The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
(2-Imino-1,5-dimethyl-1,2-dihydro-benzo[cd]indol-6-yl)-methyl-[4-(morpholine-4-sulfonyl)-benzyl]-amine; maleate ID: ALA1744235
PubChem CID: 54581127
Max Phase: Preclinical
Molecular Formula: C28H30N4O7S
Molecular Weight: 450.56
Molecule Type: Small molecule
Associated Items:
Names and Identifiers Canonical SMILES: Cc1ccc2c3c(ccc(N(C)Cc4ccc(S(=O)(=O)N5CCOCC5)cc4)c13)N=C2N.O=C(O)/C=C\C(=O)O
Standard InChI: InChI=1S/C24H26N4O3S.C4H4O4/c1-16-3-8-19-23-20(26-24(19)25)9-10-21(22(16)23)27(2)15-17-4-6-18(7-5-17)32(29,30)28-11-13-31-14-12-28;5-3(6)1-2-4(7)8/h3-10H,11-15H2,1-2H3,(H2,25,26);1-2H,(H,5,6)(H,7,8)/b;2-1-
Standard InChI Key: GUYUBZLIIYAUTQ-BTJKTKAUSA-N
Molfile:
RDKit 2D
40 43 0 0 0 0 0 0 0 0999 V2000
10.0693 -23.0759 0.0000 S 0 0 0 0 0 0 0 0 0 0 0 0
3.0915 -22.6227 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
3.1012 -23.6217 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.8906 -22.4133 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.3097 -23.1247 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.9003 -23.8410 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.1235 -23.1150 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
10.5469 -22.4035 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
5.5376 -22.3987 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.3611 -22.3889 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
9.2459 -23.0759 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.2950 -21.6921 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.3243 -24.5524 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.1186 -21.6921 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.4531 -24.1236 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
9.4846 -23.6656 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
10.7808 -23.4901 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
5.5474 -23.8215 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.7802 -23.1004 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.1478 -24.5378 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
11.4922 -21.0538 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
8.8219 -22.3645 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
8.8414 -23.7971 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
11.3703 -22.4766 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
10.1961 -21.6628 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.6037 -23.0905 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
8.0033 -22.3791 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
8.0227 -23.8020 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.7705 -21.6726 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
10.6687 -20.9855 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
11.8381 -21.8041 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.3758 -23.8117 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.8045 -18.0543 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.6295 -18.0543 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.3920 -18.7687 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.0420 -18.7687 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.8670 -18.7687 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
6.6295 -19.4832 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
4.5670 -18.7687 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
5.8045 -19.4832 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
2 4 1 0
3 6 1 0
4 12 2 0
5 7 2 0
6 5 1 0
7 9 1 0
8 1 1 0
9 10 1 0
10 19 1 0
11 1 1 0
12 14 1 0
13 20 1 0
14 9 2 0
15 3 1 0
16 1 2 0
17 1 2 0
18 7 1 0
19 26 1 0
20 18 2 0
21 30 1 0
22 11 1 0
23 11 2 0
24 8 1 0
25 8 1 0
26 28 2 0
27 22 2 0
28 23 1 0
29 10 1 0
30 25 1 0
31 24 1 0
32 18 1 0
27 26 1 0
31 21 1 0
4 5 1 0
6 13 2 0
3 2 2 0
33 34 2 0
33 35 1 0
34 36 1 0
36 37 2 0
36 38 1 0
35 39 1 0
35 40 2 0
M END Associated Targets(Human) Associated Targets(non-human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: Small moleculeTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 450.56Molecular Weight (Monoisotopic): 450.1726AlogP: 3.16#Rotatable Bonds: 5Polar Surface Area: 88.23Molecular Species: NEUTRALHBA: 6HBD: 1#RO5 Violations: ┄HBA (Lipinski): 7HBD (Lipinski): 2#RO5 Violations (Lipinski): ┄CX Acidic pKa: ┄CX Basic pKa: 8.11CX LogP: 3.14CX LogD: 2.39Aromatic Rings: 3Heavy Atoms: 32QED Weighted: 0.65Np Likeness Score: -1.46
References 1. Varney MD, Marzoni GP, Palmer CL, Deal JG, Webber S, Welsh KM, Bacquet RJ, Bartlett CA, Morse CA, Booth CL.. (1992) Crystal-structure-based design and synthesis of benz[cd]indole-containing inhibitors of thymidylate synthase., 35 (4): [PMID:1542093 ] [10.1021/jm00082a006 ] 2. Leclerc G, Decker N, Schwartz J.. (1982) Synthesis and cardiovascular activity of a new series of cyclohexylaralkylamine derivatives related to perhexiline., 25 (6): [PMID:6124638 ] [10.1021/jm00348a019 ]