)29(41)33-18(2)32-23)21-10-8-20(9-11-21)28(40)35-25(31(44)45)13-14-26(37)34-24(30(42)43)5-4-6-27(38)39/h1,7-12,16,24-25H,4-6,13-15,17H2,2H3,(H,34,37)(H,35,40)(H,38,39)(H,42,43)(H,44,45)(H,32,33,41)/t24-,25-/m0/s1
Standard InChI Key: AZGRMFZGDXICGC-DQEYMECFSA-N
Molfile:
RDKit 2D
45 47 0 0 1 0 0 0 0 0999 V2000
-0.3000 -5.7917 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.4250 -6.2042 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.0125 -6.2167 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
-0.3000 -7.4542 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
0.4250 -7.0417 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.0125 -7.0417 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.1500 -4.5167 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.8750 -4.9292 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
7.4500 -6.1417 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
10.9542 -3.8542 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
9.6375 -3.3167 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
3.3000 -6.1917 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
4.0125 -7.4292 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.6125 -5.3417 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
9.4250 -4.1167 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.7250 -7.8417 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.1375 -5.7917 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.4375 -4.9417 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
10.4542 -3.2042 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.0125 -5.7792 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-0.3000 -4.9667 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
12.7000 -1.4417 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.5750 -5.7792 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.1500 -3.6917 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
1.8625 -6.2042 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
8.1375 -6.5667 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
11.7875 -3.7417 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
1.1500 -7.4542 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
9.8625 -4.7417 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
13.0125 -0.6792 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
5.4375 -5.7667 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.7125 -4.5292 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.0000 -4.9542 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.7250 -6.1917 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
8.3625 -5.0042 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
8.5250 -4.2042 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.3000 -7.0167 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
10.6417 -4.6167 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
6.6875 -6.4667 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
1.8625 -7.0292 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
13.2125 -2.0917 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
-1.7250 -7.4542 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
11.8875 -1.5542 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
11.5875 -2.3167 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
10.7625 -2.4417 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2 1 1 0
3 1 2 0
4 6 2 0
5 2 2 0
6 3 1 0
7 18 1 0
8 7 1 0
9 14 1 0
10 19 1 0
11 15 1 0
12 23 1 0
13 37 1 0
14 8 1 0
15 36 1 0
16 13 3 0
17 2 1 0
18 31 2 0
19 11 1 0
20 12 1 0
21 1 1 0
22 43 1 0
23 25 1 0
24 7 2 0
25 17 2 0
26 9 2 0
27 10 2 0
28 5 1 0
29 15 2 0
30 22 2 0
31 34 1 0
32 33 2 0
33 20 1 0
34 20 2 0
14 35 1 1
36 35 1 0
37 12 1 0
38 10 1 0
39 9 1 0
40 25 1 0
41 22 1 0
42 6 1 0
43 44 1 0
44 45 1 0
19 45 1 1
4 5 1 0
40 28 2 0
18 32 1 0
M END Associated Targets(non-human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: Small moleculeTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 619.63Molecular Weight (Monoisotopic): 619.2278AlogP: 2.07#Rotatable Bonds: 16Polar Surface Area: 219.35Molecular Species: ACIDHBA: 9HBD: 6#RO5 Violations: 2HBA (Lipinski): 14HBD (Lipinski): 6#RO5 Violations (Lipinski): 3CX Acidic pKa: 3.09CX Basic pKa: 1.75CX LogP: 2.47CX LogD: -7.16Aromatic Rings: 3Heavy Atoms: 45QED Weighted: 0.13Np Likeness Score: -0.71
References 1. Bavetsias V, Jackman AL, Kimbell R, Gibson W, Boyle FT, Bisset GM.. (1996) Quinazoline antifolate thymidylate synthase inhibitors: gamma-linked L-D, D-D, and D-L dipeptide analogues of 2-desamino-2-methyl-N10-propargyl-5,8-dideazafolic acid (ICI 198583)., 39 (1): [PMID:8568829 ] [10.1021/jm950471+ ]