trans-rac-2-(7-chloro-5-(2-chlorophenyl)-1-(2-methylallyl)-2-oxo-4,5-dihydro-1H-benzo[d]azepin-3(2H)-yl)acetic acid

ID: ALA1761650

PubChem CID: 54587203

Max Phase: Preclinical

Molecular Formula: C22H21Cl2NO3

Molecular Weight: 418.32

Molecule Type: Small molecule

This compound is available for customization.

Associated Items:

Names and Identifiers

Canonical SMILES:  C=C(C)C[C@H]1C(=O)N(CC(=O)O)C[C@H](c2ccccc2Cl)c2cc(Cl)ccc21

Standard InChI:  InChI=1S/C22H21Cl2NO3/c1-13(2)9-18-15-8-7-14(23)10-17(15)19(16-5-3-4-6-20(16)24)11-25(22(18)28)12-21(26)27/h3-8,10,18-19H,1,9,11-12H2,2H3,(H,26,27)/t18-,19-/m1/s1

Standard InChI Key:  IJZGBQZJIZOIMQ-RTBURBONSA-N

Molfile:  

     RDKit          2D

 28 30  0  0  0  0  0  0  0  0999 V2000
    5.9015   -6.6775    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    5.4955   -5.9072    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.6834   -5.7642    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.5456   -7.4497    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.7259   -7.6393    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.0397   -7.0958    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.0378   -6.2854    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.3360   -5.8836    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.6358   -6.2912    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.6417   -7.1047    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.3440   -7.5028    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.5338   -8.4932    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.0664   -8.0895    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    6.7719   -6.6544    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    7.1871   -5.8889    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    8.0576   -5.8658    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    6.7318   -5.1466    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    4.4773   -4.9654    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.0684   -4.3923    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.8629   -3.5941    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.0673   -3.3725    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.4773   -3.9553    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.6859   -4.7513    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.9191   -5.8825    0.0000 Cl  0  0  0  0  0  0  0  0  0  0  0  0
    3.6982   -8.7538    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.5061   -9.6078    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.8625   -4.6159    0.0000 Cl  0  0  0  0  0  0  0  0  0  0  0  0
    3.0547   -8.1605    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
  1  2  1  0
  1 14  1  0
  6  7  2  0
 14 15  1  0
  2  3  1  0
 15 16  1  0
  7  8  1  0
 15 17  2  0
  1  4  1  0
  3 18  1  1
  8  9  2  0
 18 19  2  0
  5  6  1  0
 19 20  1  0
  9 10  1  0
 20 21  2  0
  7  3  1  0
 21 22  1  0
 10 11  2  0
 22 23  2  0
 23 18  1  0
 11  6  1  0
  9 24  1  0
  4  5  1  0
 12 25  1  0
  5 12  1  6
 25 26  2  0
 19 27  1  0
  4 13  2  0
 25 28  1  0
M  END

Associated Targets(Human)

FDFT1 Tchem Squalene synthetase (333 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID
Liver microsomes (16955 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Associated Targets(non-human)

Mus musculus (284745 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Molecule Features

Natural Product: NoOral: NoChemical Probe: NoParenteral: No
Molecule Type: Small moleculeTopical: NoFirst In Class: NoBlack Box: No
Chirality: NoAvailability: NoProdrug: No

Drug Indications

MESH IDMESH Heading EFO IDsEFO TermsMax Phase for IndicationReferences

Mechanisms of Action

Mechanism of ActionAction Typetarget IDTarget NameTarget TypeTarget OrganismBinding Site NameReferences

Biocomponents

Calculated Properties

Molecular Weight: 418.32Molecular Weight (Monoisotopic): 417.0898AlogP: 5.10#Rotatable Bonds: 5
Polar Surface Area: 57.61Molecular Species: ACIDHBA: 2HBD: 1
#RO5 Violations: 1HBA (Lipinski): 4HBD (Lipinski): 1#RO5 Violations (Lipinski): 1
CX Acidic pKa: 3.96CX Basic pKa: CX LogP: 4.85CX LogD: 1.67
Aromatic Rings: 2Heavy Atoms: 28QED Weighted: 0.69Np Likeness Score: -0.15

References

1. Griebenow N, Flessner T, Buchmueller A, Raabe M, Bischoff H, Kolkhof P..  (2011)  Identification and optimization of tetrahydro-2H-3-benzazepin-2-ones as squalene synthase inhibitors.,  21  (8): [PMID:21396815] [10.1016/j.bmcl.2011.02.004]
2. Soltis, D A DA and 9 more authors.  1995-02-01  Expression, purification, and characterization of the human squalene synthase: use of yeast and baculoviral systems.  [PMID:7864626]
3. Cammerer, Simon B SB and 14 more authors.  2007-11  Quinuclidine derivatives as potential antiparasitics.  [PMID:17709461]
4. Song, Yongcheng and 11 more authors.  2009-02-26  Phosphonosulfonates are potent, selective inhibitors of dehydrosqualene synthase and staphyloxanthin biosynthesis in Staphylococcus aureus.  [PMID:19191557]
5. Lin, Fu-Yang and 7 more authors.  2012-05-10  Head-to-head prenyl tranferases: anti-infective drug targets.  [PMID:22486710]

Source