SID87544755

ID: ALA1729903

PubChem CID: 2860833

Max Phase: Preclinical

Molecular Formula: C18H17NO4

Molecular Weight: 311.34

Molecule Type: Small molecule

Associated Items:

This compound is not in our inventory system

Names and Identifiers

Canonical SMILES:  CC(=O)Oc1ccc(N2C(=O)C3C4C=CC(CC4)C3C2=O)cc1

Standard InChI:  InChI=1S/C18H17NO4/c1-10(20)23-14-8-6-13(7-9-14)19-17(21)15-11-2-3-12(5-4-11)16(15)18(19)22/h2-3,6-9,11-12,15-16H,4-5H2,1H3

Standard InChI Key:  NUKVTKVDDZWCBT-UHFFFAOYSA-N

Molfile:  

     RDKit          2D

 23 26  0  0  0  0  0  0  0  0999 V2000
   -0.9442   -1.6015    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   -1.5137    1.2462    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    2.2325    0.5147    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    3.5861    0.0567    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   -1.0034   -0.1325    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   -2.1674   -0.7860    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -2.3292    0.0230    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.3480   -0.8821    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.6098    0.4268    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -2.9159   -0.4391    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -3.0586    0.3093    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -0.1944    0.0293    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -3.7552   -0.7980    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -3.8624   -0.0426    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -2.7762    0.5995    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -3.0209    1.2054    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.0699    0.8108    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.3502   -0.5904    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.4235    0.3529    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.8789    0.9726    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.1592   -0.4286    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.7771   -0.1050    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.5127   -0.8865    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
  1  8  2  0
  2  9  2  0
  3 19  1  0
  3 22  1  0
  4 22  2  0
  5  8  1  0
  5  9  1  0
  5 12  1  0
  6  7  1  0
  6  8  1  0
  6 10  1  0
  7  9  1  0
  7 11  1  0
 10 13  1  0
 10 15  1  0
 11 14  1  0
 11 16  1  0
 12 17  2  0
 12 18  1  0
 13 14  2  0
 15 16  1  0
 17 20  1  0
 18 21  2  0
 19 20  2  0
 19 21  1  0
 22 23  1  0
M  END

Associated Targets(Human)

CACNA1B Tclin Voltage-gated N-type calcium channel alpha-1B subunit/Amyloid beta A4 precursor protein-binding family A member 1 (925 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Molecule Features

Natural Product: NoOral: NoChemical Probe: NoParenteral: No
Molecule Type: Small moleculeTopical: NoFirst In Class: NoBlack Box: No
Chirality: NoAvailability: NoProdrug: No

Drug Indications

MESH IDMESH Heading EFO IDsEFO TermsMax Phase for IndicationReferences

Mechanisms of Action

Mechanism of ActionAction Typetarget IDTarget NameTarget TypeTarget OrganismBinding Site NameReferences

Calculated Properties

Molecular Weight: 311.34Molecular Weight (Monoisotopic): 311.1158AlogP: 2.31#Rotatable Bonds: 2
Polar Surface Area: 63.68Molecular Species: NEUTRALHBA: 4HBD:
#RO5 Violations: HBA (Lipinski): 5HBD (Lipinski): #RO5 Violations (Lipinski):
CX Acidic pKa: CX Basic pKa: CX LogP: 1.76CX LogD: 1.76
Aromatic Rings: 1Heavy Atoms: 23QED Weighted: 0.36Np Likeness Score: -0.19

References

1. PubChem BioAssay data set, 

Source

Source(1):