The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
SID57288036 ID: ALA1736334
PubChem CID: 2461091
Max Phase: Preclinical
Molecular Formula: C27H34N4OS
Molecular Weight: 462.66
Molecule Type: Small molecule
This compound is available for customization.
Associated Items:
Names and Identifiers Canonical SMILES: c1ccc(CC2CCN(c3nc(CN4CCOCC4)nc4sc5c(c34)CCCC5)CC2)cc1
Standard InChI: InChI=1S/C27H34N4OS/c1-2-6-20(7-3-1)18-21-10-12-31(13-11-21)26-25-22-8-4-5-9-23(22)33-27(25)29-24(28-26)19-30-14-16-32-17-15-30/h1-3,6-7,21H,4-5,8-19H2
Standard InChI Key: YKLWALAYHWOERT-UHFFFAOYSA-N
Molfile:
RDKit 2D
33 38 0 0 0 0 0 0 0 0999 V2000
-2.6210 -0.7167 0.0000 S 0 0 0 0 0 0 0 0 0 0 0 0
0.9772 -2.3156 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
-1.9114 1.9505 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
-1.1466 -0.4033 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
-0.8495 0.9944 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
0.4674 -0.7464 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
-2.2085 0.5528 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.9536 -0.2318 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-3.0335 0.5528 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.6565 1.1659 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-3.2884 -0.2318 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-0.5946 0.2098 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-3.5855 1.1659 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-4.0954 -0.4033 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-2.7184 2.1220 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.3594 2.5636 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.2124 0.0382 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-4.3925 0.9944 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-4.6474 0.2098 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-2.4213 3.5198 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-2.9733 2.9067 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.6143 3.3482 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-2.6762 4.3044 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-0.0847 -1.3595 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.2743 -0.9179 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-2.1242 4.9175 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.1703 -2.1441 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.5293 -1.7025 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-2.3791 5.7021 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.3172 4.7460 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.8271 6.3152 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-0.7652 5.3590 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.0201 6.1437 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1 8 1 0
1 11 1 0
2 27 1 0
2 28 1 0
3 10 1 0
3 15 1 0
3 16 1 0
4 8 1 0
4 12 2 0
5 10 2 0
5 12 1 0
6 17 1 0
6 24 1 0
6 25 1 0
7 8 2 0
7 9 1 0
7 10 1 0
9 11 2 0
9 13 1 0
11 14 1 0
12 17 1 0
13 18 1 0
14 19 1 0
15 21 1 0
16 22 1 0
18 19 1 0
20 21 1 0
20 22 1 0
20 23 1 0
23 26 1 0
24 27 1 0
25 28 1 0
26 29 2 0
26 30 1 0
29 31 1 0
30 32 2 0
31 33 2 0
32 33 1 0
M END Associated Targets(Human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: Small moleculeTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 462.66Molecular Weight (Monoisotopic): 462.2453AlogP: 4.86#Rotatable Bonds: 5Polar Surface Area: 41.49Molecular Species: NEUTRALHBA: 6HBD: ┄#RO5 Violations: ┄HBA (Lipinski): 5HBD (Lipinski): ┄#RO5 Violations (Lipinski): ┄CX Acidic pKa: ┄CX Basic pKa: 4.75CX LogP: 6.42CX LogD: 6.42Aromatic Rings: 3Heavy Atoms: 33QED Weighted: 0.54Np Likeness Score: -1.85
References 1. PubChem BioAssay data set, 2. Zhou, Haibin and 18 more authors. 2019-12-26 Structure-Based Discovery of SD-36 as a Potent, Selective, and Efficacious PROTAC Degrader of STAT3 Protein. [PMID:31747516 ]