trans-rac-2-(5-(2-chlorophenyl)-7-fluoro-1-isobutyl-2-oxo-4,5-dihydro-1H-benzo[d]azepin-3(2H)-yl)acetic acid

ID: ALA1761648

PubChem CID: 54584271

Max Phase: Preclinical

Molecular Formula: C22H23ClFNO3

Molecular Weight: 403.88

Molecule Type: Small molecule

This compound is available for customization.

Associated Items:

Names and Identifiers

Canonical SMILES:  CC(C)C[C@H]1C(=O)N(CC(=O)O)C[C@H](c2ccccc2Cl)c2cc(F)ccc21

Standard InChI:  InChI=1S/C22H23ClFNO3/c1-13(2)9-18-15-8-7-14(24)10-17(15)19(16-5-3-4-6-20(16)23)11-25(22(18)28)12-21(26)27/h3-8,10,13,18-19H,9,11-12H2,1-2H3,(H,26,27)/t18-,19-/m1/s1

Standard InChI Key:  MQUWWAROCCFFLW-RTBURBONSA-N

Molfile:  

     RDKit          2D

 28 30  0  0  0  0  0  0  0  0999 V2000
   21.3749   -0.0025    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   20.9689    0.7682    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   20.1564    0.9112    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   21.0191   -0.7751    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   20.1989   -0.9647    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   19.5124   -0.4208    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   19.5104    0.3896    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   18.8087    0.7918    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   18.1080    0.3838    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   18.1139   -0.4297    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   18.8166   -0.8282    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   20.0068   -1.8186    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   21.5398   -1.4149    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   22.2458    0.0206    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   22.6610    0.7865    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   23.5319    0.8096    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   22.2057    1.5288    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   19.9504    1.7100    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   20.5414    2.2835    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   20.3359    3.0817    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   19.5399    3.3037    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   18.9499    2.7205    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   19.1585    1.9245    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   17.3913    0.7929    0.0000 F   0  0  0  0  0  0  0  0  0  0  0  0
   19.1708   -2.0796    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   18.9787   -2.9336    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   18.5274   -1.4859    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   21.3360    2.0599    0.0000 Cl  0  0  0  0  0  0  0  0  0  0  0  0
  1  2  1  0
  1 14  1  0
  6  7  2  0
 14 15  1  0
  2  3  1  0
 15 16  1  0
  7  8  1  0
 15 17  2  0
  1  4  1  0
  3 18  1  1
  8  9  2  0
 18 19  2  0
  5  6  1  0
 19 20  1  0
  9 10  1  0
 20 21  2  0
  7  3  1  0
 21 22  1  0
 10 11  2  0
 22 23  2  0
 23 18  1  0
 11  6  1  0
  9 24  1  0
  4  5  1  0
 12 25  1  0
  5 12  1  6
 25 26  1  0
 25 27  1  0
  4 13  2  0
 19 28  1  0
M  END

Associated Targets(Human)

FDFT1 Tchem Squalene synthetase (333 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID
Liver microsomes (16955 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Associated Targets(non-human)

Mus musculus (284745 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Molecule Features

Natural Product: NoOral: NoChemical Probe: NoParenteral: No
Molecule Type: Small moleculeTopical: NoFirst In Class: NoBlack Box: No
Chirality: NoAvailability: NoProdrug: No

Drug Indications

MESH IDMESH Heading EFO IDsEFO TermsMax Phase for IndicationReferences

Mechanisms of Action

Mechanism of ActionAction Typetarget IDTarget NameTarget TypeTarget OrganismBinding Site NameReferences

Biocomponents

Calculated Properties

Molecular Weight: 403.88Molecular Weight (Monoisotopic): 403.1350AlogP: 4.67#Rotatable Bonds: 5
Polar Surface Area: 57.61Molecular Species: ACIDHBA: 2HBD: 1
#RO5 Violations: HBA (Lipinski): 4HBD (Lipinski): 1#RO5 Violations (Lipinski):
CX Acidic pKa: 4.00CX Basic pKa: CX LogP: 4.73CX LogD: 1.57
Aromatic Rings: 2Heavy Atoms: 28QED Weighted: 0.79Np Likeness Score: -0.34

References

1. Griebenow N, Flessner T, Buchmueller A, Raabe M, Bischoff H, Kolkhof P..  (2011)  Identification and optimization of tetrahydro-2H-3-benzazepin-2-ones as squalene synthase inhibitors.,  21  (8): [PMID:21396815] [10.1016/j.bmcl.2011.02.004]
2. Soltis, D A DA and 9 more authors.  1995-02-01  Expression, purification, and characterization of the human squalene synthase: use of yeast and baculoviral systems.  [PMID:7864626]
3. Cammerer, Simon B SB and 14 more authors.  2007-11  Quinuclidine derivatives as potential antiparasitics.  [PMID:17709461]
4. Song, Yongcheng and 11 more authors.  2009-02-26  Phosphonosulfonates are potent, selective inhibitors of dehydrosqualene synthase and staphyloxanthin biosynthesis in Staphylococcus aureus.  [PMID:19191557]
5. Lin, Fu-Yang and 7 more authors.  2012-05-10  Head-to-head prenyl tranferases: anti-infective drug targets.  [PMID:22486710]

Source