The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
Biphenyl-2-carboxylic acid (4-{8-[methyl-(2-pyridin-3-yl-ethyl)-amino]-5,6,7,8-tetrahydro-thieno[3,2-b]azepine-4-carbonyl}-phenyl)-amide ID: ALA177556
PubChem CID: 11365307
Max Phase: Preclinical
Molecular Formula: C36H34N4O2S
Molecular Weight: 586.76
Molecule Type: Small molecule
Associated Items:
Names and Identifiers Canonical SMILES: CN(CCc1cccnc1)C1CCCN(C(=O)c2ccc(NC(=O)c3ccccc3-c3ccccc3)cc2)c2ccsc21
Standard InChI: InChI=1S/C36H34N4O2S/c1-39(23-19-26-9-7-21-37-25-26)32-14-8-22-40(33-20-24-43-34(32)33)36(42)28-15-17-29(18-16-28)38-35(41)31-13-6-5-12-30(31)27-10-3-2-4-11-27/h2-7,9-13,15-18,20-21,24-25,32H,8,14,19,22-23H2,1H3,(H,38,41)
Standard InChI Key: LRGAOOBYJCRZOE-UHFFFAOYSA-N
Molfile:
RDKit 2D
43 48 0 0 0 0 0 0 0 0999 V2000
-0.8083 -1.1417 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-0.8083 -0.3167 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-0.1625 -1.6542 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
-0.3458 -2.4667 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.8917 -5.5042 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.5000 -6.0667 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-0.1625 0.1958 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.5958 -0.0667 0.0000 S 0 0 0 0 0 0 0 0 0 0 0 0
2.3125 -6.8667 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.5958 -1.4042 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.0667 -4.7042 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
-2.0750 -0.7292 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.2625 -3.0167 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-0.3458 1.0000 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
-1.1333 -2.7042 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
1.1042 -5.7542 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
1.5250 -7.1167 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.0417 2.1833 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
0.2542 1.5583 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.0417 -2.7792 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.0750 -3.8292 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.4667 -4.1417 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.6375 -1.4792 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.0417 1.3125 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.6750 -4.3792 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.6500 -3.3292 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.6542 1.8708 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.6375 0.0083 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.2792 -5.8167 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.9250 -7.4292 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.4417 1.6208 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.9917 -0.7292 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.1333 1.2458 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.8667 2.9875 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.9250 -6.5542 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.3500 -7.9167 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.4667 2.6708 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.8875 -6.3667 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.7125 -7.1792 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.0667 3.2333 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.5625 -8.1542 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.1375 -6.7917 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-0.0500 -7.5917 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2 1 2 0
3 1 1 0
4 3 1 0
5 11 1 0
6 5 1 0
7 2 1 0
8 2 1 0
9 6 2 0
10 1 1 0
11 22 1 0
12 10 2 0
13 4 1 0
14 7 1 0
15 4 2 0
16 5 2 0
17 9 1 0
18 31 1 0
19 14 1 0
20 13 1 0
21 13 2 0
22 25 2 0
23 3 1 0
24 19 1 0
25 21 1 0
26 20 2 0
27 24 1 0
28 7 1 0
29 6 1 0
30 9 1 0
31 27 2 0
32 23 1 0
33 14 1 0
34 40 1 0
35 17 2 0
36 17 1 0
37 27 1 0
38 29 2 0
39 38 1 0
40 37 2 0
41 36 2 0
42 35 1 0
43 41 1 0
8 12 1 0
32 28 1 0
26 22 1 0
18 34 2 0
30 39 2 0
42 43 2 0
M END Associated Targets(Human) Associated Targets(non-human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: Small moleculeTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 586.76Molecular Weight (Monoisotopic): 586.2402AlogP: 7.72#Rotatable Bonds: 8Polar Surface Area: 65.54Molecular Species: BASEHBA: 5HBD: 1#RO5 Violations: 2HBA (Lipinski): 6HBD (Lipinski): 1#RO5 Violations (Lipinski): 2CX Acidic pKa: ┄CX Basic pKa: 8.73CX LogP: 6.78CX LogD: 5.43Aromatic Rings: 5Heavy Atoms: 43QED Weighted: 0.20Np Likeness Score: -1.44
References 1. Itzhak Y, Kalir A, Weissman BA, Cohen S.. (1981) New analgesic drugs derived from phencyclidine., 24 (5): [PMID:7241506 ] [10.1021/jm00137a004 ]