The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
(4-{2-[3-(2-Chloro-phenoxy)-2-hydroxy-propylamino]-ethoxy}-phenoxy)-acetic acid methyl ester HCl ID: ALA1743909
PubChem CID: 54584768
Max Phase: Preclinical
Molecular Formula: C20H25Cl2NO6
Molecular Weight: 409.87
Molecule Type: Small molecule
This compound is available for customization.
Associated Items:
Names and Identifiers Canonical SMILES: COC(=O)COc1ccc(OCCNCC(O)COc2ccccc2Cl)cc1.Cl
Standard InChI: InChI=1S/C20H24ClNO6.ClH/c1-25-20(24)14-27-17-8-6-16(7-9-17)26-11-10-22-12-15(23)13-28-19-5-3-2-4-18(19)21;/h2-9,15,22-23H,10-14H2,1H3;1H
Standard InChI Key: DSQLGSHHPYGONN-UHFFFAOYSA-N
Molfile:
RDKit 2D
29 29 0 0 0 0 0 0 0 0999 V2000
12.7732 -3.2127 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.5065 -4.5252 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
2.7940 -4.9460 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
12.7565 -2.3877 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
2.0732 -4.5335 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
11.3482 -3.2585 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
12.0732 -3.6502 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
10.6482 -3.6960 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.2232 -4.9377 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.9357 -4.5252 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.0732 -3.7085 0.0000 Cl 0 0 0 0 0 0 0 0 0 0 0 0
9.2190 -4.5127 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.3607 -4.5127 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
13.5065 -3.6085 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
9.9357 -3.2752 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
10.6440 -4.5252 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
9.9232 -4.9252 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
9.2232 -3.6877 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.9315 -3.7002 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
8.5065 -4.9210 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
5.6482 -4.9335 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.7940 -5.7752 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.3607 -4.9460 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.0815 -4.9252 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.7940 -4.5127 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
14.2065 -3.1710 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.3607 -5.7752 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.0732 -6.1877 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.4161 -7.8080 0.0000 Cl 0 0 0 0 0 0 0 0 0 0 0 0
2 9 1 0
3 2 1 0
4 1 2 0
5 3 2 0
6 7 1 0
7 1 1 0
8 6 1 0
9 10 1 0
10 21 1 0
11 5 1 0
12 17 1 0
13 24 1 0
14 1 1 0
15 8 2 0
16 8 1 0
17 16 2 0
18 15 1 0
19 10 1 0
20 12 1 0
21 13 1 0
22 3 1 0
23 5 1 0
24 25 1 0
25 20 1 0
26 14 1 0
27 28 1 0
28 22 2 0
12 18 2 0
23 27 2 0
M END Associated Targets(non-human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: Small moleculeTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 409.87Molecular Weight (Monoisotopic): 409.1292AlogP: 2.30#Rotatable Bonds: 12Polar Surface Area: 86.25Molecular Species: BASEHBA: 7HBD: 2#RO5 Violations: ┄HBA (Lipinski): 7HBD (Lipinski): 2#RO5 Violations (Lipinski): ┄CX Acidic pKa: ┄CX Basic pKa: 8.79CX LogP: 2.54CX LogD: 1.14Aromatic Rings: 2Heavy Atoms: 28QED Weighted: 0.41Np Likeness Score: -0.91
References 1. Howe R, Rao BS, Holloway BR, Stribling D.. (1992) Selective beta 3-adrenergic agonists of brown adipose tissue and thermogenesis. 1. [4-[2-[(2-Hydroxy-3-phenoxypropyl)amino]ethoxy]phenoxy]acetates., 35 (10): [PMID:1350309 ] [10.1021/jm00088a009 ]