(Z)-6,6',7,3'alpha-Diligustilide

ID: ALA1765388

PubChem CID: 54582271

Max Phase: Preclinical

Molecular Formula: C24H28O4

Molecular Weight: 380.48

Molecule Type: Small molecule

Associated Items:

This compound is not in our inventory system

Names and Identifiers

Synonyms: (Z)-6,6',7,3'Alpha-Diligustilide | (Z)-6,6',7,3'Alpha-Diligustilide|CHEMBL1765388

Canonical SMILES:  CCC/C=C1\OC(=O)C2=C[C@H]3CC[C@]21C1C2=C(CC[C@H]13)/C(=C\CCC)OC2=O

Standard InChI:  InChI=1S/C24H28O4/c1-3-5-7-18-16-10-9-15-14-11-12-24(21(15)20(16)23(26)27-18)17(13-14)22(25)28-19(24)8-6-4-2/h7-8,13-15,21H,3-6,9-12H2,1-2H3/b18-7+,19-8-/t14-,15+,21?,24+/m1/s1

Standard InChI Key:  UBBRXVRQZJSDAK-FGUXGJARSA-N

Molfile:  

     RDKit          2D

 30 34  0  0  0  0  0  0  0  0999 V2000
   10.7302   -9.3336    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   12.1531   -9.3336    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   12.1520  -10.1588    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   13.5825   -9.3426    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   12.8670   -8.9221    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   13.5771  -10.1679    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   12.8615  -10.5734    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   13.0286  -11.3803    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   13.8451  -11.4717    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   14.1857  -10.7204    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   12.4711  -11.9939    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   14.9937  -10.5571    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   15.2555   -9.7742    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   16.0635   -9.6067    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   16.3211   -8.8237    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   11.4437  -10.5693    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   10.7244  -10.1595    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   10.1159  -10.7143    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   10.4536  -11.4646    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   11.2722  -11.3770    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    9.3087  -10.5429    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   11.8267  -11.9892    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   11.5755  -12.7755    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   12.1299  -13.3877    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   11.8746  -14.1700    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   11.8488   -9.8529    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   11.1324   -9.4404    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   12.1531   -8.5083    0.0000 H   0  0  0  0  0  0  0  0  0  0  0  0
   11.4437   -8.9188    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   11.4437   -8.0938    0.0000 H   0  0  0  0  0  0  0  0  0  0  0  0
  1 17  2  0
 29  1  1  0
 16  3  1  0
 29  2  1  0
  2  3  1  0
  2  5  1  0
  3  7  1  0
  6  4  1  0
  4  5  1  0
  6  7  2  0
  7  8  1  0
  8  9  1  0
  9 10  1  0
 10  6  1  0
  8 11  2  0
 10 12  2  0
 12 13  1  0
 13 14  1  0
 14 15  1  0
 16 17  1  0
 17 18  1  0
 18 19  1  0
 19 20  1  0
 20 16  1  0
 18 21  2  0
 20 22  2  0
 22 23  1  0
 23 24  1  0
 24 25  1  0
 16 26  1  1
 26 27  1  0
 29 27  1  0
  2 28  1  1
 29 30  1  1
M  END

Alternative Forms

Associated Targets(non-human)

Mus musculus (284745 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID
MAL62 Alpha-glucosidase MAL62 (106 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Molecule Features

Natural Product: NoOral: NoChemical Probe: NoParenteral: No
Molecule Type: Small moleculeTopical: NoFirst In Class: NoBlack Box: No
Chirality: NoAvailability: NoProdrug: No

Drug Indications

MESH IDMESH Heading EFO IDsEFO TermsMax Phase for IndicationReferences

Mechanisms of Action

Mechanism of ActionAction Typetarget IDTarget NameTarget TypeTarget OrganismBinding Site NameReferences

Calculated Properties

Molecular Weight: 380.48Molecular Weight (Monoisotopic): 380.1988AlogP: 5.13#Rotatable Bonds: 4
Polar Surface Area: 52.60Molecular Species: NEUTRALHBA: 4HBD:
#RO5 Violations: 1HBA (Lipinski): 4HBD (Lipinski): #RO5 Violations (Lipinski): 1
CX Acidic pKa: CX Basic pKa: CX LogP: 4.69CX LogD: 4.69
Aromatic Rings: Heavy Atoms: 28QED Weighted: 0.63Np Likeness Score: 3.57

References

1. Brindis F, Rodríguez R, Bye R, González-Andrade M, Mata R..  (2011)  (Z)-3-butylidenephthalide from Ligusticum porteri , an α-glucosidase inhibitor.,  74  (3): [PMID:20879744] [10.1021/np100447a]

Source