The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
(Z)-6,6',7,3'alpha-Diligustilide ID: ALA1765388
PubChem CID: 54582271
Max Phase: Preclinical
Molecular Formula: C24H28O4
Molecular Weight: 380.48
Molecule Type: Small molecule
Associated Items:
Names and Identifiers Synonyms: (Z)-6,6',7,3'Alpha-Diligustilide | (Z)-6,6',7,3'Alpha-Diligustilide|CHEMBL1765388
Canonical SMILES: CCC/C=C1\OC(=O)C2=C[C@H]3CC[C@]21C1C2=C(CC[C@H]13)/C(=C\CCC)OC2=O
Standard InChI: InChI=1S/C24H28O4/c1-3-5-7-18-16-10-9-15-14-11-12-24(21(15)20(16)23(26)27-18)17(13-14)22(25)28-19(24)8-6-4-2/h7-8,13-15,21H,3-6,9-12H2,1-2H3/b18-7+,19-8-/t14-,15+,21?,24+/m1/s1
Standard InChI Key: UBBRXVRQZJSDAK-FGUXGJARSA-N
Molfile:
RDKit 2D
30 34 0 0 0 0 0 0 0 0999 V2000
10.7302 -9.3336 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
12.1531 -9.3336 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
12.1520 -10.1588 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
13.5825 -9.3426 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
12.8670 -8.9221 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
13.5771 -10.1679 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
12.8615 -10.5734 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
13.0286 -11.3803 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
13.8451 -11.4717 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
14.1857 -10.7204 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
12.4711 -11.9939 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
14.9937 -10.5571 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
15.2555 -9.7742 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
16.0635 -9.6067 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
16.3211 -8.8237 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
11.4437 -10.5693 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
10.7244 -10.1595 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
10.1159 -10.7143 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
10.4536 -11.4646 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
11.2722 -11.3770 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
9.3087 -10.5429 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
11.8267 -11.9892 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
11.5755 -12.7755 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
12.1299 -13.3877 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
11.8746 -14.1700 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
11.8488 -9.8529 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
11.1324 -9.4404 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
12.1531 -8.5083 0.0000 H 0 0 0 0 0 0 0 0 0 0 0 0
11.4437 -8.9188 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
11.4437 -8.0938 0.0000 H 0 0 0 0 0 0 0 0 0 0 0 0
1 17 2 0
29 1 1 0
16 3 1 0
29 2 1 0
2 3 1 0
2 5 1 0
3 7 1 0
6 4 1 0
4 5 1 0
6 7 2 0
7 8 1 0
8 9 1 0
9 10 1 0
10 6 1 0
8 11 2 0
10 12 2 0
12 13 1 0
13 14 1 0
14 15 1 0
16 17 1 0
17 18 1 0
18 19 1 0
19 20 1 0
20 16 1 0
18 21 2 0
20 22 2 0
22 23 1 0
23 24 1 0
24 25 1 0
16 26 1 1
26 27 1 0
29 27 1 0
2 28 1 1
29 30 1 1
M END Associated Targets(non-human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: Small moleculeTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 380.48Molecular Weight (Monoisotopic): 380.1988AlogP: 5.13#Rotatable Bonds: 4Polar Surface Area: 52.60Molecular Species: NEUTRALHBA: 4HBD: ┄#RO5 Violations: 1HBA (Lipinski): 4HBD (Lipinski): ┄#RO5 Violations (Lipinski): 1CX Acidic pKa: ┄CX Basic pKa: ┄CX LogP: 4.69CX LogD: 4.69Aromatic Rings: ┄Heavy Atoms: 28QED Weighted: 0.63Np Likeness Score: 3.57
References 1. Brindis F, Rodríguez R, Bye R, González-Andrade M, Mata R.. (2011) (Z)-3-butylidenephthalide from Ligusticum porteri , an α-glucosidase inhibitor., 74 (3): [PMID:20879744 ] [10.1021/np100447a ]