The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
2-{4-[2-(2,4-Diamino-5,6,7,8-tetrahydro-pyrido[2,3-d]pyrimidin-6-yl)-ethyl]-benzoylamino}-pentanedioic acid ID: ALA173271
PubChem CID: 13912571
Max Phase: Preclinical
Molecular Formula: C21H26N6O5
Molecular Weight: 442.48
Molecule Type: Small molecule
This compound is available for customization.
Associated Items:
Names and Identifiers Canonical SMILES: Nc1nc(N)c2c(n1)NCC(CCc1ccc(C(=O)NC(CCC(=O)O)C(=O)O)cc1)C2
Standard InChI: InChI=1S/C21H26N6O5/c22-17-14-9-12(10-24-18(14)27-21(23)26-17)2-1-11-3-5-13(6-4-11)19(30)25-15(20(31)32)7-8-16(28)29/h3-6,12,15H,1-2,7-10H2,(H,25,30)(H,28,29)(H,31,32)(H5,22,23,24,26,27)
Standard InChI Key: JVKOZIXIYHORFY-UHFFFAOYSA-N
Molfile:
RDKit 2D
32 34 0 0 0 0 0 0 0 0999 V2000
-2.3375 -1.4167 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
-1.8208 -1.1167 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-2.8583 -0.5167 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
-1.8208 -0.5167 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-2.3375 -0.2167 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-2.8583 -1.1167 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.3292 0.7125 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.2958 -1.4167 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
2.8500 0.4208 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
3.3625 1.3208 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.3667 0.7208 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.8042 0.4083 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.3000 -0.2125 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.9292 0.4375 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.3167 1.3125 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
2.8375 1.6208 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
4.9292 -0.1542 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
-2.3458 0.3833 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
-3.3750 -1.4167 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
3.8875 0.4250 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.2792 0.7083 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.8125 -0.1917 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-0.7750 -1.1125 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.4042 0.7333 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.8792 1.6250 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
-0.7833 -0.5042 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.7792 -0.1917 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.4417 0.7458 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
1.2917 -0.4917 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.7667 0.4000 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.2625 -0.5000 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-0.2625 -0.2042 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2 1 2 0
3 6 2 0
4 2 1 0
5 3 1 0
6 1 1 0
7 12 1 0
8 2 1 0
9 7 1 0
10 11 1 0
11 9 1 0
12 21 1 0
13 4 1 0
14 24 1 0
15 7 2 0
16 10 2 0
17 14 2 0
18 5 1 0
19 6 1 0
20 11 1 0
21 30 2 0
22 29 1 0
23 8 1 0
24 20 1 0
25 10 1 0
26 23 1 0
27 31 1 0
28 14 1 0
29 27 2 0
30 27 1 0
31 32 1 0
32 26 1 0
4 5 2 0
26 13 1 0
22 12 2 0
M END Associated Targets(non-human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: Small moleculeTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 442.48Molecular Weight (Monoisotopic): 442.1965AlogP: 0.91#Rotatable Bonds: 9Polar Surface Area: 193.55Molecular Species: ACIDHBA: 8HBD: 6#RO5 Violations: 1HBA (Lipinski): 11HBD (Lipinski): 8#RO5 Violations (Lipinski): 2CX Acidic pKa: 3.57CX Basic pKa: 7.86CX LogP: -0.76CX LogD: -4.40Aromatic Rings: 2Heavy Atoms: 32QED Weighted: 0.32Np Likeness Score: 0.31
References 1. Taylor EC, Harrington PJ, Fletcher SR, Beardsley GP, Moran RG.. (1985) Synthesis of the antileukemic agents 5,10-dideazaaminopterin and 5,10-dideaza-5,6,7,8-tetrahydroaminopterin., 28 (7): [PMID:4009615 ] [10.1021/jm00145a012 ]