The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
SID56373836 ID: ALA1731605
PubChem CID: 2553264
Max Phase: Preclinical
Molecular Formula: C23H17ClN2O4
Molecular Weight: 420.85
Molecule Type: Small molecule
Associated Items:
Names and Identifiers Canonical SMILES: O=C(COC(=O)c1cc(-c2ccco2)nc2ccccc12)NCc1ccc(Cl)cc1
Standard InChI: InChI=1S/C23H17ClN2O4/c24-16-9-7-15(8-10-16)13-25-22(27)14-30-23(28)18-12-20(21-6-3-11-29-21)26-19-5-2-1-4-17(18)19/h1-12H,13-14H2,(H,25,27)
Standard InChI Key: JADGLVYNRHIESM-UHFFFAOYSA-N
Molfile:
RDKit 2D
30 33 0 0 0 0 0 0 0 0999 V2000
6.2282 -0.5781 0.0000 Cl 0 0 0 0 0 0 0 0 0 0 0 0
-3.8136 0.9950 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
0.5124 1.0719 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
-0.2021 -0.1656 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
1.9413 1.8969 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
-2.3455 1.8969 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
2.6558 0.6594 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
-0.9165 1.8969 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-0.9165 1.0719 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.6310 2.3094 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-2.3455 1.0719 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.6310 0.6594 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-3.0600 0.6594 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-0.2021 0.6594 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-0.2021 2.3094 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.6310 3.1344 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-3.1462 -0.1610 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-0.2021 3.1344 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-0.9165 3.5469 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-4.3657 0.3819 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-3.9532 -0.3326 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.2269 0.6594 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.9413 1.0719 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.0847 0.6594 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.3703 1.0719 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.7992 1.0719 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.0847 -0.1656 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.5137 -0.1656 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.5137 0.6594 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.7992 -0.5781 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1 28 1 0
2 13 1 0
2 20 1 0
3 14 1 0
3 22 1 0
4 14 2 0
5 23 2 0
6 10 2 0
6 11 1 0
7 23 1 0
7 25 1 0
8 9 2 0
8 10 1 0
8 15 1 0
9 12 1 0
9 14 1 0
10 16 1 0
11 12 2 0
11 13 1 0
13 17 2 0
15 18 2 0
16 19 2 0
17 21 1 0
18 19 1 0
20 21 2 0
22 23 1 0
24 25 1 0
24 26 2 0
24 27 1 0
26 29 1 0
27 30 2 0
28 29 2 0
28 30 1 0
M END Associated Targets(Human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: Small moleculeTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 420.85Molecular Weight (Monoisotopic): 420.0877AlogP: 4.62#Rotatable Bonds: 6Polar Surface Area: 81.43Molecular Species: NEUTRALHBA: 5HBD: 1#RO5 Violations: ┄HBA (Lipinski): 6HBD (Lipinski): 1#RO5 Violations (Lipinski): ┄CX Acidic pKa: 13.28CX Basic pKa: 0.34CX LogP: 4.45CX LogD: 4.45Aromatic Rings: 4Heavy Atoms: 30QED Weighted: 0.46Np Likeness Score: -1.72
References 1. PubChem BioAssay data set, 2. PubChem BioAssay data set,