The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
(3-{2-[3-(2-Fluoro-phenoxy)-2-hydroxy-propylamino]-ethoxy}-phenoxy)-acetic acid methyl ester HCl ID: ALA1743911
PubChem CID: 54583784
Max Phase: Preclinical
Molecular Formula: C20H25ClFNO6
Molecular Weight: 393.41
Molecule Type: Small molecule
This compound is available for customization.
Associated Items:
Names and Identifiers Canonical SMILES: COC(=O)COc1cccc(OCCNCC(O)COc2ccccc2F)c1.Cl
Standard InChI: InChI=1S/C20H24FNO6.ClH/c1-25-20(24)14-27-17-6-4-5-16(11-17)26-10-9-22-12-15(23)13-28-19-8-3-2-7-18(19)21;/h2-8,11,15,22-23H,9-10,12-14H2,1H3;1H
Standard InChI Key: OGBMCUSOKMGGTC-UHFFFAOYSA-N
Molfile:
RDKit 2D
29 29 0 0 0 0 0 0 0 0999 V2000
12.6373 -5.0892 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.3586 -4.6936 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
2.6464 -5.1058 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
12.6415 -5.9137 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
1.9301 -4.6936 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
9.7762 -5.0934 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
11.2047 -5.0934 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
11.9169 -4.6811 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
10.4926 -4.6894 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.0707 -5.1016 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
9.0683 -4.6769 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.7829 -4.6894 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.9218 -3.8690 0.0000 F 0 0 0 0 0 0 0 0 0 0 0 0
6.2072 -4.6811 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
13.3494 -4.6686 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
4.7829 -3.8648 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
8.3561 -5.0809 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
9.7804 -3.4442 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.5033 -5.0934 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.6464 -5.9387 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.2179 -5.1141 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
10.5008 -3.8565 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
9.0683 -3.8523 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.9318 -5.0934 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.6440 -4.6769 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
14.0658 -5.0809 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.2179 -5.9387 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.9301 -6.3510 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.4161 -7.8080 0.0000 Cl 0 0 0 0 0 0 0 0 0 0 0 0
2 10 1 0
3 2 1 0
4 1 2 0
5 3 2 0
6 9 2 0
7 8 1 0
8 1 1 0
9 7 1 0
10 12 1 0
11 6 1 0
12 19 1 0
13 5 1 0
14 24 1 0
15 1 1 0
16 12 1 0
17 11 1 0
18 22 2 0
19 14 1 0
20 3 1 0
21 5 1 0
22 9 1 0
23 18 1 0
24 25 1 0
25 17 1 0
26 15 1 0
27 28 1 0
28 20 2 0
11 23 2 0
21 27 2 0
M END Associated Targets(non-human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: Small moleculeTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 393.41Molecular Weight (Monoisotopic): 393.1588AlogP: 1.79#Rotatable Bonds: 12Polar Surface Area: 86.25Molecular Species: BASEHBA: 7HBD: 2#RO5 Violations: ┄HBA (Lipinski): 7HBD (Lipinski): 2#RO5 Violations (Lipinski): ┄CX Acidic pKa: ┄CX Basic pKa: 8.76CX LogP: 2.07CX LogD: 0.70Aromatic Rings: 2Heavy Atoms: 28QED Weighted: 0.42Np Likeness Score: -1.08
References 1. Howe R, Rao BS, Holloway BR, Stribling D.. (1992) Selective beta 3-adrenergic agonists of brown adipose tissue and thermogenesis. 1. [4-[2-[(2-Hydroxy-3-phenoxypropyl)amino]ethoxy]phenoxy]acetates., 35 (10): [PMID:1350309 ] [10.1021/jm00088a009 ]