The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
5-(2-Guanidino-thiazol-4-yl)-2-methyl-1H-pyrrole-3-carboxylic acid dimethylamide: (maleate) ID: ALA1744204
PubChem CID: 54587000
Max Phase: Preclinical
Molecular Formula: C16H20N6O5S
Molecular Weight: 292.37
Molecule Type: Small molecule
This compound is available for customization.
Associated Items:
Names and Identifiers Canonical SMILES: Cc1[nH]c(-c2csc(N=C(N)N)n2)cc1C(=O)N(C)C.O=C(O)/C=C\C(=O)O
Standard InChI: InChI=1S/C12H16N6OS.C4H4O4/c1-6-7(10(19)18(2)3)4-8(15-6)9-5-20-12(16-9)17-11(13)14;5-3(6)1-2-4(7)8/h4-5,15H,1-3H3,(H4,13,14,16,17);1-2H,(H,5,6)(H,7,8)/b;2-1-
Standard InChI Key: LWAOPCYYVMCALL-BTJKTKAUSA-N
Molfile:
RDKit 2D
28 28 0 0 0 0 0 0 0 0999 V2000
8.9419 -21.9737 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.6031 -21.9450 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
8.2582 -22.4449 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.6897 -22.8758 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.9423 -22.4449 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.1552 -22.2036 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
9.7234 -22.2380 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
8.7006 -21.1865 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.8732 -21.1693 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
4.8623 -22.8931 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
6.1724 -23.5309 0.0000 S 0 0 0 0 0 0 0 0 0 0 0 0
4.0349 -22.8931 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.9595 -23.2665 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
9.8785 -23.0482 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
10.3440 -21.7037 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
3.6154 -23.5998 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
3.6212 -22.1691 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
9.2005 -20.5257 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
10.6657 -23.3240 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
9.2580 -23.5998 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.8045 -18.0543 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.6295 -18.0543 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.3920 -18.7687 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.0420 -18.7687 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.8670 -18.7687 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
6.6295 -19.4832 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
4.5670 -18.7687 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
5.8045 -19.4832 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
2 3 2 0
3 1 1 0
4 6 2 0
5 2 1 0
6 5 1 0
7 1 1 0
8 1 2 0
9 8 1 0
10 4 1 0
11 13 1 0
12 10 2 3
13 5 2 0
14 7 1 0
15 7 2 0
16 12 1 0
17 12 1 0
18 8 1 0
19 14 1 0
20 14 1 0
2 9 1 0
11 4 1 0
21 22 2 0
21 23 1 0
22 24 1 0
24 25 2 0
24 26 1 0
23 27 1 0
23 28 2 0
M END Associated Targets(Human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: Small moleculeTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 292.37Molecular Weight (Monoisotopic): 292.1106AlogP: 1.05#Rotatable Bonds: 3Polar Surface Area: 113.39Molecular Species: NEUTRALHBA: 4HBD: 3#RO5 Violations: ┄HBA (Lipinski): 7HBD (Lipinski): 5#RO5 Violations (Lipinski): ┄CX Acidic pKa: 13.04CX Basic pKa: 7.31CX LogP: 0.45CX LogD: 0.20Aromatic Rings: 2Heavy Atoms: 20QED Weighted: 0.58Np Likeness Score: -1.56
References 1. LaMattina JL, McCarthy PA, Reiter LA, Holt WF, Yeh LA.. (1990) Antiulcer agents. 4-substituted 2-guanidinothiazoles: reversible, competitive, and selective inhibitors of gastric H+,K(+)-ATPase., 33 (2): [PMID:2153817 ] [10.1021/jm00164a012 ]