The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
Biphenyl-2-carboxylic acid [4-(5,6,7,8-tetrahydro-thieno[3,2-b]azepine-4-carbonyl)-phenyl]-amide ID: ALA175813
PubChem CID: 21467167
Max Phase: Preclinical
Molecular Formula: C28H24N2O2S
Molecular Weight: 452.58
Molecule Type: Small molecule
Associated Items:
Names and Identifiers Canonical SMILES: O=C(Nc1ccc(C(=O)N2CCCCc3sccc32)cc1)c1ccccc1-c1ccccc1
Standard InChI: InChI=1S/C28H24N2O2S/c31-27(24-11-5-4-10-23(24)20-8-2-1-3-9-20)29-22-15-13-21(14-16-22)28(32)30-18-7-6-12-26-25(30)17-19-33-26/h1-5,8-11,13-17,19H,6-7,12,18H2,(H,29,31)
Standard InChI Key: FCTSOYFQOMNNFT-UHFFFAOYSA-N
Molfile:
RDKit 2D
33 37 0 0 0 0 0 0 0 0999 V2000
4.0125 -1.0875 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
3.3667 -0.5750 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.8292 -1.8917 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.0667 -4.9292 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.6750 -5.4917 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.3667 0.2500 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.4917 -6.2917 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.2500 -4.1292 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
2.5792 -0.8292 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.5792 0.5083 0.0000 S 0 0 0 0 0 0 0 0 0 0 0 0
4.4375 -2.4500 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.1000 -0.1542 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.0417 -2.1292 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
5.2792 -5.1792 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
5.7042 -6.5417 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.2167 -2.2042 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.2500 -3.2542 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.6417 -3.5667 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.8125 -0.9042 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.8542 -3.8125 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.8250 -2.7542 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.4542 -5.2417 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.1000 -6.8542 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.0125 0.7625 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.1000 -5.9792 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.5250 -7.3417 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.1667 -0.1542 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
8.0667 -5.8000 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.8875 -6.6042 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.8125 0.5833 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.7417 -7.5875 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.3125 -6.2167 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.1292 -7.0250 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2 1 1 0
3 1 1 0
4 8 1 0
5 4 1 0
6 2 2 0
7 5 2 0
8 18 1 0
9 2 1 0
10 6 1 0
11 3 1 0
12 9 2 0
13 3 2 0
14 4 2 0
15 7 1 0
16 11 1 0
17 11 2 0
18 20 2 0
19 1 1 0
20 17 1 0
21 16 2 0
22 5 1 0
23 7 1 0
24 6 1 0
25 15 2 0
26 15 1 0
27 19 1 0
28 22 2 0
29 28 1 0
30 27 1 0
31 26 2 0
32 25 1 0
33 31 1 0
30 24 1 0
10 12 1 0
21 18 1 0
23 29 2 0
32 33 2 0
M END Associated Targets(Human) Associated Targets(non-human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: Small moleculeTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 452.58Molecular Weight (Monoisotopic): 452.1558AlogP: 6.65#Rotatable Bonds: 4Polar Surface Area: 49.41Molecular Species: NEUTRALHBA: 3HBD: 1#RO5 Violations: 1HBA (Lipinski): 4HBD (Lipinski): 1#RO5 Violations (Lipinski): 1CX Acidic pKa: ┄CX Basic pKa: ┄CX LogP: 6.51CX LogD: 6.51Aromatic Rings: 4Heavy Atoms: 33QED Weighted: 0.38Np Likeness Score: -1.60
References 1. Itzhak Y, Kalir A, Weissman BA, Cohen S.. (1981) New analgesic drugs derived from phencyclidine., 24 (5): [PMID:7241506 ] [10.1021/jm00137a004 ]