The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
(R)-2-((S)-4-Carboxy-4-{4-[(2-methyl-4-oxo-3,4-dihydro-quinazolin-6-ylmethyl)-prop-2-ynyl-amino]-benzoylamino}-butyrylamino)-pentanedioic acid TFA ID: ALA170789
PubChem CID: 136078510
Max Phase: Preclinical
Molecular Formula: C32H32F3N5O11
Molecular Weight: 605.60
Molecule Type: Small molecule
Associated Items:
Names and Identifiers Canonical SMILES: C#CCN(Cc1ccc2nc(C)nc(O)c2c1)c1ccc(C(=O)N[C@@H](CCC(=O)N[C@H](CCC(=O)O)C(=O)O)C(=O)O)cc1.O=C(O)C(F)(F)F
Standard InChI: InChI=1S/C30H31N5O9.C2HF3O2/c1-3-14-35(16-18-4-9-22-21(15-18)28(40)32-17(2)31-22)20-7-5-19(6-8-20)27(39)34-24(30(43)44)10-12-25(36)33-23(29(41)42)11-13-26(37)38;3-2(4,5)1(6)7/h1,4-9,15,23-24H,10-14,16H2,2H3,(H,33,36)(H,34,39)(H,37,38)(H,41,42)(H,43,44)(H,31,32,40);(H,6,7)/t23-,24+;/m1./s1
Standard InChI Key: WNDVTFYGTFPZBO-ITNPDYSASA-N
Molfile:
RDKit 2D
51 52 0 0 0 0 0 0 0 0999 V2000
1.7250 -3.1167 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.4375 -2.7042 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.4375 -1.8792 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
1.0667 -3.4917 0.0000 F 0 0 0 0 0 0 0 0 0 0 0 0
0.9167 -2.8042 0.0000 F 0 0 0 0 0 0 0 0 0 0 0 0
1.5792 -3.9667 0.0000 F 0 0 0 0 0 0 0 0 0 0 0 0
3.1500 -3.1167 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
0.4375 -5.6000 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.1542 -6.0125 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-0.2833 -6.0167 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
0.4375 -7.2625 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
1.1542 -6.8417 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-0.2833 -6.8500 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.8875 -4.3167 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.6000 -4.7292 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
8.1750 -5.9417 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
11.5000 -2.4000 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
10.3750 -3.1250 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
4.0250 -6.0000 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
4.7417 -7.2417 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
8.3417 -5.1500 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
10.0667 -3.8917 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.4542 -7.6542 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
10.6875 -2.3375 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.8667 -5.6000 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.1667 -4.7500 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
9.2125 -0.8000 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.7417 -5.5792 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.4292 -4.7750 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
3.3042 -5.5875 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.8750 -3.4917 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
2.5875 -6.0042 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
8.8750 -6.3667 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
11.8250 -1.6500 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
1.8750 -7.2625 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
10.5917 -4.5500 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
9.7917 -0.1875 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
5.4417 -4.3375 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.1750 -5.5750 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.4542 -5.9917 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.7375 -4.7542 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
9.0875 -4.8125 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
10.2500 -1.6500 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
9.2542 -4.0042 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
9.4292 -1.5875 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.0292 -6.8250 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
11.9250 -3.1042 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
7.4167 -6.2750 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
2.5917 -6.8375 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
8.4167 -0.6000 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
-1.0000 -7.2625 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2 1 1 0
3 2 2 0
4 1 1 0
5 1 1 0
6 1 1 0
7 2 1 0
9 8 1 0
10 8 2 0
11 13 2 0
12 9 2 0
13 10 1 0
14 26 1 0
15 14 1 0
16 21 1 0
17 24 1 0
18 22 1 0
19 30 1 0
20 46 1 0
21 15 1 0
22 44 1 0
23 20 3 0
24 18 1 0
25 9 1 0
26 38 1 0
27 45 1 0
28 19 1 0
29 8 1 0
30 32 1 0
31 14 2 0
32 25 2 0
33 16 2 0
34 17 2 0
35 12 1 0
36 22 2 0
37 27 2 0
38 41 2 0
39 40 1 0
40 28 2 0
41 28 1 0
21 42 1 1
24 43 1 6
44 42 1 0
45 43 1 0
46 19 1 0
47 17 1 0
48 16 1 0
49 32 1 0
50 27 1 0
51 13 1 0
12 11 1 0
35 49 2 0
26 39 2 0
M END Associated Targets(Human) Associated Targets(non-human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: Small moleculeTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 605.60Molecular Weight (Monoisotopic): 605.2122AlogP: 1.68#Rotatable Bonds: 15Polar Surface Area: 219.35Molecular Species: ACIDHBA: 9HBD: 6#RO5 Violations: 2HBA (Lipinski): 14HBD (Lipinski): 6#RO5 Violations (Lipinski): 3CX Acidic pKa: 3.06CX Basic pKa: 1.74CX LogP: 2.04CX LogD: -7.64Aromatic Rings: 3Heavy Atoms: 44QED Weighted: 0.14Np Likeness Score: -0.78
References 1. Bavetsias V, Jackman AL, Kimbell R, Gibson W, Boyle FT, Bisset GM.. (1996) Quinazoline antifolate thymidylate synthase inhibitors: gamma-linked L-D, D-D, and D-L dipeptide analogues of 2-desamino-2-methyl-N10-propargyl-5,8-dideazafolic acid (ICI 198583)., 39 (1): [PMID:8568829 ] [10.1021/jm950471+ ]