The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
SID87692460 ID: ALA1729177
PubChem CID: 44631804
Max Phase: Preclinical
Molecular Formula: C23H24F3N3O4
Molecular Weight: 349.43
Molecule Type: Small molecule
Associated Items:
Names and Identifiers Canonical SMILES: CN1CCCC1CCNC(=O)c1cc(-c2ccco2)nc2ccccc12.O=C(O)C(F)(F)F
Standard InChI: InChI=1S/C21H23N3O2.C2HF3O2/c1-24-12-4-6-15(24)10-11-22-21(25)17-14-19(20-9-5-13-26-20)23-18-8-3-2-7-16(17)18;3-2(4,5)1(6)7/h2-3,5,7-9,13-15H,4,6,10-12H2,1H3,(H,22,25);(H,6,7)
Standard InChI Key: KCAKFPBQYUEZLI-UHFFFAOYSA-N
Molfile:
RDKit 2D
33 35 0 0 0 0 0 0 0 0999 V2000
4.7837 2.9752 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
7.0133 -0.7328 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
6.2989 2.1547 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
5.5844 -0.7328 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
4.2025 -3.2802 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
7.0133 0.9172 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.2989 0.5047 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.0133 1.7422 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.5844 1.7422 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.5844 0.9172 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.8699 2.1547 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.2989 -0.3203 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.7278 0.5047 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.7278 2.1547 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.1162 1.8191 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
8.4423 0.9172 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
8.4423 1.7422 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.9767 3.1467 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.5642 2.4322 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.5844 -1.5578 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.8699 -2.7953 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.8699 -1.9703 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.5374 -3.2802 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.4574 -4.0649 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.2824 -4.0649 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.4179 -3.0253 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.1786 0.0000 0.0000 F 0 0 0 0 0 0 0 0 0 0 0 0
0.3536 0.8250 0.0000 F 0 0 0 0 0 0 0 0 0 0 0 0
0.3536 -0.8250 0.0000 F 0 0 0 0 0 0 0 0 0 0 0 0
-0.8839 -0.7145 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
-0.8839 0.7145 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
0.3536 0.0000 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-0.4714 0.0000 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1 11 1 0
1 18 1 0
2 12 2 0
3 8 2 0
3 9 1 0
4 12 1 0
4 20 1 0
5 21 1 0
5 24 1 0
5 26 1 0
6 7 2 0
6 8 1 0
6 13 1 0
7 10 1 0
7 12 1 0
8 14 1 0
9 10 2 0
9 11 1 0
11 15 2 0
13 16 2 0
14 17 2 0
15 19 1 0
16 17 1 0
18 19 2 0
20 22 1 0
21 22 1 0
21 23 1 0
23 25 1 0
24 25 1 0
27 32 1 0
28 32 1 0
29 32 1 0
30 33 2 0
31 33 1 0
32 33 1 0
M END Associated Targets(Human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: Small moleculeTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 349.43Molecular Weight (Monoisotopic): 349.1790AlogP: 3.71#Rotatable Bonds: 5Polar Surface Area: 58.37Molecular Species: BASEHBA: 4HBD: 1#RO5 Violations: ┄HBA (Lipinski): 5HBD (Lipinski): 1#RO5 Violations (Lipinski): ┄CX Acidic pKa: ┄CX Basic pKa: 9.29CX LogP: 2.84CX LogD: 0.95Aromatic Rings: 3Heavy Atoms: 26QED Weighted: 0.76Np Likeness Score: -1.40
References 1. PubChem BioAssay data set,