The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
xN-[2-(2-Hydroxy-2-phenyl-ethylamino)-2-methyl-propyl]-2-phenyl-acetamide fumarate ID: ALA1744140
PubChem CID: 54585985
Max Phase: Preclinical
Molecular Formula: C24H30N2O6
Molecular Weight: 326.44
Molecule Type: Small molecule
This compound is available for customization.
Associated Items:
Names and Identifiers Canonical SMILES: CC(C)(CNC(=O)Cc1ccccc1)NCC(O)c1ccccc1.O=C(O)/C=C/C(=O)O
Standard InChI: InChI=1S/C20H26N2O2.C4H4O4/c1-20(2,22-14-18(23)17-11-7-4-8-12-17)15-21-19(24)13-16-9-5-3-6-10-16;5-3(6)1-2-4(7)8/h3-12,18,22-23H,13-15H2,1-2H3,(H,21,24);1-2H,(H,5,6)(H,7,8)/b;2-1+
Standard InChI Key: JEMFOPYFTYRQJO-WLHGVMLRSA-N
Molfile:
RDKit 2D
32 32 0 0 0 0 0 0 0 0999 V2000
8.3321 -22.1687 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.6188 -22.5900 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
5.4748 -22.1813 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
6.1922 -22.5942 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
8.3321 -21.3428 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
4.7532 -22.5942 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.0399 -22.1896 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.3266 -22.6067 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
9.0454 -22.5817 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.9055 -22.1771 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
9.7586 -22.1645 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.0399 -21.3637 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
5.6041 -23.1781 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.7762 -23.1781 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.6134 -22.1938 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.3266 -23.4326 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
10.4719 -22.5692 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
9.7461 -21.3428 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.9001 -22.6067 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.6134 -23.8456 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
10.4469 -20.9174 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
11.1810 -22.1437 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.9001 -23.4326 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
11.1727 -21.3261 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.1196 -19.5054 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.8341 -19.0929 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.5486 -19.5054 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.2631 -19.0929 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.9775 -19.5054 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
0.4052 -19.0929 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
1.1196 -20.3304 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
3.2631 -18.2679 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
2 1 1 0
3 4 1 0
4 10 1 0
5 1 2 0
6 3 1 0
7 6 1 0
8 7 1 0
9 1 1 0
10 2 1 0
11 9 1 0
12 7 1 0
13 4 1 0
14 4 1 0
15 8 2 0
16 8 1 0
17 11 2 0
18 11 1 0
19 15 1 0
20 16 2 0
21 18 2 0
22 17 1 0
23 20 1 0
24 21 1 0
24 22 2 0
23 19 2 0
25 26 1 0
26 27 2 0
27 28 1 0
28 29 1 0
25 30 1 0
25 31 2 0
28 32 2 0
M END Associated Targets(Human) Associated Targets(non-human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: Small moleculeTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 326.44Molecular Weight (Monoisotopic): 326.1994AlogP: 2.45#Rotatable Bonds: 8Polar Surface Area: 61.36Molecular Species: BASEHBA: 3HBD: 3#RO5 Violations: ┄HBA (Lipinski): 4HBD (Lipinski): 3#RO5 Violations (Lipinski): ┄CX Acidic pKa: ┄CX Basic pKa: 8.91CX LogP: 2.45CX LogD: 0.94Aromatic Rings: 2Heavy Atoms: 24QED Weighted: 0.70Np Likeness Score: -0.60
References 1. Large MS, Smith LH.. (1980) Beta-adrenergic blocking agents. 19. 1-Phenyl-2-[[(substituted-amido)alkyl]amino]ethanols., 23 (2): [PMID:6102152 ] [10.1021/jm00176a002 ]