The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
(4-{2-[3-(2-Fluoro-phenoxy)-2-hydroxy-propylamino]-ethoxy}-phenoxy)-acetic acid HCl ID: ALA1743910
PubChem CID: 54585701
Max Phase: Preclinical
Molecular Formula: C19H23ClFNO6
Molecular Weight: 379.38
Molecule Type: Small molecule
This compound is available for customization.
Associated Items:
Names and Identifiers Canonical SMILES: Cl.O=C(O)COc1ccc(OCCNCC(O)COc2ccccc2F)cc1
Standard InChI: InChI=1S/C19H22FNO6.ClH/c20-17-3-1-2-4-18(17)27-12-14(22)11-21-9-10-25-15-5-7-16(8-6-15)26-13-19(23)24;/h1-8,14,21-22H,9-13H2,(H,23,24);1H
Standard InChI Key: QKKWJZBHVSHATC-UHFFFAOYSA-N
Molfile:
RDKit 2D
28 28 0 0 0 0 0 0 0 0999 V2000
13.0650 -3.2923 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.7900 -4.6048 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
3.0775 -5.0215 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
13.0400 -2.4673 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
2.3608 -4.6090 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
11.6358 -3.3340 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
12.3608 -3.7215 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
10.9358 -3.7715 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.5108 -5.0090 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.2233 -4.5965 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.3608 -3.7840 0.0000 F 0 0 0 0 0 0 0 0 0 0 0 0
9.5025 -4.5840 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
13.7900 -3.6840 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
6.6483 -4.5923 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
10.2233 -3.3548 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
10.9275 -4.5965 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
10.2108 -5.0048 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
9.5108 -3.7590 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.2150 -3.7715 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
8.7900 -4.9965 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
5.9358 -5.0090 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.0775 -5.8465 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.6483 -5.0215 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.3650 -5.0048 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
8.0775 -4.5840 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.6483 -5.8465 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.3608 -6.2590 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.4161 -7.8080 0.0000 Cl 0 0 0 0 0 0 0 0 0 0 0 0
2 9 1 0
3 2 1 0
4 1 2 0
5 3 2 0
6 7 1 0
7 1 1 0
8 6 1 0
9 10 1 0
10 21 1 0
11 5 1 0
12 17 1 0
13 1 1 0
14 24 1 0
15 8 2 0
16 8 1 0
17 16 2 0
18 15 1 0
19 10 1 0
20 12 1 0
21 14 1 0
22 3 1 0
23 5 1 0
24 25 1 0
25 20 1 0
26 27 1 0
27 22 2 0
12 18 2 0
23 26 2 0
M END Associated Targets(non-human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: Small moleculeTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 379.38Molecular Weight (Monoisotopic): 379.1431AlogP: 1.70#Rotatable Bonds: 12Polar Surface Area: 97.25Molecular Species: ZWITTERIONHBA: 6HBD: 3#RO5 Violations: ┄HBA (Lipinski): 7HBD (Lipinski): 3#RO5 Violations (Lipinski): ┄CX Acidic pKa: 2.98CX Basic pKa: 8.79CX LogP: -0.54CX LogD: -0.56Aromatic Rings: 2Heavy Atoms: 27QED Weighted: 0.48Np Likeness Score: -0.99
References 1. Howe R, Rao BS, Holloway BR, Stribling D.. (1992) Selective beta 3-adrenergic agonists of brown adipose tissue and thermogenesis. 1. [4-[2-[(2-Hydroxy-3-phenoxypropyl)amino]ethoxy]phenoxy]acetates., 35 (10): [PMID:1350309 ] [10.1021/jm00088a009 ]