The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
Flezelastine ID: ALA1742475
Cas Number: 135381-77-0
PubChem CID: 60432
Max Phase: Phase
Molecular Formula: C29H30FN3O
Molecular Weight: 455.58
Molecule Type: Small molecule
Associated Items:
Names and Identifiers Canonical SMILES: O=c1c2ccccc2c(Cc2ccc(F)cc2)nn1C1CCCN(CCc2ccccc2)CC1
Standard InChI: InChI=1S/C29H30FN3O/c30-24-14-12-23(13-15-24)21-28-26-10-4-5-11-27(26)29(34)33(31-28)25-9-6-18-32(20-17-25)19-16-22-7-2-1-3-8-22/h1-5,7-8,10-15,25H,6,9,16-21H2
Standard InChI Key: HQFSNUYUXXPVKL-UHFFFAOYSA-N
Molfile:
RDKit 2D
34 38 0 0 0 0 0 0 0 0999 V2000
-1.1208 0.9083 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
-1.1208 0.1833 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
-1.7458 1.2708 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.7458 -0.1792 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-2.3750 0.9083 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-2.3750 0.1833 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.0542 1.7708 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
-0.4958 1.2708 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.7458 1.9875 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
-1.7458 -0.9000 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.1250 0.8750 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.8042 1.0958 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.7792 1.8208 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-2.3750 -1.2625 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-3.6250 -1.9917 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-4.2583 -2.3417 0.0000 F 0 0 0 0 0 0 0 0 0 0 0 0
2.1792 1.2250 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-3.0000 1.2708 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-2.3750 -1.9917 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-3.0000 -0.9000 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-3.0000 -2.3417 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-3.6250 -1.2625 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.9000 1.2708 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.6792 2.4000 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-3.0000 -0.1792 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-0.0458 2.4833 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-0.5583 1.9833 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.1875 1.9208 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.3167 0.6583 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-3.6250 0.9083 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-3.6250 0.1833 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.9167 1.9958 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.0542 0.7333 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.3417 1.4083 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2 1 1 0
3 1 1 0
4 2 2 0
5 3 1 0
6 5 2 0
7 12 1 0
8 1 1 0
9 3 2 0
10 4 1 0
11 8 1 0
12 11 1 0
13 7 1 0
14 10 1 0
15 22 2 0
16 15 1 0
17 13 1 0
18 5 1 0
19 14 1 0
20 14 2 0
21 19 2 0
22 20 1 0
23 17 1 0
24 26 1 0
25 6 1 0
26 27 1 0
27 8 1 0
28 23 1 0
29 23 2 0
30 18 2 0
31 30 1 0
32 28 2 0
33 29 1 0
34 33 2 0
4 6 1 0
7 24 1 0
25 31 2 0
21 15 1 0
32 34 1 0
M END
Associated Targets(non-human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: Small moleculeTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 455.58Molecular Weight (Monoisotopic): 455.2373AlogP: 5.40#Rotatable Bonds: 6Polar Surface Area: 38.13Molecular Species: BASEHBA: 4HBD: ┄#RO5 Violations: 1HBA (Lipinski): 4HBD (Lipinski): ┄#RO5 Violations (Lipinski): 1CX Acidic pKa: ┄CX Basic pKa: 9.27CX LogP: 5.59CX LogD: 3.72Aromatic Rings: 4Heavy Atoms: 34QED Weighted: 0.39Np Likeness Score: -1.17
References 1. Hu YP, Robert J.. (1995) Azelastine and flezelastine as reversing agents of multidrug resistance: pharmacological and molecular studies., 50 (1): [PMID:7632160 ] [10.1016/0006-2952(95)00130-r ] 2. USP Dictionary of USAN and International Names (2010 edition) and USAN registrations 2007-date,