luteolin-3',7-diglucoside

ID: ALA1744031

Cas Number: 52187-80-1

PubChem CID: 5490298

Max Phase: Preclinical

Molecular Formula: C27H30O16

Molecular Weight: 610.52

Molecule Type: Small molecule

Names and Identifiers

Synonyms: Luteolin-3',7-Diglucoside | Luteolin-3',7-di-O-glucoside|52187-80-1|Luteolin-7,3'-di-O-gflucoside|Luteolin-3 inverted exclamation marka,7-diglucoside|5-hydroxy-2-[4-hydroxy-3-[(2S,3R,4S,5S,6R)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxyphenyl]-7-[(2S,3R,4S,5S,6R)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxychromen-4-one|EINECS 257-724-7|luteolin-3',7-diglucoside|CHEMBL1744031|DTXSID90200214|CHEBI:167535|HY-N8318|AKOS040760534|7-(beta-D-Glucopyranosyloxy)-2-(3-(beta-D-glucopyranosyloxy)-4-Show More⌵

Canonical SMILES:  O=c1cc(-c2ccc(O)c(O[C@@H]3O[C@H](CO)[C@@H](O)[C@H](O)[C@H]3O)c2)oc2cc(O[C@@H]3O[C@H](CO)[C@@H](O)[C@H](O)[C@H]3O)cc(O)c12

Standard InChI:  InChI=1S/C27H30O16/c28-7-17-20(33)22(35)24(37)26(42-17)39-10-4-12(31)19-13(32)6-14(40-16(19)5-10)9-1-2-11(30)15(3-9)41-27-25(38)23(36)21(34)18(8-29)43-27/h1-6,17-18,20-31,33-38H,7-8H2/t17-,18-,20-,21-,22+,23+,24-,25-,26-,27-/m1/s1

Standard InChI Key:  BISZYPSIZGKOFA-IPOZFMEPSA-N

Molfile:  

     RDKit          2D

 43 47  0  0  0  0  0  0  0  0999 V2000
   16.7430  -18.0855    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   16.7418  -18.9126    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   17.4563  -19.3254    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   17.4545  -17.6730    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   18.1697  -18.0819    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   18.1685  -18.9147    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   18.8851  -19.3298    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   19.6076  -18.9167    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   19.6088  -18.0840    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   18.8875  -17.6643    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   18.8828  -20.1545    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   20.3223  -17.6760    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   21.0358  -18.0918    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   21.7506  -17.6819    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   21.7530  -16.8562    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   21.0347  -16.4423    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   20.3230  -16.8546    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   16.0286  -17.6734    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   15.3144  -18.0859    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   14.6022  -17.6689    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   13.8902  -18.0779    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   13.8861  -18.9029    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   14.6003  -19.3173    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   15.3185  -18.9066    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   14.5977  -20.1420    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   13.1775  -17.6630    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   13.1804  -16.8383    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   13.1705  -19.3128    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   16.0330  -19.3187    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   21.0339  -15.6175    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   20.3192  -15.2060    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   20.3215  -14.3834    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   19.6108  -13.9719    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   18.8946  -14.3815    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   18.8935  -15.2072    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   19.6087  -15.6232    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   18.1784  -15.6178    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   19.6131  -13.1472    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   20.3285  -12.7367    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   18.1815  -13.9672    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   19.6103  -16.4480    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   17.4560  -20.1504    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   22.4679  -16.4444    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
 19 20  1  0
  7  8  1  0
  8  9  2  0
  9 10  1  0
  5  6  1  0
  7 11  2  0
 19 24  1  0
 20 21  1  0
 21 22  1  0
 22 23  1  0
 23 24  1  0
 23 25  1  1
  2  3  1  0
 21 26  1  1
 12 13  2  0
 26 27  1  0
  3  6  2  0
 22 28  1  6
 13 14  1  0
 24 29  1  6
  1  2  2  0
 16 30  1  0
 14 15  2  0
 31 30  1  1
 31 32  1  0
  5  4  2  0
 15 16  1  0
  4  1  1  0
 16 17  2  0
 17 12  1  0
 31 36  1  0
 32 33  1  0
 33 34  1  0
 34 35  1  0
 35 36  1  0
  9 12  1  0
 35 37  1  1
  5 10  1  0
 33 38  1  1
  1 18  1  0
 38 39  1  0
  6  7  1  0
 34 40  1  6
 19 18  1  1
 36 41  1  6
  3 42  1  0
 15 43  1  0
M  END

Alternative Forms

1. Parent:

   

   ALA1744031

   LUTEOLIN-3',7-DIGLUCOSIDE

Molecule Features

Natural Product: Yes

Oral: No

Chemical Probe: No

Parenteral: No

Molecule Type: Small molecule

Topical: No

First In Class: No

Black Box: No

Chirality: No

Availability: No

Prodrug: No

Calculated Properties

Molecular Weight: 610.52

Molecular Weight (Monoisotopic): 610.1534

AlogP: -2.77

#Rotatable Bonds: 7

Polar Surface Area: 269.43

Molecular Species: NEUTRAL

HBA: 16

HBD: 10

#RO5 Violations: 3

HBA (Lipinski): 16

HBD (Lipinski): 10

#RO5 Violations (Lipinski): 3

CX Acidic pKa: 7.31

CX Basic pKa: ┄

CX LogP: -2.13

CX LogD: -2.48

Aromatic Rings: 3

Heavy Atoms: 43

QED Weighted: 0.13

Np Likeness Score: 1.54

References

1. Lale A, Herbert JM, Augereau JM, Billon M, Leconte M, Gleye J..  (1996)  Ability of different flavonoids to inhibit the procoagulant activity of adherent human monocytes.,  59  (3): [PMID:8882428] [10.1021/np960057s]

2. Amić D, Lucić B..  (2010)  Reliability of bond dissociation enthalpy calculated by the PM6 method and experimental TEAC values in antiradical QSAR of flavonoids.,  18  (1): [PMID:19944611] [10.1016/j.bmc.2009.11.015]

Source

Source(1):

• Scientific Literature