N-Benzyl-2-(bicyclo[2.2.1]hept-2-yloxy)-nicotinamide

ID: ALA171141

PubChem CID: 14555268

Max Phase: Preclinical

Molecular Formula: C20H22N2O2

Molecular Weight: 322.41

Molecule Type: Small molecule

Associated Items:

This compound is not in our inventory system

Names and Identifiers

Canonical SMILES:  O=C(NCc1ccccc1)c1cccnc1OC1CC2CCC1C2

Standard InChI:  InChI=1S/C20H22N2O2/c23-19(22-13-14-5-2-1-3-6-14)17-7-4-10-21-20(17)24-18-12-15-8-9-16(18)11-15/h1-7,10,15-16,18H,8-9,11-13H2,(H,22,23)

Standard InChI Key:  YRADNWKOQRRDFI-UHFFFAOYSA-N

Molfile:  

     RDKit          2D

 24 27  0  0  0  0  0  0  0  0999 V2000
    2.9542   -4.7417    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.9542   -4.1292    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.4667   -3.8292    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.4750   -5.0417    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    3.4792   -5.6417    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.9625   -5.9042    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.9917   -4.1292    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    2.4292   -5.0417    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    3.9667   -5.8917    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.0250   -5.3417    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.4667   -3.2292    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    3.4417   -6.1542    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.8042   -6.5125    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.5042   -3.8292    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.2750   -6.7875    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.4292   -3.8375    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.0292   -4.1250    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.9167   -4.7417    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.0292   -4.7250    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.5417   -3.8167    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.9167   -4.1292    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.0667   -4.1167    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.5542   -5.0167    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.0667   -4.7167    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
  2  1  1  0
  3  2  1  0
  4  1  1  0
  5  4  1  0
  6  5  1  0
  7  3  1  0
  8  1  2  0
  9  5  1  0
 10  6  1  0
 11  3  2  0
 12  9  1  0
 13  6  1  0
 14  7  1  0
 15 12  1  0
 16  2  2  0
 17 14  1  0
 18  8  1  0
 19 17  2  0
 20 17  1  0
 21 18  2  0
 22 20  2  0
 23 19  1  0
 24 22  1  0
 16 21  1  0
 12 10  1  0
 13 15  1  0
 23 24  2  0
M  END

Associated Targets(non-human)

Pde4d Phosphodiesterase 4 (578 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID
Mus musculus (284745 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Molecule Features

Natural Product: NoOral: NoChemical Probe: NoParenteral: No
Molecule Type: Small moleculeTopical: NoFirst In Class: NoBlack Box: No
Chirality: NoAvailability: NoProdrug: No

Drug Indications

MESH IDMESH Heading EFO IDsEFO TermsMax Phase for IndicationReferences

Mechanisms of Action

Mechanism of ActionAction Typetarget IDTarget NameTarget TypeTarget OrganismBinding Site NameReferences

Calculated Properties

Molecular Weight: 322.41Molecular Weight (Monoisotopic): 322.1681AlogP: 3.58#Rotatable Bonds: 5
Polar Surface Area: 51.22Molecular Species: NEUTRALHBA: 3HBD: 1
#RO5 Violations: HBA (Lipinski): 4HBD (Lipinski): 1#RO5 Violations (Lipinski):
CX Acidic pKa: 13.06CX Basic pKa: 1.62CX LogP: 3.53CX LogD: 3.53
Aromatic Rings: 2Heavy Atoms: 24QED Weighted: 0.92Np Likeness Score: -0.86

References

1. Vinick FJ, Saccomano NA, Koe BK, Nielsen JA, Williams IH, Thadeio PF, Jung S, Meltz M, Johnson J, Lebel LA..  (1991)  Nicotinamide ethers: novel inhibitors of calcium-independent phosphodiesterase and [3H]rolipram binding.,  34  (1): [PMID:1825116] [10.1021/jm00105a015]

Source