The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
SID48410297 ID: ALA1728362
PubChem CID: 24178230
Max Phase: Preclinical
Molecular Formula: C27H18N4O3
Molecular Weight: 446.47
Molecule Type: Small molecule
This compound is available for customization.
Associated Items:
Names and Identifiers Canonical SMILES: O=C(Nc1ccc2nc(-c3ccco3)c(-c3ccco3)nc2c1)Nc1cccc2ccccc12
Standard InChI: InChI=1S/C27H18N4O3/c32-27(31-20-9-3-7-17-6-1-2-8-19(17)20)28-18-12-13-21-22(16-18)30-26(24-11-5-15-34-24)25(29-21)23-10-4-14-33-23/h1-16H,(H2,28,31,32)
Standard InChI Key: RUNFURRWVLSJGU-UHFFFAOYSA-N
Molfile:
RDKit 2D
34 39 0 0 0 0 0 0 0 0999 V2000
-1.3883 -3.4858 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
-2.9035 -1.8403 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
0.7081 1.9491 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
-0.0064 -1.7634 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
-1.4353 -0.9384 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
1.4226 0.7116 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
2.1370 1.9491 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
-0.7209 -2.1759 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.4353 -1.7634 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-0.0064 -0.9384 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-0.7209 -0.5259 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-0.7209 -3.0009 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-2.1498 -2.1759 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.7081 -0.5259 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.7081 0.2991 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-0.7209 0.2991 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-0.0064 0.7116 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-0.0534 -3.4858 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-2.2360 -2.9964 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.8515 3.1866 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.1370 2.7741 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.4226 1.5366 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.1334 -4.2704 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-0.3084 -4.2704 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-3.4555 -2.4534 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-3.0430 -3.1679 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.8515 4.0116 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.4226 3.1866 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.5660 2.7741 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.1370 4.4241 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.5660 4.4241 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.4226 4.0116 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.2804 3.1866 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.2804 4.0116 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1 12 1 0
1 23 1 0
2 13 1 0
2 25 1 0
3 22 2 0
4 8 2 0
4 10 1 0
5 9 2 0
5 11 1 0
6 15 1 0
6 22 1 0
7 21 1 0
7 22 1 0
8 9 1 0
8 12 1 0
9 13 1 0
10 11 2 0
10 14 1 0
11 16 1 0
12 18 2 0
13 19 2 0
14 15 2 0
15 17 1 0
16 17 2 0
18 24 1 0
19 26 1 0
20 21 1 0
20 27 2 0
20 29 1 0
21 28 2 0
23 24 2 0
25 26 2 0
27 30 1 0
27 31 1 0
28 32 1 0
29 33 2 0
30 32 2 0
31 34 2 0
33 34 1 0
M END Associated Targets(Human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: Small moleculeTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 446.47Molecular Weight (Monoisotopic): 446.1379AlogP: 6.95#Rotatable Bonds: 4Polar Surface Area: 93.19Molecular Species: NEUTRALHBA: 5HBD: 2#RO5 Violations: 1HBA (Lipinski): 7HBD (Lipinski): 2#RO5 Violations (Lipinski): 1CX Acidic pKa: 11.18CX Basic pKa: ┄CX LogP: 5.62CX LogD: 5.62Aromatic Rings: 6Heavy Atoms: 34QED Weighted: 0.31Np Likeness Score: -1.36
References 1. PubChem BioAssay data set,