[(4S,6R)-8-Chloro-6-(2,3-dimethoxy-phenyl)-1-isopropyl-4H,6H-2,5-dioxa-3-aza-benzo[e]azulen-4-yl]-acetic acid

ID: ALA1777819

PubChem CID: 54581628

Max Phase: Preclinical

Molecular Formula: C24H24ClNO6

Molecular Weight: 457.91

Molecule Type: Small molecule

This compound is available for customization.

Associated Items:

Names and Identifiers

Canonical SMILES:  COc1cccc([C@@H]2O[C@@H](CC(=O)O)c3noc(C(C)C)c3-c3ccc(Cl)cc32)c1OC

Standard InChI:  InChI=1S/C24H24ClNO6/c1-12(2)22-20-14-9-8-13(25)10-16(14)23(15-6-5-7-17(29-3)24(15)30-4)31-18(11-19(27)28)21(20)26-32-22/h5-10,12,18,23H,11H2,1-4H3,(H,27,28)/t18-,23-/m0/s1

Standard InChI Key:  WRADIXPKOCXFKO-MBSDFSHPSA-N

Molfile:  

     RDKit          2D

 32 35  0  0  0  0  0  0  0  0999 V2000
   -5.0962    0.2487    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -5.0973   -0.5744    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -4.3861   -0.9852    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -4.3879    0.6594    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.7624   -0.1381    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -2.1836    0.6494    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   -3.0174    0.7910    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -3.6710   -0.5767    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -3.6762    0.2524    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -0.8697   -0.1088    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -0.4487    0.6787    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.4439    0.7080    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   -0.9204    1.4371    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   -2.1225   -0.9316    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -2.9619   -1.1319    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -3.0310   -1.9921    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -2.2342   -2.3236    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   -1.6727   -1.6682    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   -3.7675   -2.4419    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -4.5253   -2.0290    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -3.7463   -3.3047    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -5.8071    0.6590    0.0000 Cl  0  0  0  0  0  0  0  0  0  0  0  0
   -3.2272    1.5797    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -2.6432    2.1581    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -2.8525    2.9509    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -3.6453    3.1665    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -4.2287    2.5832    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -4.0164    1.7925    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.8512    1.9422    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   -1.2684    2.5201    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -2.2700    3.5291    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   -1.4779    3.3137    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
  5  6  1  0
  6  7  1  0
  5 14  1  0
 15 16  2  0
 16 17  1  0
 17 18  1  0
 18 14  2  0
 15  8  1  0
 16 19  1  0
  8  9  1  0
 19 20  1  0
  9  7  1  0
 19 21  1  0
  4  1  1  0
  1 22  1  0
  5 10  1  1
 23 24  2  0
 10 11  1  0
 24 25  1  0
  2  3  1  0
 25 26  2  0
 11 12  1  0
 26 27  1  0
  3  8  2  0
 27 28  2  0
 28 23  1  0
  7 23  1  6
 11 13  2  0
 24 29  1  0
 14 15  1  0
 29 30  1  0
  1  2  2  0
 25 31  1  0
  9  4  2  0
 31 32  1  0
M  END

Associated Targets(Human)

Liver microsomes (16955 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID
FDFT1 Tchem Squalene synthetase (333 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Associated Targets(non-human)

Rattus norvegicus (775804 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Molecule Features

Natural Product: NoOral: NoChemical Probe: NoParenteral: No
Molecule Type: Small moleculeTopical: NoFirst In Class: NoBlack Box: No
Chirality: NoAvailability: NoProdrug: No

Drug Indications

MESH IDMESH Heading EFO IDsEFO TermsMax Phase for IndicationReferences

Mechanisms of Action

Mechanism of ActionAction Typetarget IDTarget NameTarget TypeTarget OrganismBinding Site NameReferences

Biocomponents

Calculated Properties

Molecular Weight: 457.91Molecular Weight (Monoisotopic): 457.1292AlogP: 5.77#Rotatable Bonds: 6
Polar Surface Area: 91.02Molecular Species: ACIDHBA: 6HBD: 1
#RO5 Violations: 1HBA (Lipinski): 7HBD (Lipinski): 1#RO5 Violations (Lipinski): 1
CX Acidic pKa: 4.48CX Basic pKa: CX LogP: 4.78CX LogD: 1.96
Aromatic Rings: 3Heavy Atoms: 32QED Weighted: 0.50Np Likeness Score: -0.03

References

1. Griebenow N, Buchmueller A, Kolkhof P, Schamberger J, Bischoff H..  (2011)  Identification of 4H,6H-[2]benzoxepino[4,5-c][1,2]oxazoles as novel squalene synthase inhibitors.,  21  (12): [PMID:21576018] [10.1016/j.bmcl.2011.04.092]

Source