The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
(1-Allyl-1H-benzoimidazol-2-yl)-(3-methyl-4-{3-[(pyridin-3-ylmethyl)-amino]-propoxy}-benzofuran-2-yl)-methanone ID: ALA171506
PubChem CID: 500960
Max Phase: Preclinical
Molecular Formula: C29H28N4O3
Molecular Weight: 480.57
Molecule Type: Small molecule
Associated Items:
Names and Identifiers Canonical SMILES: C=CCn1c(C(=O)c2oc3cccc(OCCCNCc4cccnc4)c3c2C)nc2ccccc21
Standard InChI: InChI=1S/C29H28N4O3/c1-3-16-33-23-11-5-4-10-22(23)32-29(33)27(34)28-20(2)26-24(12-6-13-25(26)36-28)35-17-8-15-31-19-21-9-7-14-30-18-21/h3-7,9-14,18,31H,1,8,15-17,19H2,2H3
Standard InChI Key: IHYFRBDAUXNJOF-UHFFFAOYSA-N
Molfile:
RDKit 2D
36 40 0 0 0 0 0 0 0 0999 V2000
4.9792 -0.3667 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.7417 0.3458 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.5667 0.3458 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.6417 -1.1167 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
5.8000 -0.4542 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
3.2542 1.0125 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.2542 -0.3250 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
2.4667 0.7583 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.4667 -0.0667 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.9667 -1.2625 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.2542 -1.6667 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.9792 1.0583 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
1.7542 1.1708 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.3125 3.2458 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
6.3500 0.1583 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.1542 -0.0042 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.7042 0.6083 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.8917 3.2333 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.5042 1.7958 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.7542 -0.4875 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.4625 3.2333 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
1.7500 1.9958 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
4.5917 3.6500 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.6792 -1.6667 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.0292 3.2333 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.2542 -2.4917 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.1750 3.6458 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.0417 -0.0750 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.0417 0.7500 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.3167 2.4125 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.7417 3.6458 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.0375 2.4000 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.8875 2.4083 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.6042 2.0000 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.6792 -2.4875 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.9667 -2.9042 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2 3 1 0
3 1 1 0
4 1 2 0
5 1 1 0
6 2 2 0
7 2 1 0
8 6 1 0
9 7 1 0
10 5 1 0
11 4 1 0
12 3 2 0
13 8 2 0
14 23 2 0
15 5 1 0
16 15 1 0
17 16 2 0
18 27 1 0
19 6 1 0
20 9 2 0
21 31 1 0
22 13 1 0
23 18 1 0
24 10 1 0
25 32 1 0
26 11 1 0
27 21 1 0
28 20 1 0
29 13 1 0
30 34 2 0
31 25 1 0
32 22 1 0
33 18 2 0
34 33 1 0
35 24 2 0
36 26 2 0
10 11 2 0
36 35 1 0
8 9 1 0
29 28 2 0
14 30 1 0
M END Associated Targets(Human) Associated Targets(non-human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: Small moleculeTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 480.57Molecular Weight (Monoisotopic): 480.2161AlogP: 5.46#Rotatable Bonds: 11Polar Surface Area: 82.18Molecular Species: BASEHBA: 7HBD: 1#RO5 Violations: 1HBA (Lipinski): 7HBD (Lipinski): 1#RO5 Violations (Lipinski): 1CX Acidic pKa: ┄CX Basic pKa: 8.70CX LogP: 4.69CX LogD: 3.37Aromatic Rings: 5Heavy Atoms: 36QED Weighted: 0.15Np Likeness Score: -1.14
References 1. Kawasaki K, Masubuchi M, Morikami K, Sogabe S, Aoyama T, Ebiike H, Niizuma S, Hayase M, Fujii T, Sakata K, Shindoh H, Shiratori Y, Aoki Y, Ohtsuka T, Shimma N.. (2003) Design and synthesis of novel benzofurans as a new class of antifungal agents targeting fungal N-myristoyltransferase. Part 3., 13 (1): [PMID:12467623 ] [10.1016/s0960-894x(02)00844-2 ]