The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
platensimycin A2 ID: ALA1773136
PubChem CID: 54580073
Max Phase: Preclinical
Molecular Formula: C24H27NO8
Molecular Weight: 457.48
Molecule Type: Small molecule
This compound is available for customization.
Associated Items:
Names and Identifiers Synonyms: Platensimycin A2 | CHEMBL1773136
Canonical SMILES: C[C@@]12CC34C=CC(=O)[C@@](C)(CCC(=O)Nc5c(O)ccc(C(=O)O)c5O)C3[C@H](CC1[C@H]4O)O2
Standard InChI: InChI=1S/C24H27NO8/c1-22(7-6-16(28)25-17-13(26)4-3-11(18(17)29)21(31)32)15(27)5-8-24-10-23(2)12(20(24)30)9-14(33-23)19(22)24/h3-5,8,12,14,19-20,26,29-30H,6-7,9-10H2,1-2H3,(H,25,28)(H,31,32)/t12?,14-,19?,20+,22+,23+,24?/m0/s1
Standard InChI Key: VAAYQILRAJLVSM-GEELLUDZSA-N
Molfile:
RDKit 2D
34 38 0 0 0 0 0 0 0 0999 V2000
13.1429 -3.4883 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
13.1418 -4.3187 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
13.8578 -4.7312 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
14.5750 -4.3183 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
14.5724 -3.4851 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
13.8561 -3.0758 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
15.2794 -3.0666 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
13.8576 -5.5556 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
12.4256 -4.7302 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
11.7176 -4.3175 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
12.4249 -5.5547 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
15.2840 -4.7292 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
15.9994 -4.3160 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
16.7159 -4.7270 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
15.9981 -3.4878 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
17.4313 -4.3137 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
18.1289 -4.5913 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
18.8557 -4.3115 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
19.5722 -4.7225 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
18.8543 -3.4833 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
18.1402 -5.5455 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
19.5675 -5.5455 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
18.9340 -5.3280 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
18.1288 -3.8089 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
17.3424 -5.2630 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
16.9341 -5.9653 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
17.7127 -5.7288 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
18.4722 -6.1065 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
17.9264 -6.5225 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
17.7242 -4.9653 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
17.2279 -4.5875 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
18.7317 -4.7630 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
16.5448 -5.0455 0.0000 H 0 0 0 0 0 0 0 0 0 0 0 0
19.5256 -3.9616 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
16 17 1 0
17 18 1 0
2 9 1 0
18 19 1 0
4 5 1 0
18 20 2 0
9 10 1 0
17 21 1 0
2 3 1 0
19 22 2 0
9 11 2 0
21 23 1 0
23 22 1 0
5 6 2 0
17 24 1 1
4 12 1 0
21 25 1 0
6 1 1 0
25 26 1 0
12 13 1 0
26 27 1 0
1 2 2 0
27 28 1 0
23 28 1 0
13 14 1 0
27 29 1 6
5 7 1 0
27 30 1 0
13 15 2 0
25 31 1 0
31 30 1 0
3 4 2 0
23 32 1 0
30 32 1 0
14 16 1 0
25 33 1 6
3 8 1 0
32 34 1 1
M END Associated Targets(non-human) Molecule Features Natural Product: YesOral: NoChemical Probe: NoParenteral: NoMolecule Type: Small moleculeTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 457.48Molecular Weight (Monoisotopic): 457.1737AlogP: 2.20#Rotatable Bonds: 5Polar Surface Area: 153.39Molecular Species: ACIDHBA: 7HBD: 5#RO5 Violations: ┄HBA (Lipinski): 9HBD (Lipinski): 5#RO5 Violations (Lipinski): ┄CX Acidic pKa: 2.96CX Basic pKa: ┄CX LogP: 2.05CX LogD: -1.44Aromatic Rings: 1Heavy Atoms: 33QED Weighted: 0.42Np Likeness Score: 2.54
References 1. Zhang C, Ondeyka J, Herath K, Jayasuriya H, Guan Z, Zink DL, Dietrich L, Burgess B, Ha SN, Wang J, Singh SB.. (2011) Platensimycin and platencin congeners from Streptomyces platensis., 74 (3): [PMID:21214253 ] [10.1021/np100635f ]