The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
4-(4,9-dimethoxy-10H-indolo[3,2-b]quinolin-11-yl)-N-(2-(dimethylamino)ethyl)benzamide ID: ALA1760432
PubChem CID: 54580018
Max Phase: Preclinical
Molecular Formula: C28H28N4O3
Molecular Weight: 468.56
Molecule Type: Small molecule
This compound is available for customization.
Associated Items:
Names and Identifiers Canonical SMILES: COc1cccc2c(-c3ccc(C(=O)NCCN(C)C)cc3)c3[nH]c4c(OC)cccc4c3nc12
Standard InChI: InChI=1S/C28H28N4O3/c1-32(2)16-15-29-28(33)18-13-11-17(12-14-18)23-19-7-5-9-21(34-3)24(19)30-26-20-8-6-10-22(35-4)25(20)31-27(23)26/h5-14,31H,15-16H2,1-4H3,(H,29,33)
Standard InChI Key: MOVIGIKVZNZDAB-UHFFFAOYSA-N
Molfile:
RDKit 2D
35 39 0 0 0 0 0 0 0 0999 V2000
8.1298 -6.3807 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.8662 -7.1647 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
8.4125 -7.7830 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
8.9355 -6.2152 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
9.4834 -6.8302 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
9.2212 -7.6135 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
9.8852 -8.1049 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
10.3093 -6.8375 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
10.5549 -7.6233 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
11.3566 -7.8020 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
10.8620 -6.2334 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
11.6037 -8.5845 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
11.0439 -9.1919 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
11.2903 -9.9783 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
12.0963 -10.1586 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
12.6553 -9.5461 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
12.4058 -8.7620 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
11.6630 -6.4084 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
11.9106 -7.1991 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
12.7176 -7.3787 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
13.2777 -6.7685 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
13.0254 -5.9760 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
12.2190 -5.8001 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
12.3466 -10.9479 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
11.7894 -11.5560 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
13.1520 -11.1263 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
10.9840 -11.3776 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
10.7359 -10.5909 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
9.9305 -10.4123 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
9.6825 -9.6256 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
9.3733 -11.0205 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
8.1528 -8.5659 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
7.3448 -8.7324 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
11.9691 -5.0140 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
12.5249 -4.4045 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
8 5 1 0
16 17 2 0
17 12 1 0
10 12 1 0
1 2 2 0
5 4 2 0
18 19 1 0
8 9 2 0
19 20 1 0
4 1 1 0
20 21 2 0
9 10 1 0
21 22 1 0
10 19 2 0
22 23 2 0
23 18 1 0
5 6 1 0
18 11 2 0
11 8 1 0
24 25 1 0
24 26 2 0
15 24 1 0
25 27 1 0
2 3 1 0
27 28 1 0
12 13 2 0
28 29 1 0
3 6 2 0
29 30 1 0
13 14 1 0
29 31 1 0
6 7 1 0
3 32 1 0
14 15 2 0
32 33 1 0
7 9 1 0
23 34 1 0
15 16 1 0
34 35 1 0
M END Associated Targets(Human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: Small moleculeTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 468.56Molecular Weight (Monoisotopic): 468.2161AlogP: 4.84#Rotatable Bonds: 7Polar Surface Area: 79.48Molecular Species: BASEHBA: 5HBD: 2#RO5 Violations: ┄HBA (Lipinski): 7HBD (Lipinski): 2#RO5 Violations (Lipinski): ┄CX Acidic pKa: 11.30CX Basic pKa: 8.51CX LogP: 4.06CX LogD: 2.92Aromatic Rings: 5Heavy Atoms: 35QED Weighted: 0.36Np Likeness Score: -0.49
References 1. Riechert-Krause F, Eick A, Grünert R, Bednarski PJ, Weisz K.. (2011) In vitro anticancer activity and evaluation of DNA duplex binding affinity of phenyl-substituted indoloquinolines., 21 (8): [PMID:21414783 ] [10.1016/j.bmcl.2011.02.088 ]