The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
3'-methoxy-4'-(2R,3-dihydroxy-3-methylbutoxyl)-3'',3''-dimethylpyrano-(6,7)-isoflavone ID: ALA1773673
Cas Number: 1292766-21-2
PubChem CID: 52951514
Max Phase: Preclinical
Molecular Formula: C26H28O7
Molecular Weight: 452.50
Molecule Type: Small molecule
This compound is available for customization.
Associated Items:
Names and Identifiers Synonyms: Pierreione B | Pierreione B|1292766-21-2|CHEBI:68048|CHEMBL1773673|DTXSID801108928|7-[4-[(2R)-2,3-dihydroxy-3-methylbutoxy]-3-methoxyphenyl]-2,2-dimethylpyrano[3,2-g]chromen-6-one|HY-N3065|AKOS032961802|CS-0023142|Q27136544|3'-methoxy-4'-(2R,3-dihydroxy-3-methylbutoxyl)-3'',3''-dimethylpyrano-(6,7)-isoflavone|2H,6H-Benzo[1,2-b:5,4-b']dipyran-6-one, 7-[4-[(2R)-2,3-dihydroxy-3-methylbutoxy]-3-methoxyphenyl]-2,2-dimethyl-|7-(4-{[(2R)-2,3-dihydroxy-3-methylbutyl]oxy}-3-methoxyphenyl)-2,2-dimethyl-2H Show More⌵
Canonical SMILES: COc1cc(-c2coc3cc4c(cc3c2=O)C=CC(C)(C)O4)ccc1OC[C@@H](O)C(C)(C)O
Standard InChI: InChI=1S/C26H28O7/c1-25(2)9-8-16-10-17-21(12-20(16)33-25)31-13-18(24(17)28)15-6-7-19(22(11-15)30-5)32-14-23(27)26(3,4)29/h6-13,23,27,29H,14H2,1-5H3/t23-/m1/s1
Standard InChI Key: RDXLWAJRBPKMPD-HSZRJFAPSA-N
Molfile:
RDKit 2D
33 36 0 0 0 0 0 0 0 0999 V2000
-2.3708 -4.2521 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-2.3726 -2.5994 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.6573 -3.0084 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.6539 -3.8414 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-0.9348 -4.2526 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-0.2145 -3.8355 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-0.2180 -3.0025 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-0.9417 -2.5867 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
-0.9326 -5.0775 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
0.5010 -4.2460 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.4994 -5.0712 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.2141 -5.4817 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.9283 -5.0672 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.9233 -4.2380 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.2082 -3.8314 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-3.0855 -3.8393 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-3.0859 -3.0120 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-3.7986 -2.6011 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
-4.5155 -3.0127 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-4.5151 -3.8400 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-3.7978 -4.2556 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.6352 -3.8212 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
3.3521 -4.2291 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.6444 -5.4768 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
3.3570 -5.0614 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.0731 -5.4710 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.7857 -5.0556 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.5018 -5.4652 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.7824 -4.2307 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.0765 -6.2958 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
5.4951 -4.6369 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
-4.7326 -2.2121 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-5.2325 -3.4203 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
15 10 1 0
16 17 2 0
4 5 1 0
5 6 1 0
6 7 2 0
7 8 1 0
16 1 1 0
5 9 2 0
16 21 1 0
17 18 1 0
18 19 1 0
19 20 1 0
20 21 2 0
1 4 2 0
14 22 1 0
6 10 1 0
22 23 1 0
13 24 1 0
10 11 2 0
24 25 1 0
3 2 2 0
25 26 1 0
11 12 1 0
26 27 1 0
2 17 1 0
27 28 1 0
12 13 2 0
27 29 1 0
3 4 1 0
26 30 1 6
13 14 1 0
27 31 1 0
3 8 1 0
19 32 1 0
14 15 2 0
19 33 1 0
M END Associated Targets(Human) Associated Targets(non-human) Molecule Features Natural Product: YesOral: NoChemical Probe: NoParenteral: NoMolecule Type: Small moleculeTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 452.50Molecular Weight (Monoisotopic): 452.1835AlogP: 4.16#Rotatable Bonds: 6Polar Surface Area: 98.36Molecular Species: NEUTRALHBA: 7HBD: 2#RO5 Violations: ┄HBA (Lipinski): 7HBD (Lipinski): 2#RO5 Violations (Lipinski): ┄CX Acidic pKa: 13.20CX Basic pKa: ┄CX LogP: 3.30CX LogD: 3.30Aromatic Rings: 3Heavy Atoms: 33QED Weighted: 0.58Np Likeness Score: 1.70
References 1. Gao S, Xu YM, Valeriote FA, Gunatilaka AA.. (2011) Pierreiones A-D, solid tumor selective pyranoisoflavones and other cytotoxic constituents from Antheroporum pierrei., 74 (4): [PMID:21452840 ] [10.1021/np100763p ]