The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
SID87345608 ID: ALA1730382
PubChem CID: 44601945
Max Phase: Preclinical
Molecular Formula: C29H29NO4S
Molecular Weight: 487.62
Molecule Type: Small molecule
Associated Items:
Names and Identifiers Canonical SMILES: COc1ccc(-c2sc3cc4c(cc3c2-c2ccc(OCCN3CCCCC3)cc2)OCO4)cc1
Standard InChI: InChI=1S/C29H29NO4S/c1-31-22-9-7-21(8-10-22)29-28(24-17-25-26(34-19-33-25)18-27(24)35-29)20-5-11-23(12-6-20)32-16-15-30-13-3-2-4-14-30/h5-12,17-18H,2-4,13-16,19H2,1H3
Standard InChI Key: GHDUUBQWEJBITR-UHFFFAOYSA-N
Molfile:
RDKit 2D
35 40 0 0 0 0 0 0 0 0999 V2000
-2.5245 -4.0923 0.0000 S 0 0 0 0 0 0 0 0 0 0 0 0
-5.5227 -2.7575 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
-5.5227 -4.0923 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
-1.5047 0.3810 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
1.2604 -3.4249 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
0.3641 1.5087 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
-2.5245 -2.7575 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-3.3091 -3.0124 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-2.0396 -3.4249 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-3.3091 -3.8374 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-2.2696 -1.9728 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-4.0236 -2.5999 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-4.7381 -3.0124 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-4.7381 -3.8374 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.2146 -3.4249 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-4.0236 -4.2499 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-2.8216 -1.3597 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.4626 -1.8013 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-0.8021 -2.7104 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-0.8021 -4.1394 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-6.0076 -3.4249 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-2.5667 -0.5751 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.2076 -1.0167 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.7597 -0.4036 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.0229 -2.7104 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.0229 -4.1394 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.4354 -3.4249 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-0.6978 0.5526 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-0.4428 1.3372 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.6729 -4.1394 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.6191 2.2933 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.9162 0.8956 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.4260 2.4649 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.7231 1.0671 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.9781 1.8518 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1 9 1 0
1 10 1 0
2 13 1 0
2 21 1 0
3 14 1 0
3 21 1 0
4 24 1 0
4 28 1 0
5 27 1 0
5 30 1 0
6 29 1 0
6 31 1 0
6 32 1 0
7 8 1 0
7 9 2 0
7 11 1 0
8 10 1 0
8 12 2 0
9 15 1 0
10 16 2 0
11 17 2 0
11 18 1 0
12 13 1 0
13 14 2 0
14 16 1 0
15 19 2 0
15 20 1 0
17 22 1 0
18 23 2 0
19 25 1 0
20 26 2 0
22 24 2 0
23 24 1 0
25 27 2 0
26 27 1 0
28 29 1 0
31 33 1 0
32 34 1 0
33 35 1 0
34 35 1 0
M END Associated Targets(Human) Associated Targets(non-human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: Small moleculeTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 487.62Molecular Weight (Monoisotopic): 487.1817AlogP: 6.84#Rotatable Bonds: 7Polar Surface Area: 40.16Molecular Species: BASEHBA: 6HBD: ┄#RO5 Violations: 1HBA (Lipinski): 5HBD (Lipinski): ┄#RO5 Violations (Lipinski): 1CX Acidic pKa: ┄CX Basic pKa: 8.81CX LogP: 6.32CX LogD: 4.89Aromatic Rings: 4Heavy Atoms: 35QED Weighted: 0.29Np Likeness Score: -0.70
References 1. PubChem BioAssay data set,