1-(2-((1S,5S)-7-chloro-5-(2,3-dimethoxyphenyl)-1-isobutyl-2-oxo-4,5-dihydro-1H-benzo[d]azepin-3(2H)-yl)acetyl)piperidine-4-carboxylic acid

ID: ALA1761663

PubChem CID: 54582327

Max Phase: Preclinical

Molecular Formula: C30H37ClN2O6

Molecular Weight: 557.09

Molecule Type: Small molecule

Names and Identifiers

Canonical SMILES:  COc1cccc([C@H]2CN(CC(=O)N3CCC(C(=O)O)CC3)C(=O)[C@@H](CC(C)C)c3ccc(Cl)cc32)c1OC

Standard InChI:  InChI=1S/C30H37ClN2O6/c1-18(2)14-24-21-9-8-20(31)15-23(21)25(22-6-5-7-26(38-3)28(22)39-4)16-33(29(24)35)17-27(34)32-12-10-19(11-13-32)30(36)37/h5-9,15,18-19,24-25H,10-14,16-17H2,1-4H3,(H,36,37)/t24-,25+/m0/s1

Standard InChI Key:  WMJMBQSUCFTOQK-LOSJGSFVSA-N

Molfile:  

     RDKit          2D

 39 42  0  0  0  0  0  0  0  0999 V2000
   11.5504  -19.6948    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   11.1477  -18.9228    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   10.3380  -18.7827    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   11.1982  -20.4610    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   10.3769  -20.6505    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    9.6943  -20.1076    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    9.6956  -19.3003    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    8.9936  -18.9040    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    8.2980  -19.3091    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    8.3027  -20.1168    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    9.0014  -20.5160    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   10.1879  -21.5023    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   11.7152  -21.0990    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   12.4188  -19.6682    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   12.8311  -18.9079    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   13.6996  -18.8856    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   12.3793  -18.1658    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   10.1321  -17.9846    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   10.7216  -17.4138    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   10.5164  -16.6209    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    9.7232  -16.3999    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    9.1353  -16.9811    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    9.3409  -17.7706    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    7.5819  -18.9025    0.0000 Cl  0  0  0  0  0  0  0  0  0  0  0  0
    9.3553  -21.7612    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    9.1619  -22.6131    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    8.7118  -21.1725    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   11.5126  -17.6378    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   14.1499  -19.6247    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   15.0084  -19.6057    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   15.4270  -18.8440    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   14.9770  -18.0988    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   14.1043  -18.1197    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   16.2961  -18.8223    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   16.7509  -19.5633    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   16.7158  -18.0596    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   12.1016  -17.0627    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   11.1030  -16.0432    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   11.8949  -16.2639    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
  1  2  1  0
  2  3  1  0
  1  4  1  0
  5  6  1  0
  7  3  1  0
  4  5  1  0
  6  7  2  0
  7  8  1  0
  8  9  2  0
  9 10  1  0
 10 11  2  0
 11  6  1  0
  5 12  1  1
  4 13  2  0
  1 14  1  0
 14 15  1  0
 15 16  1  0
 15 17  2  0
  3 18  1  1
 18 19  2  0
 19 20  1  0
 20 21  2  0
 21 22  1  0
 22 23  2  0
 23 18  1  0
  9 24  1  0
 12 25  1  0
 25 26  1  0
 25 27  1  0
 19 28  1  0
 16 29  1  0
 16 33  1  0
 29 30  1  0
 30 31  1  0
 31 32  1  0
 32 33  1  0
 31 34  1  0
 34 35  1  0
 34 36  2  0
 28 37  1  0
 20 38  1  0
 38 39  1  0
M  END

Alternative Forms

1. Parent:

   

   ALA1761663

   1-(2-((1S,5S)-7-chloro-5-(2,3-dimethoxyphenyl)-1-isobutyl-2-oxo-4,5-dihydro-1H-benzo[d]azepin-3(2H)-yl)acetyl)piperidine-4-carboxylic acid

Molecule Features

Natural Product: No

Oral: No

Chemical Probe: No

Parenteral: No

Molecule Type: Small molecule

Topical: No

First In Class: No

Black Box: No

Chirality: No

Availability: No

Prodrug: No

Calculated Properties

Molecular Weight: 557.09

Molecular Weight (Monoisotopic): 556.2340

AlogP: 4.78

#Rotatable Bonds: 8

Polar Surface Area: 96.38

Molecular Species: ACID

HBA: 5

HBD: 1

#RO5 Violations: 1

HBA (Lipinski): 8

HBD (Lipinski): 1

#RO5 Violations (Lipinski): 1

CX Acidic pKa: 4.04

CX Basic pKa: ┄

CX LogP: 3.99

CX LogD: 0.86

Aromatic Rings: 2

Heavy Atoms: 39

QED Weighted: 0.50

Np Likeness Score: -0.37

References

1. Griebenow N, Flessner T, Buchmueller A, Raabe M, Bischoff H, Kolkhof P..  (2011)  Identification and optimization of tetrahydro-2H-3-benzazepin-2-ones as squalene synthase inhibitors.,  21  (8): [PMID:21396815] [10.1016/j.bmcl.2011.02.004]

2. Soltis, D A DA and 9 more authors.  1995-02-01  Expression, purification, and characterization of the human squalene synthase: use of yeast and baculoviral systems.  [PMID:7864626]

3. Cammerer, Simon B SB and 14 more authors.  2007-11  Quinuclidine derivatives as potential antiparasitics.  [PMID:17709461]

4. Song, Yongcheng and 11 more authors.  2009-02-26  Phosphonosulfonates are potent, selective inhibitors of dehydrosqualene synthase and staphyloxanthin biosynthesis in Staphylococcus aureus.  [PMID:19191557]

5. Lin, Fu-Yang and 7 more authors.  2012-05-10  Head-to-head prenyl tranferases: anti-infective drug targets.  [PMID:22486710]

Source

Source(1):

• Scientific Literature