The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
SID56373846 ID: ALA1732031
PubChem CID: 2587706
Max Phase: Preclinical
Molecular Formula: C25H22N2O6
Molecular Weight: 446.46
Molecule Type: Small molecule
Associated Items:
Names and Identifiers Canonical SMILES: COc1ccc(CNC(=O)COC(=O)c2cc(-c3ccco3)nc3ccccc23)cc1OC
Standard InChI: InChI=1S/C25H22N2O6/c1-30-22-10-9-16(12-23(22)31-2)14-26-24(28)15-33-25(29)18-13-20(21-8-5-11-32-21)27-19-7-4-3-6-17(18)19/h3-13H,14-15H2,1-2H3,(H,26,28)
Standard InChI Key: KQFYPWYACRHAHY-UHFFFAOYSA-N
Molfile:
RDKit 2D
33 36 0 0 0 0 0 0 0 0999 V2000
-4.3259 0.6478 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
0.0001 0.7247 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
-0.7144 -0.5128 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
5.7159 0.7247 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
5.7159 -0.9253 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
1.4290 1.5497 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
-2.8578 1.5497 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
2.1435 0.3122 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
-1.4289 1.5497 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.4289 0.7247 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-2.1433 1.9622 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-2.8578 0.7247 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-2.1433 0.3122 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-3.5723 0.3122 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-0.7144 0.3122 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-0.7144 1.9622 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-2.1433 2.7872 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-3.6585 -0.5083 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-0.7144 2.7872 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.4289 3.1997 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-4.8780 0.0347 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-4.4655 -0.6798 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.0014 0.3122 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.0014 -0.5128 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.5724 0.3122 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.7146 0.3122 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.2869 0.7247 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.4290 0.7247 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.2869 -0.9253 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.5724 -0.5128 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.8580 0.7247 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.7159 1.5497 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.4303 -0.5128 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1 14 1 0
1 21 1 0
2 15 1 0
2 26 1 0
3 15 2 0
4 23 1 0
4 32 1 0
5 24 1 0
5 33 1 0
6 28 2 0
7 11 2 0
7 12 1 0
8 28 1 0
8 31 1 0
9 10 2 0
9 11 1 0
9 16 1 0
10 13 1 0
10 15 1 0
11 17 1 0
12 13 2 0
12 14 1 0
14 18 2 0
16 19 2 0
17 20 2 0
18 22 1 0
19 20 1 0
21 22 2 0
23 24 2 0
23 27 1 0
24 29 1 0
25 27 2 0
25 30 1 0
25 31 1 0
26 28 1 0
29 30 2 0
M END Associated Targets(Human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: Small moleculeTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 446.46Molecular Weight (Monoisotopic): 446.1478AlogP: 3.99#Rotatable Bonds: 8Polar Surface Area: 99.89Molecular Species: NEUTRALHBA: 7HBD: 1#RO5 Violations: ┄HBA (Lipinski): 8HBD (Lipinski): 1#RO5 Violations (Lipinski): ┄CX Acidic pKa: 13.32CX Basic pKa: 0.34CX LogP: 3.53CX LogD: 3.53Aromatic Rings: 4Heavy Atoms: 33QED Weighted: 0.41Np Likeness Score: -1.35
References 1. PubChem BioAssay data set,