trans-rac-2-(1-benzyl-7-chloro-5-(2-chlorophenyl)-2-oxo-4,5-dihydro-1H-benzo[d]azepin-3(2H)-yl)acetic acid

ID: ALA1761652

PubChem CID: 54585231

Max Phase: Preclinical

Molecular Formula: C25H21Cl2NO3

Molecular Weight: 454.35

Molecule Type: Small molecule

This compound is available for customization.

Associated Items:

Names and Identifiers

Canonical SMILES:  O=C(O)CN1C[C@H](c2ccccc2Cl)c2cc(Cl)ccc2[C@@H](Cc2ccccc2)C1=O

Standard InChI:  InChI=1S/C25H21Cl2NO3/c26-17-10-11-18-20(13-17)22(19-8-4-5-9-23(19)27)14-28(15-24(29)30)25(31)21(18)12-16-6-2-1-3-7-16/h1-11,13,21-22H,12,14-15H2,(H,29,30)/t21-,22-/m1/s1

Standard InChI Key:  NNUVTLUSHGZXSS-FGZHOGPDSA-N

Molfile:  

     RDKit          2D

 31 34  0  0  0  0  0  0  0  0999 V2000
   20.9148   -7.0455    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   20.5109   -6.2790    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   19.7029   -6.1369    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   20.5607   -7.8136    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   19.7452   -8.0023    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   19.0626   -7.4616    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   19.0606   -6.6553    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   18.3625   -6.2556    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   17.6658   -6.6611    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   17.6717   -7.4705    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   18.3704   -7.8666    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   19.5541   -8.8519    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   21.0789   -8.4503    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   21.7809   -7.0224    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   22.1939   -6.2609    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   23.0600   -6.2378    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   21.7410   -5.5224    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   19.4979   -5.3420    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   20.0860   -4.7720    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   19.8815   -3.9779    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   19.0900   -3.7574    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   18.5030   -4.3371    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   18.7105   -5.1290    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   16.9528   -6.2546    0.0000 Cl  0  0  0  0  0  0  0  0  0  0  0  0
   18.7228   -9.1112    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   20.8760   -4.9944    0.0000 Cl  0  0  0  0  0  0  0  0  0  0  0  0
   18.0883   -8.5188    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   17.2577   -8.7775    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   17.0660   -9.6279    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   17.7114  -10.2192    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   18.5395   -9.9574    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
 14 15  1  0
  2  3  1  0
 15 16  1  0
  7  8  1  0
 15 17  2  0
  1  4  1  0
  3 18  1  1
  8  9  2  0
 18 19  2  0
  5  6  1  0
 19 20  1  0
  9 10  1  0
 20 21  2  0
  7  3  1  0
 21 22  1  0
 10 11  2  0
 22 23  2  0
 23 18  1  0
 11  6  1  0
  9 24  1  0
  4  5  1  0
 12 25  1  0
  5 12  1  6
 19 26  1  0
 25 27  2  0
  4 13  2  0
 27 28  1  0
  1  2  1  0
 28 29  2  0
  1 14  1  0
 29 30  1  0
  6  7  2  0
 30 31  2  0
 31 25  1  0
M  END

Associated Targets(Human)

FDFT1 Tchem Squalene synthetase (333 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID
Liver microsomes (16955 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Associated Targets(non-human)

Mus musculus (284745 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Molecule Features

Natural Product: NoOral: NoChemical Probe: NoParenteral: No
Molecule Type: Small moleculeTopical: NoFirst In Class: NoBlack Box: No
Chirality: NoAvailability: NoProdrug: No

Drug Indications

MESH IDMESH Heading EFO IDsEFO TermsMax Phase for IndicationReferences

Mechanisms of Action

Mechanism of ActionAction Typetarget IDTarget NameTarget TypeTarget OrganismBinding Site NameReferences

Biocomponents

Calculated Properties

Molecular Weight: 454.35Molecular Weight (Monoisotopic): 453.0898AlogP: 5.38#Rotatable Bonds: 5
Polar Surface Area: 57.61Molecular Species: ACIDHBA: 2HBD: 1
#RO5 Violations: 1HBA (Lipinski): 4HBD (Lipinski): 1#RO5 Violations (Lipinski): 1
CX Acidic pKa: 3.96CX Basic pKa: CX LogP: 5.60CX LogD: 2.42
Aromatic Rings: 3Heavy Atoms: 31QED Weighted: 0.56Np Likeness Score: -0.26

References

1. Griebenow N, Flessner T, Buchmueller A, Raabe M, Bischoff H, Kolkhof P..  (2011)  Identification and optimization of tetrahydro-2H-3-benzazepin-2-ones as squalene synthase inhibitors.,  21  (8): [PMID:21396815] [10.1016/j.bmcl.2011.02.004]
2. Soltis, D A DA and 9 more authors.  1995-02-01  Expression, purification, and characterization of the human squalene synthase: use of yeast and baculoviral systems.  [PMID:7864626]
3. Cammerer, Simon B SB and 14 more authors.  2007-11  Quinuclidine derivatives as potential antiparasitics.  [PMID:17709461]
4. Song, Yongcheng and 11 more authors.  2009-02-26  Phosphonosulfonates are potent, selective inhibitors of dehydrosqualene synthase and staphyloxanthin biosynthesis in Staphylococcus aureus.  [PMID:19191557]
5. Lin, Fu-Yang and 7 more authors.  2012-05-10  Head-to-head prenyl tranferases: anti-infective drug targets.  [PMID:22486710]

Source