The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
3-[2-Benzyl-3-(hydroxy-phenethyloxy-phosphoryl)-propionylamino]-propionic acid; compound with GENERIC INORGANIC NEUTRAL COMPONENT ID: ALA177646
PubChem CID: 44387607
Max Phase: Preclinical
Molecular Formula: C21H26ClKNO6P
Molecular Weight: 419.41
Molecule Type: Small molecule
This compound is available for customization.
Associated Items:
Names and Identifiers Canonical SMILES: O=C(O)CCNC(=O)C(Cc1ccccc1)CP(=O)(O)OCCc1ccccc1.[Cl-].[K+]
Standard InChI: InChI=1S/C21H26NO6P.ClH.K/c23-20(24)11-13-22-21(25)19(15-18-9-5-2-6-10-18)16-29(26,27)28-14-12-17-7-3-1-4-8-17;;/h1-10,19H,11-16H2,(H,22,25)(H,23,24)(H,26,27);1H;/q;;+1/p-1
Standard InChI Key: MYNJKHDWLQGTQW-UHFFFAOYSA-M
Molfile:
RDKit 2D
31 30 0 0 0 0 0 0 0 0999 V2000
8.9250 -3.0958 0.0000 Cl 0 0 0 0 0 0 0 0 0 0 0 0
3.4375 -1.5083 0.0000 P 0 0 0 0 0 0 0 0 0 0 0 0
4.6708 -1.5083 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.2875 -1.1500 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.0542 -1.1500 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.7500 -1.1500 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.6708 -2.2208 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.4375 -0.7958 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
7.1375 -1.5083 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.2875 -0.4417 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
7.7500 -0.4417 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
5.9083 -1.5083 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
2.7250 -1.5083 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
3.4375 -2.2208 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
6.5208 -1.1500 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
8.3667 -1.5083 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
5.2875 -2.5750 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.3708 -0.8917 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.2958 -0.2792 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.6583 -0.8917 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.2875 -3.2875 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.9083 -2.2208 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.6583 0.3375 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.5917 -0.2792 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.2333 0.3375 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.9000 -3.6417 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.5208 -2.5750 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.3042 0.9500 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.5208 -3.2875 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.5917 0.9500 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
8.2167 -3.0958 0.0000 K 0 0 0 0 0 15 0 0 0 0 0 0
3 5 1 0
4 3 1 0
5 2 1 0
6 9 1 0
7 3 1 0
8 2 2 0
9 15 1 0
10 4 2 0
11 6 2 0
12 4 1 0
13 2 1 0
14 2 1 0
15 12 1 0
16 6 1 0
17 7 1 0
18 13 1 0
19 20 1 0
20 18 1 0
21 17 2 0
22 17 1 0
23 19 2 0
24 19 1 0
25 24 2 0
26 21 1 0
27 22 2 0
28 23 1 0
29 27 1 0
30 25 1 0
28 30 2 0
26 29 2 0
M CHG 2 1 -1 31 1
M END Associated Targets(non-human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: Small moleculeTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 419.41Molecular Weight (Monoisotopic): 419.1498AlogP: 2.88#Rotatable Bonds: 12Polar Surface Area: 112.93Molecular Species: ACIDHBA: 4HBD: 3#RO5 Violations: ┄HBA (Lipinski): 7HBD (Lipinski): 3#RO5 Violations (Lipinski): ┄CX Acidic pKa: 1.82CX Basic pKa: ┄CX LogP: 2.36CX LogD: -2.98Aromatic Rings: 2Heavy Atoms: 29QED Weighted: 0.46Np Likeness Score: -0.08
References 1. De Lombaert S, Erion MD, Tan J, Blanchard L, el-Chehabi L, Ghai RD, Sakane Y, Berry C, Trapani AJ.. (1994) N-Phosphonomethyl dipeptides and their phosphonate prodrugs, a new generation of neutral endopeptidase (NEP, EC 3.4.24.11) inhibitors., 37 (4): [PMID:8120868 ] [10.1021/jm00030a009 ]