The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
trans-rac-2-(5-(2-chlorophenyl)-1-isobutyl-7-methyl-2-oxo-4,5-dihydro-1H-benzo[d]azepin-3(2H)-yl)acetic acid ID: ALA1761647
PubChem CID: 54585229
Max Phase: Preclinical
Molecular Formula: C23H26ClNO3
Molecular Weight: 399.92
Molecule Type: Small molecule
This compound is available for customization.
Associated Items:
Names and Identifiers Canonical SMILES: Cc1ccc2c(c1)[C@@H](c1ccccc1Cl)CN(CC(=O)O)C(=O)[C@@H]2CC(C)C
Standard InChI: InChI=1S/C23H26ClNO3/c1-14(2)10-19-16-9-8-15(3)11-18(16)20(17-6-4-5-7-21(17)24)12-25(23(19)28)13-22(26)27/h4-9,11,14,19-20H,10,12-13H2,1-3H3,(H,26,27)/t19-,20-/m1/s1
Standard InChI Key: GDJRPHAADWFEKK-WOJBJXKFSA-N
Molfile:
RDKit 2D
28 30 0 0 0 0 0 0 0 0999 V2000
13.4681 0.2475 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
13.0621 1.0178 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
12.2500 1.1608 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
13.1123 -0.5247 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
12.2925 -0.7143 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
11.6064 -0.1708 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
11.6044 0.6396 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
10.9027 1.0414 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
10.2024 0.6338 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
10.2083 -0.1797 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
10.9106 -0.5778 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
12.1004 -1.5682 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
13.6330 -1.1645 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
14.3386 0.2706 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
14.7538 1.0361 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
15.6243 1.0592 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
14.2985 1.7784 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
12.0440 1.9596 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
12.6350 2.5327 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
12.4295 3.3309 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
11.6339 3.5525 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
11.0439 2.9697 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
11.2525 2.1737 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
9.4857 1.0425 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
11.2648 -1.8288 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
11.0727 -2.6828 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
10.6214 -1.2355 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
13.4292 2.3091 0.0000 Cl 0 0 0 0 0 0 0 0 0 0 0 0
1 2 1 0
1 14 1 0
6 7 2 0
14 15 1 0
2 3 1 0
15 16 1 0
7 8 1 0
15 17 2 0
1 4 1 0
3 18 1 1
8 9 2 0
18 19 2 0
5 6 1 0
19 20 1 0
9 10 1 0
20 21 2 0
7 3 1 0
21 22 1 0
10 11 2 0
22 23 2 0
23 18 1 0
11 6 1 0
9 24 1 0
4 5 1 0
12 25 1 0
5 12 1 6
25 26 1 0
25 27 1 0
4 13 2 0
19 28 1 0
M END Associated Targets(Human) Associated Targets(non-human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: Small moleculeTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 399.92Molecular Weight (Monoisotopic): 399.1601AlogP: 4.84#Rotatable Bonds: 5Polar Surface Area: 57.61Molecular Species: ACIDHBA: 2HBD: 1#RO5 Violations: ┄HBA (Lipinski): 4HBD (Lipinski): 1#RO5 Violations (Lipinski): ┄CX Acidic pKa: 4.17CX Basic pKa: ┄CX LogP: 5.10CX LogD: 2.05Aromatic Rings: 2Heavy Atoms: 28QED Weighted: 0.78Np Likeness Score: -0.07
References 1. Griebenow N, Flessner T, Buchmueller A, Raabe M, Bischoff H, Kolkhof P.. (2011) Identification and optimization of tetrahydro-2H-3-benzazepin-2-ones as squalene synthase inhibitors., 21 (8): [PMID:21396815 ] [10.1016/j.bmcl.2011.02.004 ] 2. Soltis, D A DA and 9 more authors. 1995-02-01 Expression, purification, and characterization of the human squalene synthase: use of yeast and baculoviral systems. [PMID:7864626 ] 3. Cammerer, Simon B SB and 14 more authors. 2007-11 Quinuclidine derivatives as potential antiparasitics. [PMID:17709461 ] 4. Song, Yongcheng and 11 more authors. 2009-02-26 Phosphonosulfonates are potent, selective inhibitors of dehydrosqualene synthase and staphyloxanthin biosynthesis in Staphylococcus aureus. [PMID:19191557 ] 5. Lin, Fu-Yang and 7 more authors. 2012-05-10 Head-to-head prenyl tranferases: anti-infective drug targets. [PMID:22486710 ]