The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
2-{4-[(2,4-Diamino-pteridin-6-ylmethyl)-methyl-amino]-benzoylamino}-6-(2-iodo-acetylamino)-hexanoic acid ID: ALA172658
PubChem CID: 44384841
Max Phase: Preclinical
Molecular Formula: C23H28IN9O4
Molecular Weight: 621.44
Molecule Type: Small molecule
This compound is available for customization.
Associated Items:
Names and Identifiers Canonical SMILES: CN(Cc1cnc2nc(N)nc(N)c2n1)c1ccc(C(=O)NC(CCCCNC(=O)CI)C(=O)O)cc1
Standard InChI: InChI=1S/C23H28IN9O4/c1-33(12-14-11-28-20-18(29-14)19(25)31-23(26)32-20)15-7-5-13(6-8-15)21(35)30-16(22(36)37)4-2-3-9-27-17(34)10-24/h5-8,11,16H,2-4,9-10,12H2,1H3,(H,27,34)(H,30,35)(H,36,37)(H4,25,26,28,31,32)
Standard InChI Key: NDRPUTRIAJPVPS-UHFFFAOYSA-N
Molfile:
RDKit 2D
37 39 0 0 0 0 0 0 0 0999 V2000
-1.4833 -4.7292 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
-0.7583 -5.9792 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
-0.0500 -4.7292 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-0.0500 -5.5667 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-0.7583 -4.3167 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.4750 -5.5667 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.6625 -4.3167 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
5.7000 -3.0542 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.6625 -5.9792 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
6.4167 -3.4667 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
1.3792 -4.7292 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.8625 -3.4667 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.8250 -4.7292 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
7.1417 -3.0542 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.9792 -3.4750 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.1042 -4.3125 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.5417 -4.3125 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
9.2875 0.6875 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.6917 -2.2250 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
7.8667 -4.3000 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
1.3792 -5.5667 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
9.2792 1.5208 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
-0.7583 -3.4875 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
4.9792 -4.3125 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.2542 -3.0625 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.2625 -4.7250 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.5375 -3.4792 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-2.1958 -5.9792 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
8.5667 0.2750 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
8.5792 -3.0417 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
10.0042 -0.5417 0.0000 I 0 0 0 0 0 0 0 0 0 0 0 0
10.0000 0.2833 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.8292 -5.5625 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.1375 -2.2167 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
8.5750 -0.5500 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.8542 -1.8042 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.8542 -0.9667 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2 6 2 0
3 5 1 0
4 2 1 0
5 1 2 0
6 1 1 0
7 3 2 0
8 15 1 0
9 4 2 0
10 8 1 0
11 7 1 0
12 14 1 0
13 16 1 0
14 10 1 0
15 25 1 0
16 11 1 0
17 13 1 0
18 29 1 0
19 8 2 0
20 12 2 0
21 9 1 0
22 18 2 0
23 5 1 0
24 26 1 0
25 27 2 0
26 17 2 0
27 17 1 0
28 6 1 0
29 35 1 0
30 12 1 0
31 32 1 0
32 18 1 0
33 13 1 0
34 14 1 0
35 37 1 0
36 34 1 0
37 36 1 0
3 4 1 0
11 21 2 0
24 15 2 0
M END Associated Targets(non-human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: Small moleculeTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 621.44Molecular Weight (Monoisotopic): 621.1309AlogP: 1.13#Rotatable Bonds: 12Polar Surface Area: 202.34Molecular Species: ACIDHBA: 10HBD: 5#RO5 Violations: 1HBA (Lipinski): 13HBD (Lipinski): 7#RO5 Violations (Lipinski): 3CX Acidic pKa: 3.21CX Basic pKa: 2.79CX LogP: 0.75CX LogD: -2.46Aromatic Rings: 3Heavy Atoms: 37QED Weighted: 0.11Np Likeness Score: -0.67
References 1. Rosowsky A, Wright JE, Ginty C, Uren J.. (1982) Methotrexate analogues. 15. A methotrexate analogue designed for active-site-directed irreversible inactivation of dihydrofolate reductase., 25 (8): [PMID:6811744 ] [10.1021/jm00350a015 ]