The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
Biphenyl-2-carboxylic acid {4-[8-(2-pyrrolidin-1-yl-ethyl)-5,6,7,8-tetrahydro-1-thia-4,8-diaza-azulene-4-carbonyl]-phenyl}-amide ID: ALA176146
PubChem CID: 11272841
Max Phase: Preclinical
Molecular Formula: C33H34N4O2S
Molecular Weight: 550.73
Molecule Type: Small molecule
Associated Items:
Names and Identifiers Canonical SMILES: O=C(Nc1ccc(C(=O)N2CCCN(CCN3CCCC3)c3sccc32)cc1)c1ccccc1-c1ccccc1
Standard InChI: InChI=1S/C33H34N4O2S/c38-31(29-12-5-4-11-28(29)25-9-2-1-3-10-25)34-27-15-13-26(14-16-27)32(39)37-21-8-20-36(33-30(37)17-24-40-33)23-22-35-18-6-7-19-35/h1-5,9-17,24H,6-8,18-23H2,(H,34,38)
Standard InChI Key: WPUYJTITOZWSHH-UHFFFAOYSA-N
Molfile:
RDKit 2D
40 45 0 0 0 0 0 0 0 0999 V2000
2.1417 1.0458 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.1917 0.2250 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
2.7625 1.6208 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.4750 -0.2000 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.7167 -3.9375 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.5792 1.5208 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
0.7125 -4.7667 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.4250 2.3750 0.0000 S 0 0 0 0 0 0 0 0 0 0 0 0
-0.0083 -5.1917 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.4292 1.4375 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.4417 -3.5042 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
1.5917 2.2458 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.4750 -1.0292 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.3542 2.8708 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
0.7667 0.2000 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
0.0042 -3.5417 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
4.0542 2.2208 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-0.7333 -4.8042 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.8792 -0.2167 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.1792 -1.4167 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.7417 -1.4542 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.4542 -2.6750 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.8792 2.1833 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.6792 0.0458 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.9875 0.8208 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.1792 -2.2375 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.7375 -2.2792 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.4250 -5.1500 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-0.0208 -6.0167 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.1792 2.9000 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.0875 3.6458 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.4375 -5.2292 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-0.7083 -3.9750 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.7000 -6.4125 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.4167 -5.9792 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.7417 4.1542 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.4167 3.7083 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.4250 -3.5667 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-2.1583 -4.8417 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-2.1500 -4.0042 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2 1 1 0
3 1 2 0
4 2 1 0
5 11 1 0
6 3 1 0
7 5 1 0
8 3 1 0
9 7 2 0
10 1 1 0
11 22 1 0
12 10 2 0
13 4 1 0
14 23 1 0
15 4 2 0
16 5 2 0
17 6 1 0
18 9 1 0
19 2 1 0
20 13 1 0
21 13 2 0
22 27 2 0
23 17 1 0
24 19 1 0
25 6 1 0
26 20 2 0
27 21 1 0
28 7 1 0
29 9 1 0
30 14 1 0
31 14 1 0
32 18 1 0
33 18 2 0
34 35 1 0
35 28 2 0
36 31 1 0
37 30 1 0
38 33 1 0
39 32 2 0
40 38 2 0
8 12 1 0
24 25 1 0
26 22 1 0
37 36 1 0
29 34 2 0
39 40 1 0
M END Associated Targets(Human) Associated Targets(non-human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: Small moleculeTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 550.73Molecular Weight (Monoisotopic): 550.2402AlogP: 6.62#Rotatable Bonds: 7Polar Surface Area: 55.89Molecular Species: BASEHBA: 5HBD: 1#RO5 Violations: 2HBA (Lipinski): 6HBD (Lipinski): 1#RO5 Violations (Lipinski): 2CX Acidic pKa: ┄CX Basic pKa: 8.79CX LogP: 6.04CX LogD: 4.63Aromatic Rings: 4Heavy Atoms: 40QED Weighted: 0.28Np Likeness Score: -1.50
References 1. Cho H, Murakami K, Nakanishi H, Fujisawa A, Isoshima H, Niwa M, Hayakawa K, Hase Y, Uchida I, Watanabe H, Wakitani K, Aisaka K.. (2004) Synthesis and structure-activity relationships of 5,6,7,8-tetrahydro-4H-thieno[3,2-b]azepine derivatives: novel arginine vasopressin antagonists., 47 (1): [PMID:14695824 ] [10.1021/jm030287l ]