The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
SID49825497 ID: ALA1733669
PubChem CID: 24818973
Max Phase: Preclinical
Molecular Formula: C21H29N3O4
Molecular Weight: 387.48
Molecule Type: Small molecule
Associated Items:
Names and Identifiers Canonical SMILES: Cc1ccc(OCc2cc(C(=O)NCC(C)(C)N3CCOCC3)no2)cc1C
Standard InChI: InChI=1S/C21H29N3O4/c1-15-5-6-17(11-16(15)2)27-13-18-12-19(23-28-18)20(25)22-14-21(3,4)24-7-9-26-10-8-24/h5-6,11-12H,7-10,13-14H2,1-4H3,(H,22,25)
Standard InChI Key: BTZXAXMAVFTNQI-UHFFFAOYSA-N
Molfile:
RDKit 2D
28 30 0 0 0 0 0 0 0 0999 V2000
-4.7465 2.1640 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
-6.3150 0.6097 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
-3.1388 -0.0655 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
1.1480 2.4095 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
-0.2809 1.5845 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
-3.9395 1.9925 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
-2.4243 1.1720 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
-0.9954 1.1720 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-3.8533 1.1720 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-3.1388 0.7595 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-5.1590 1.4496 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-4.6069 0.8365 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.7099 0.7595 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-5.9795 1.3633 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.4336 1.1720 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-0.2809 2.4095 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-7.1355 0.5234 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.4079 1.8865 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-0.5829 0.4576 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-8.2915 -0.3165 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-7.4711 -0.2302 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-8.7765 0.3510 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-7.6204 1.1909 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.1480 1.5845 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.4336 2.8220 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-8.4409 1.1046 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-8.6271 -1.0702 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-9.5969 0.2647 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1 6 1 0
1 11 1 0
2 14 1 0
2 17 1 0
3 10 2 0
4 24 1 0
4 25 1 0
5 8 1 0
5 15 1 0
5 16 1 0
6 9 2 0
7 10 1 0
7 13 1 0
8 13 1 0
8 18 1 0
8 19 1 0
9 10 1 0
9 12 1 0
11 12 2 0
11 14 1 0
15 24 1 0
16 25 1 0
17 21 1 0
17 23 2 0
20 21 2 0
20 22 1 0
20 27 1 0
22 26 2 0
22 28 1 0
23 26 1 0
M END Associated Targets(Human) Associated Targets(non-human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: Small moleculeTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 387.48Molecular Weight (Monoisotopic): 387.2158AlogP: 2.71#Rotatable Bonds: 7Polar Surface Area: 76.83Molecular Species: NEUTRALHBA: 6HBD: 1#RO5 Violations: ┄HBA (Lipinski): 7HBD (Lipinski): 1#RO5 Violations (Lipinski): ┄CX Acidic pKa: 12.16CX Basic pKa: 6.25CX LogP: 2.81CX LogD: 2.78Aromatic Rings: 2Heavy Atoms: 28QED Weighted: 0.79Np Likeness Score: -2.06
References 1. PubChem BioAssay data set,