The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
SID87337274 ID: ALA1720757
Cas Number: 326916-05-6
PubChem CID: 44601718
Max Phase: Preclinical
Molecular Formula: C26H22Cl2FN3O2
Molecular Weight: 498.39
Molecule Type: Small molecule
Associated Items:
Names and Identifiers Canonical SMILES: N#C/C(=C/C1=C(N2CCOCC2)/C(=C/c2ccc(Cl)cc2Cl)CC1)C(=O)Nc1ccccc1F
Standard InChI: InChI=1S/C26H22Cl2FN3O2/c27-21-8-7-17(22(28)15-21)13-18-5-6-19(25(18)32-9-11-34-12-10-32)14-20(16-30)26(33)31-24-4-2-1-3-23(24)29/h1-4,7-8,13-15H,5-6,9-12H2,(H,31,33)/b18-13+,20-14-
Standard InChI Key: RHRADDNSRSJNRL-DKPWPWCWSA-N
Molfile:
RDKit 2D
34 37 0 0 0 0 0 0 0 0999 V2000
0.4278 -0.8998 0.0000 Cl 0 0 0 0 0 0 0 0 0 0 0 0
1.3109 -3.6178 0.0000 Cl 0 0 0 0 0 0 0 0 0 0 0 0
-2.1333 -3.5335 0.0000 F 0 0 0 0 0 0 0 0 0 0 0 0
-2.5935 1.2954 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
-5.1002 -3.3207 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
-2.5935 -0.3546 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
-3.7025 -3.0236 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
-6.2279 -1.4518 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
-2.5935 -1.1796 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.9261 -1.6646 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-3.2609 -1.6646 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-2.1810 -2.4492 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-3.0060 -2.4492 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.1414 -1.4096 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-4.0456 -1.4096 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-0.5284 -1.9617 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-4.6587 -1.9617 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.8790 0.0579 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-3.3080 0.0579 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.2563 -1.7067 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-4.4871 -2.7686 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-0.6999 -2.7686 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.8694 -2.2588 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-3.5310 -3.8305 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.8790 0.8829 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-3.3080 0.8829 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.6978 -3.0657 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-5.4433 -1.7067 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-0.0868 -3.3207 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-2.7464 -4.0855 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-4.1441 -4.3826 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-2.5748 -4.8925 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-3.9726 -5.1896 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-3.1879 -5.4445 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1 20 1 0
2 27 1 0
3 30 1 0
4 25 1 0
4 26 1 0
5 21 2 0
6 9 1 0
6 18 1 0
6 19 1 0
7 21 1 0
7 24 1 0
8 28 3 0
9 10 1 0
9 11 2 0
10 12 1 0
10 14 2 0
11 13 1 0
11 15 1 0
12 13 1 0
14 16 1 0
15 17 2 0
16 20 1 0
16 22 2 0
17 21 1 0
17 28 1 0
18 25 1 0
19 26 1 0
20 23 2 0
22 29 1 0
23 27 1 0
24 30 1 0
24 31 2 0
27 29 2 0
30 32 2 0
31 33 1 0
32 34 1 0
33 34 2 0
M END Associated Targets(Human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: Small moleculeTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 498.39Molecular Weight (Monoisotopic): 497.1073AlogP: 5.98#Rotatable Bonds: 5Polar Surface Area: 65.36Molecular Species: NEUTRALHBA: 4HBD: 1#RO5 Violations: 1HBA (Lipinski): 5HBD (Lipinski): 1#RO5 Violations (Lipinski): 1CX Acidic pKa: 11.28CX Basic pKa: 4.62CX LogP: 5.10CX LogD: 5.10Aromatic Rings: 2Heavy Atoms: 34QED Weighted: 0.41Np Likeness Score: -1.61
References 1. PubChem BioAssay data set,