trans-rac-1-(2-(7-chloro-5-(2,3-dimethoxyphenyl)-1-isobutyl-2-oxo-4,5-dihydro-1H-benzo[d]azepin-3(2H)-yl)acetyl)piperidine-4-carboxylic acid

ID: ALA1761662

PubChem CID: 54584272

Max Phase: Preclinical

Molecular Formula: C30H37ClN2O6

Molecular Weight: 557.09

Molecule Type: Small molecule

Names and Identifiers

Canonical SMILES:  COc1cccc([C@H]2CN(CC(=O)N3CCC(C(=O)O)CC3)C(=O)[C@H](CC(C)C)c3ccc(Cl)cc32)c1OC

Standard InChI:  InChI=1S/C30H37ClN2O6/c1-18(2)14-24-21-9-8-20(31)15-23(21)25(22-6-5-7-26(38-3)28(22)39-4)16-33(29(24)35)17-27(34)32-12-10-19(11-13-32)30(36)37/h5-9,15,18-19,24-25H,10-14,16-17H2,1-4H3,(H,36,37)/t24-,25-/m1/s1

Standard InChI Key:  WMJMBQSUCFTOQK-JWQCQUIFSA-N

Molfile:  

     RDKit          2D

 39 42  0  0  0  0  0  0  0  0999 V2000
    3.2014  -13.0801    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    2.7975  -12.3137    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.9896  -12.1714    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.8474  -13.8481    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.0319  -14.0368    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.3493  -13.4962    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.3474  -12.6899    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.6493  -12.2902    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -0.0474  -12.6957    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -0.0415  -13.5050    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.6572  -13.9011    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.8408  -14.8862    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.3654  -14.4847    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    4.0673  -13.0570    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.4804  -12.2956    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.3464  -12.2725    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    4.0275  -11.5571    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    1.7847  -11.3768    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.3726  -10.8067    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.1682  -10.0127    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.3767   -9.7921    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.7898  -10.3719    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.9974  -11.1638    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -0.7603  -12.2892    0.0000 Cl  0  0  0  0  0  0  0  0  0  0  0  0
    1.0095  -15.1455    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.8184  -15.9950    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.3695  -14.5553    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.1627  -11.0292    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    5.7927  -13.0117    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.6549  -12.9908    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    7.0720  -12.2312    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.6204  -11.4909    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.7515  -11.5101    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    7.9384  -12.2114    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    8.3906  -12.9490    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    8.3563  -11.4484    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    3.7503  -10.4562    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.7542   -9.4381    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    3.5448   -9.6582    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
 18 19  2  0
  5  6  1  0
 19 20  1  0
  9 10  1  0
 20 21  2  0
  7  3  1  0
 21 22  1  0
 10 11  2  0
 22 23  2  0
 23 18  1  0
 11  6  1  0
  9 24  1  0
  4  5  1  0
 12 25  1  0
  5 12  1  6
 25 26  1  0
 25 27  1  0
  4 13  2  0
 19 28  1  0
 16 29  1  0
  1  2  1  0
  1 14  1  0
  6  7  2  0
 14 15  1  0
  2  3  1  0
 16 33  1  0
 29 30  1  0
 30 31  1  0
 31 32  1  0
 32 33  1  0
 15 16  1  0
 31 34  1  0
  7  8  1  0
 15 17  2  0
 34 35  1  0
 34 36  2  0
  1  4  1  0
 28 37  1  0
  3 18  1  1
 20 38  1  0
  8  9  2  0
 38 39  1  0
M  END

Alternative Forms

1. Parent:

   

   ALA1761662

   trans-rac-1-(2-(7-chloro-5-(2,3-dimethoxyphenyl)-1-isobutyl-2-oxo-4,5-dihydro-1H-benzo[d]azepin-3(2H)-yl)acetyl)piperidine-4-carboxylic acid

Molecule Features

Natural Product: No

Oral: No

Chemical Probe: No

Parenteral: No

Molecule Type: Small molecule

Topical: No

First In Class: No

Black Box: No

Chirality: No

Availability: No

Prodrug: No

Calculated Properties

Molecular Weight: 557.09

Molecular Weight (Monoisotopic): 556.2340

AlogP: 4.78

#Rotatable Bonds: 8

Polar Surface Area: 96.38

Molecular Species: ACID

HBA: 5

HBD: 1

#RO5 Violations: 1

HBA (Lipinski): 8

HBD (Lipinski): 1

#RO5 Violations (Lipinski): 1

CX Acidic pKa: 4.04

CX Basic pKa: ┄

CX LogP: 3.99

CX LogD: 0.86

Aromatic Rings: 2

Heavy Atoms: 39

QED Weighted: 0.50

Np Likeness Score: -0.37

References

1. Griebenow N, Flessner T, Buchmueller A, Raabe M, Bischoff H, Kolkhof P..  (2011)  Identification and optimization of tetrahydro-2H-3-benzazepin-2-ones as squalene synthase inhibitors.,  21  (8): [PMID:21396815] [10.1016/j.bmcl.2011.02.004]

2. Soltis, D A DA and 9 more authors.  1995-02-01  Expression, purification, and characterization of the human squalene synthase: use of yeast and baculoviral systems.  [PMID:7864626]

3. Cammerer, Simon B SB and 14 more authors.  2007-11  Quinuclidine derivatives as potential antiparasitics.  [PMID:17709461]

4. Song, Yongcheng and 11 more authors.  2009-02-26  Phosphonosulfonates are potent, selective inhibitors of dehydrosqualene synthase and staphyloxanthin biosynthesis in Staphylococcus aureus.  [PMID:19191557]

5. Lin, Fu-Yang and 7 more authors.  2012-05-10  Head-to-head prenyl tranferases: anti-infective drug targets.  [PMID:22486710]

Source

Source(1):

• Scientific Literature