The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
2-[4-(4-(2-Methoxyphenyl)piperazin-1-yl)butyl]-1-oxo-1,2,3,4-tetrahydroisoquinoline-6-carbonitrile ID: ALA1771113
PubChem CID: 54585811
Max Phase: Preclinical
Molecular Formula: C25H30N4O2
Molecular Weight: 418.54
Molecule Type: Small molecule
Associated Items:
Names and Identifiers Canonical SMILES: COc1ccccc1N1CCN(CCCCN2CCc3cc(C#N)ccc3C2=O)CC1
Standard InChI: InChI=1S/C25H30N4O2/c1-31-24-7-3-2-6-23(24)28-16-14-27(15-17-28)11-4-5-12-29-13-10-21-18-20(19-26)8-9-22(21)25(29)30/h2-3,6-9,18H,4-5,10-17H2,1H3
Standard InChI Key: UAORLSRHSCKPEH-UHFFFAOYSA-N
Molfile:
RDKit 2D
31 34 0 0 0 0 0 0 0 0999 V2000
9.2395 -12.7281 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
9.2384 -13.5555 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
9.9532 -13.9684 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
9.9514 -12.3155 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
10.6667 -12.7245 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
10.6655 -13.5576 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
11.3823 -13.9728 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
12.1049 -13.5596 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
12.1061 -12.7266 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
11.3847 -12.3068 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
11.3847 -11.4818 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
12.8215 -12.3159 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
13.5350 -12.7301 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
14.2504 -12.3194 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
14.9638 -12.7336 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
15.6792 -12.3229 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
16.3929 -12.7411 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
17.1062 -12.3339 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
17.1125 -11.5086 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
16.3993 -11.0922 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
15.6797 -11.5010 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
17.8267 -11.1025 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
18.5387 -11.5211 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
19.2553 -11.1138 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
19.2609 -10.2880 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
18.5439 -9.8713 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
17.8304 -10.2809 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
18.5327 -12.3461 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
19.2442 -12.7636 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
8.5237 -13.9674 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.8131 -14.3791 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
14 15 1 0
5 4 2 0
15 16 1 0
16 17 1 0
4 1 1 0
5 10 1 0
6 7 1 0
7 8 1 0
8 9 1 0
16 21 1 0
17 18 1 0
18 19 1 0
19 20 1 0
20 21 1 0
9 10 1 0
5 6 1 0
22 23 2 0
10 11 2 0
23 24 1 0
24 25 2 0
9 12 1 0
25 26 1 0
2 3 1 0
26 27 2 0
27 22 1 0
19 22 1 0
12 13 1 0
23 28 1 0
3 6 2 0
28 29 1 0
13 14 1 0
2 30 1 0
1 2 2 0
30 31 3 0
M END Associated Targets(Human) Associated Targets(non-human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: Small moleculeTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 418.54Molecular Weight (Monoisotopic): 418.2369AlogP: 3.17#Rotatable Bonds: 7Polar Surface Area: 59.81Molecular Species: NEUTRALHBA: 5HBD: ┄#RO5 Violations: ┄HBA (Lipinski): 6HBD (Lipinski): ┄#RO5 Violations (Lipinski): ┄CX Acidic pKa: ┄CX Basic pKa: 7.87CX LogP: 3.34CX LogD: 2.75Aromatic Rings: 2Heavy Atoms: 31QED Weighted: 0.65Np Likeness Score: -1.24
References 1. Ortega R, Hübner H, Gmeiner P, Masaguer CF.. (2011) Aromatic ring functionalization of benzolactam derivatives: new potent dopamine D3 receptor ligands., 21 (9): [PMID:21273071 ] [10.1016/j.bmcl.2010.12.083 ]