The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
Epipodophyllotoxin 4-[2-(dimethylamino)ethyl]carbamate ID: ALA1773346
PubChem CID: 54580155
Max Phase: Preclinical
Molecular Formula: C27H32N2O9
Molecular Weight: 528.56
Molecule Type: Small molecule
This compound is available for customization.
Associated Items:
Names and Identifiers Synonyms: Epipodophyllotoxin 4-[2-(Dimethylamino)Ethyl]Carbamate | CHEMBL1773346|Epipodophyllotoxin 4-[2-(Dimethylamino)Ethyl]Carbamate
Canonical SMILES: COc1cc([C@@H]2c3cc4c(cc3[C@@H](OC(=O)NCCN(C)C)[C@H]3COC(=O)[C@H]23)OCO4)cc(OC)c1OC
Standard InChI: InChI=1S/C27H32N2O9/c1-29(2)7-6-28-27(31)38-24-16-11-19-18(36-13-37-19)10-15(16)22(23-17(24)12-35-26(23)30)14-8-20(32-3)25(34-5)21(9-14)33-4/h8-11,17,22-24H,6-7,12-13H2,1-5H3,(H,28,31)/t17-,22+,23-,24+/m0/s1
Standard InChI Key: DAWXSSJTUYLBPJ-QQJYNPJZSA-N
Molfile:
RDKit 2D
40 44 0 0 0 0 0 0 0 0999 V2000
8.0667 -19.7542 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.6375 -20.5792 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
8.0667 -20.5792 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.3500 -20.9917 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.6375 -19.7542 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.3500 -19.3375 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.3500 -21.8167 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
8.8542 -20.8292 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.9167 -20.9917 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.9167 -19.3417 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.3417 -23.4625 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
9.3375 -20.1667 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
8.8542 -19.5000 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.6292 -23.0500 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
8.0542 -23.0417 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.2042 -19.7542 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.2042 -20.5792 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.6292 -22.2250 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
8.0542 -22.2250 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.4292 -20.8417 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
4.4167 -19.5042 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
3.9417 -20.1792 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
9.1042 -21.6167 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
7.3500 -18.5125 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
7.3417 -24.2875 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
5.9167 -23.4542 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
8.7667 -23.4542 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
6.6292 -24.7000 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.2000 -23.0417 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
8.7667 -24.2792 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
8.0625 -21.4000 0.0000 H 0 0 0 0 0 0 0 0 0 0 0 0
8.0625 -18.9292 0.0000 H 0 0 0 0 0 0 0 0 0 0 0 0
8.0645 -18.1000 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
8.0645 -17.2750 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
8.7789 -18.5125 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
9.4934 -18.1000 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
10.2079 -18.5125 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
10.9224 -18.1000 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
11.6368 -18.5125 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
10.9224 -17.2750 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
9 2 2 0
10 5 2 0
11 15 1 0
12 13 1 0
13 1 1 0
14 18 1 0
15 19 2 0
16 10 1 0
17 16 2 0
18 7 2 0
19 7 1 0
20 17 1 0
21 16 1 0
22 21 1 0
23 8 2 0
6 24 1 1
25 11 1 0
26 14 1 0
27 15 1 0
28 25 1 0
29 26 1 0
30 27 1 0
3 31 1 1
1 32 1 6
8 12 1 0
2 4 1 0
17 9 1 0
14 11 2 0
22 20 1 0
24 33 1 0
2 5 1 0
33 34 2 0
3 1 1 0
33 35 1 0
4 3 1 0
35 36 1 0
5 6 1 0
36 37 1 0
6 1 1 0
37 38 1 0
4 7 1 6
38 39 1 0
8 3 1 0
38 40 1 0
M END Associated Targets(Human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: Small moleculeTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 528.56Molecular Weight (Monoisotopic): 528.2108AlogP: 2.70#Rotatable Bonds: 8Polar Surface Area: 114.02Molecular Species: BASEHBA: 10HBD: 1#RO5 Violations: 1HBA (Lipinski): 11HBD (Lipinski): 1#RO5 Violations (Lipinski): 2CX Acidic pKa: ┄CX Basic pKa: 8.51CX LogP: 1.97CX LogD: 0.84Aromatic Rings: 2Heavy Atoms: 38QED Weighted: 0.51Np Likeness Score: 0.83
References 1. Kamal A, Kumar BA, Suresh P, Juvekar A, Zingde S.. (2011) Synthesis of 4β-carbamoyl epipodophyllotoxins as potential antitumour agents., 19 (9): [PMID:21489802 ] [10.1016/j.bmc.2011.03.030 ]