The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
(S)-4-((R)-1-Carboxy-ethylcarbamoyl)-2-{4-[(2-methyl-4-oxo-3,4-dihydro-quinazolin-6-ylmethyl)-prop-2-ynyl-amino]-benzoylamino}-butyric acid TFA ID: ALA170975
PubChem CID: 135515262
Max Phase: Preclinical
Molecular Formula: C30H30F3N5O9
Molecular Weight: 547.57
Molecule Type: Small molecule
Associated Items:
Names and Identifiers Canonical SMILES: C#CCN(Cc1ccc2nc(C)nc(O)c2c1)c1ccc(C(=O)N[C@@H](CCC(=O)N[C@H](C)C(=O)O)C(=O)O)cc1.O=C(O)C(F)(F)F
Standard InChI: InChI=1S/C28H29N5O7.C2HF3O2/c1-4-13-33(15-18-5-10-22-21(14-18)26(36)31-17(3)30-22)20-8-6-19(7-9-20)25(35)32-23(28(39)40)11-12-24(34)29-16(2)27(37)38;3-2(4,5)1(6)7/h1,5-10,14,16,23H,11-13,15H2,2-3H3,(H,29,34)(H,32,35)(H,37,38)(H,39,40)(H,30,31,36);(H,6,7)/t16-,23+;/m1./s1
Standard InChI Key: WUVGYWHYLYAAPX-LJTXTEAOSA-N
Molfile:
RDKit 2D
47 48 0 0 0 0 0 0 0 0999 V2000
10.3042 -7.2000 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
11.0167 -6.7875 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
11.0167 -5.9625 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
9.6542 -7.5750 0.0000 F 0 0 0 0 0 0 0 0 0 0 0 0
9.5000 -6.8917 0.0000 F 0 0 0 0 0 0 0 0 0 0 0 0
10.1667 -8.0500 0.0000 F 0 0 0 0 0 0 0 0 0 0 0 0
11.7292 -7.2000 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
0.4125 -4.6667 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.1375 -5.0792 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-0.3000 -5.0792 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
0.4125 -6.3292 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
1.1375 -5.9042 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-0.3000 -5.9167 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.8625 -3.3917 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.5875 -3.7917 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
8.1625 -5.0042 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
11.4750 -1.4667 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
10.3500 -2.1917 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
4.0125 -5.0667 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
4.7250 -6.3042 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
8.3250 -4.2167 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
10.0500 -2.9542 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.4375 -6.7167 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.8500 -4.6667 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.1500 -3.8167 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
10.6417 -1.4417 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.7250 -4.6417 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.4125 -3.8417 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
3.2875 -4.6542 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.8625 -2.5542 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
2.5750 -5.0667 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
11.7750 -0.7042 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
8.8500 -5.4292 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
1.8625 -6.3292 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
10.5750 -3.6167 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
5.4250 -3.4042 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.1500 -4.6417 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.4375 -5.0542 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.7125 -3.8167 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
9.0625 -3.8792 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
9.2375 -3.0667 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.0125 -5.8917 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
11.9375 -2.1542 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
7.4000 -5.3417 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
2.5750 -5.9042 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.0125 -6.3292 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
10.1750 -0.7667 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2 1 1 0
3 2 2 0
4 1 1 0
5 1 1 0
6 1 1 0
7 2 1 0
9 8 1 0
10 8 2 0
11 13 2 0
12 9 2 0
13 10 1 0
14 25 1 0
15 14 1 0
16 21 1 0
17 26 1 0
18 22 1 0
19 29 1 0
20 42 1 0
21 15 1 0
22 41 1 0
23 20 3 0
24 9 1 0
25 36 1 0
26 18 1 0
27 19 1 0
28 8 1 0
29 31 1 0
30 14 2 0
31 24 2 0
32 17 2 0
33 16 2 0
34 12 1 0
35 22 2 0
36 39 2 0
37 38 1 0
38 27 2 0
39 27 1 0
21 40 1 1
41 40 1 0
42 19 1 0
43 17 1 0
44 16 1 0
45 31 1 0
46 13 1 0
26 47 1 6
12 11 1 0
34 45 2 0
25 37 2 0
M END Associated Targets(Human) Associated Targets(non-human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: Small moleculeTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 547.57Molecular Weight (Monoisotopic): 547.2067AlogP: 1.84#Rotatable Bonds: 12Polar Surface Area: 182.05Molecular Species: ACIDHBA: 8HBD: 5#RO5 Violations: 1HBA (Lipinski): 12HBD (Lipinski): 5#RO5 Violations (Lipinski): 2CX Acidic pKa: 3.15CX Basic pKa: 1.75CX LogP: 2.41CX LogD: -4.16Aromatic Rings: 3Heavy Atoms: 40QED Weighted: 0.21Np Likeness Score: -1.00
References 1. Bavetsias V, Jackman AL, Kimbell R, Gibson W, Boyle FT, Bisset GM.. (1996) Quinazoline antifolate thymidylate synthase inhibitors: gamma-linked L-D, D-D, and D-L dipeptide analogues of 2-desamino-2-methyl-N10-propargyl-5,8-dideazafolic acid (ICI 198583)., 39 (1): [PMID:8568829 ] [10.1021/jm950471+ ]