3',5-dimethoxy-4'-(2R,3-dihydroxy-3-methylbutoxyl)-3'',3''-dimethylpyrano-(6,7)-isoflavone

ID: ALA1773672

Cas Number: 1292766-20-1

PubChem CID: 52951513

Max Phase: Preclinical

Molecular Formula: C27H30O8

Molecular Weight: 482.53

Molecule Type: Small molecule

Names and Identifiers

Synonyms: Pierreione A | Pierreione A|CHEBI:68047|CHEMBL1773672|DTXSID601104744|Q27136543|1292766-20-1|2H,6H-Benzo[1,2-b:5,4-b']dipyran-6-one, 7-[4-[(2R)-2,3-dihydroxy-3-methylbutoxy]-3-methoxyphenyl]-5-methoxy-2,2-dimethyl-|3',5-dimethoxy-4'-(2R,3-dihydroxy-3-methylbutoxyl)-3'',3''-dimethylpyrano-(6,7)-isoflavone|7-(4-{[(2R)-2,3-dihydroxy-3-methylbutyl]oxy}-3-methoxyphenyl)-5-methoxy-2,2-dimethyl-2H,6H-pyrano[3,2-g]chromen-6-one

Canonical SMILES:  COc1cc(-c2coc3cc4c(c(OC)c3c2=O)C=CC(C)(C)O4)ccc1OC[C@@H](O)C(C)(C)O

Standard InChI:  InChI=1S/C27H30O8/c1-26(2)10-9-16-19(35-26)12-21-23(25(16)32-6)24(29)17(13-33-21)15-7-8-18(20(11-15)31-5)34-14-22(28)27(3,4)30/h7-13,22,28,30H,14H2,1-6H3/t22-/m1/s1

Standard InChI Key:  XYVIHRJUIIUQSN-JOCHJYFZSA-N

Molfile:  

     RDKit          2D

 35 38  0  0  0  0  0  0  0  0999 V2000
   -2.3415    0.6514    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -2.3433    2.3041    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.6282    1.8950    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.6247    1.0621    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -0.9056    0.6509    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -0.1854    1.0680    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -0.1888    1.9009    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -0.9124    2.3167    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   -0.9033   -0.1740    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    0.5302    0.6575    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.5286   -0.1678    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.2432   -0.5782    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.9574   -0.1637    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.9525    0.6654    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.2373    1.0721    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -3.0563    1.0641    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -3.0567    1.8914    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -3.7695    2.3024    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   -4.4862    1.8907    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -4.4858    1.0634    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -3.7686    0.6479    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.6643    1.0823    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    3.3812    0.6744    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -2.3430   -0.1735    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   -3.0581   -0.5848    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.6735   -0.5733    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    3.3861   -0.1579    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.1022   -0.5675    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.8149   -0.1521    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.5308   -0.5618    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.8115    0.6727    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.1055   -1.3923    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    5.5241    0.2667    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   -4.7035    2.6913    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -5.2035    1.4831    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
  4  5  1  0
  5  6  1  0
  6  7  2  0
  7  8  1  0
 16  1  1  0
  5  9  2  0
 16 21  1  0
 17 18  1  0
 18 19  1  0
 19 20  1  0
 20 21  2  0
  1  4  2  0
 14 22  1  0
  6 10  1  0
 22 23  1  0
  1 24  1  0
 10 11  2  0
 24 25  1  0
  3  2  2  0
 13 26  1  0
 11 12  1  0
 26 27  1  0
  2 17  1  0
 27 28  1  0
 12 13  2  0
 28 29  1  0
  3  4  1  0
 29 30  1  0
 13 14  1  0
 29 31  1  0
  3  8  1  0
 28 32  1  6
 14 15  2  0
 29 33  1  0
 15 10  1  0
 19 34  1  0
 16 17  2  0
 19 35  1  0
M  END

Alternative Forms

1. Parent:

   

   ALA1773672

   PIERREIONE A

Molecule Features

Natural Product: Yes

Oral: No

Chemical Probe: No

Parenteral: No

Molecule Type: Small molecule

Topical: No

First In Class: No

Black Box: No

Chirality: No

Availability: No

Prodrug: No

Calculated Properties

Molecular Weight: 482.53

Molecular Weight (Monoisotopic): 482.1941

AlogP: 4.17

#Rotatable Bonds: 7

Polar Surface Area: 107.59

Molecular Species: NEUTRAL

HBA: 8

HBD: 2

#RO5 Violations: ┄

HBA (Lipinski): 8

HBD (Lipinski): 2

#RO5 Violations (Lipinski): ┄

CX Acidic pKa: 13.20

CX Basic pKa: ┄

CX LogP: 3.14

CX LogD: 3.14

Aromatic Rings: 3

Heavy Atoms: 35

QED Weighted: 0.52

Np Likeness Score: 1.90

References

1. Gao S, Xu YM, Valeriote FA, Gunatilaka AA..  (2011)  Pierreiones A-D, solid tumor selective pyranoisoflavones and other cytotoxic constituents from Antheroporum pierrei.,  74  (4): [PMID:21452840] [10.1021/np100763p]

Source

Source(1):

• Scientific Literature