The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
SID87349809 ID: ALA1736103
PubChem CID: 44602312
Max Phase: Preclinical
Molecular Formula: C26H24N2O2
Molecular Weight: 396.49
Molecule Type: Small molecule
Associated Items:
Names and Identifiers Canonical SMILES: O=C(c1cc(-c2ccco2)nc2ccccc12)N1CCCCC1Cc1ccccc1
Standard InChI: InChI=1S/C26H24N2O2/c29-26(28-15-7-6-11-20(28)17-19-9-2-1-3-10-19)22-18-24(25-14-8-16-30-25)27-23-13-5-4-12-21(22)23/h1-5,8-10,12-14,16,18,20H,6-7,11,15,17H2
Standard InChI Key: FBBYCOPRFSLPDK-UHFFFAOYSA-N
Molfile:
RDKit 2D
30 34 0 0 0 0 0 0 0 0999 V2000
1.0101 -0.9960 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
-1.2196 2.7120 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
-0.4189 -0.9960 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
0.2956 1.8915 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
0.2956 0.2415 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.0101 0.6540 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.0101 1.4790 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.2956 -0.5835 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-0.4189 1.4790 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-0.4189 0.6540 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.1333 1.8915 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-0.4189 -1.8210 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.7246 0.2415 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.7246 1.8915 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.1333 -0.5835 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.4390 0.6540 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.8870 1.5560 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.4390 1.4790 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.2956 -2.2335 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.1333 -2.2335 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.8478 -0.9960 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.2956 -3.0585 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.8478 -1.8210 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-2.0265 2.8835 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-2.4390 2.1691 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.0101 -3.4710 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-0.4189 -3.4710 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.0101 -4.2960 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-0.4189 -4.2960 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.2956 -4.7085 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1 8 2 0
2 11 1 0
2 24 1 0
3 8 1 0
3 12 1 0
3 15 1 0
4 7 2 0
4 9 1 0
5 6 2 0
5 8 1 0
5 10 1 0
6 7 1 0
6 13 1 0
7 14 1 0
9 10 2 0
9 11 1 0
11 17 2 0
12 19 1 0
12 20 1 0
13 16 2 0
14 18 2 0
15 21 1 0
16 18 1 0
17 25 1 0
19 22 1 0
20 23 1 0
21 23 1 0
22 26 2 0
22 27 1 0
24 25 2 0
26 28 1 0
27 29 2 0
28 30 2 0
29 30 1 0
M END Associated Targets(Human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: Small moleculeTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 396.49Molecular Weight (Monoisotopic): 396.1838AlogP: 5.73#Rotatable Bonds: 4Polar Surface Area: 46.34Molecular Species: NEUTRALHBA: 3HBD: ┄#RO5 Violations: 1HBA (Lipinski): 4HBD (Lipinski): ┄#RO5 Violations (Lipinski): 1CX Acidic pKa: ┄CX Basic pKa: 0.28CX LogP: 5.45CX LogD: 5.45Aromatic Rings: 4Heavy Atoms: 30QED Weighted: 0.44Np Likeness Score: -1.33
References 1. PubChem BioAssay data set,