The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
Epipodophyllotoxin 4-[N-(2-propynyl)]carbamate ID: ALA1773342
PubChem CID: 54580154
Max Phase: Preclinical
Molecular Formula: C26H25NO9
Molecular Weight: 495.48
Molecule Type: Small molecule
This compound is available for customization.
Associated Items:
Names and Identifiers Canonical SMILES: C#CCNC(=O)O[C@@H]1c2cc3c(cc2[C@@H](c2cc(OC)c(OC)c(OC)c2)[C@H]2C(=O)OC[C@@H]21)OCO3
Standard InChI: InChI=1S/C26H25NO9/c1-5-6-27-26(29)36-23-15-10-18-17(34-12-35-18)9-14(15)21(22-16(23)11-33-25(22)28)13-7-19(30-2)24(32-4)20(8-13)31-3/h1,7-10,16,21-23H,6,11-12H2,2-4H3,(H,27,29)/t16-,21+,22-,23+/m0/s1
Standard InChI Key: WLGYXVZLJAOZGE-AZIXLERZSA-N
Molfile:
RDKit 2D
38 42 0 0 0 0 0 0 0 0999 V2000
0.6363 1.2333 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-0.7928 0.4083 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.6363 0.4083 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-0.0803 -0.0042 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-0.7928 1.2333 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-0.0803 1.6500 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-0.0803 -0.8292 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.4238 0.1583 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.5137 -0.0042 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.5137 1.6458 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-0.0887 -2.4750 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.9072 0.8208 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
1.4238 1.4875 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-0.8012 -2.0625 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.6238 -2.0542 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-2.2262 1.2333 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-2.2262 0.4083 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-0.8012 -1.2375 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.6238 -1.2375 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-3.0012 0.1458 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
-3.0137 1.4833 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
-3.4887 0.8083 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.6738 -0.6292 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
-0.0803 2.4750 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
-0.0887 -3.3000 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
-1.5137 -2.4667 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
1.3363 -2.4667 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
-0.8012 -3.7125 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-2.2303 -2.0542 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.3363 -3.2917 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.6322 -0.4125 0.0000 H 0 0 0 0 0 0 0 0 0 0 0 0
0.6322 2.0583 0.0000 H 0 0 0 0 0 0 0 0 0 0 0 0
0.6341 2.8875 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.6341 3.7125 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
1.3486 2.4750 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
2.0631 2.8875 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.7759 2.4759 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.4887 2.0644 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4 7 1 6
8 3 1 0
9 2 2 0
10 5 2 0
11 15 1 0
12 13 1 0
13 1 1 0
14 18 1 0
15 19 2 0
16 10 1 0
17 16 2 0
18 7 2 0
19 7 1 0
20 17 1 0
21 16 1 0
22 21 1 0
23 8 2 0
6 24 1 1
25 11 1 0
26 14 1 0
27 15 1 0
28 25 1 0
29 26 1 0
30 27 1 0
3 31 1 1
1 32 1 6
8 12 1 0
2 4 1 0
17 9 1 0
14 11 2 0
22 20 1 0
24 33 1 0
2 5 1 0
33 34 2 0
3 1 1 0
33 35 1 0
4 3 1 0
35 36 1 0
5 6 1 0
36 37 1 0
6 1 1 0
37 38 3 0
M END Associated Targets(Human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: Small moleculeTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 495.48Molecular Weight (Monoisotopic): 495.1529AlogP: 2.78#Rotatable Bonds: 6Polar Surface Area: 110.78Molecular Species: NEUTRALHBA: 9HBD: 1#RO5 Violations: ┄HBA (Lipinski): 10HBD (Lipinski): 1#RO5 Violations (Lipinski): ┄CX Acidic pKa: 12.69CX Basic pKa: ┄CX LogP: 2.18CX LogD: 2.18Aromatic Rings: 2Heavy Atoms: 36QED Weighted: 0.48Np Likeness Score: 0.95
References 1. Kamal A, Kumar BA, Suresh P, Juvekar A, Zingde S.. (2011) Synthesis of 4β-carbamoyl epipodophyllotoxins as potential antitumour agents., 19 (9): [PMID:21489802 ] [10.1016/j.bmc.2011.03.030 ]