The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
[(4R,6S)-8-Chloro-6-(2,3-dimethoxy-phenyl)-1-isopropyl-4H,6H-2,5-dioxa-3-aza-benzo[e]azulen-4-yl]-acetic acid ID: ALA1778340
PubChem CID: 54583685
Max Phase: Preclinical
Molecular Formula: C24H24ClNO6
Molecular Weight: 457.91
Molecule Type: Small molecule
This compound is available for customization.
Associated Items:
Names and Identifiers Canonical SMILES: COc1cccc([C@H]2O[C@H](CC(=O)O)c3noc(C(C)C)c3-c3ccc(Cl)cc32)c1OC
Standard InChI: InChI=1S/C24H24ClNO6/c1-12(2)22-20-14-9-8-13(25)10-16(14)23(15-6-5-7-17(29-3)24(15)30-4)31-18(11-19(27)28)21(20)26-32-22/h5-10,12,18,23H,11H2,1-4H3,(H,27,28)/t18-,23-/m1/s1
Standard InChI Key: WRADIXPKOCXFKO-WZONZLPQSA-N
Molfile:
RDKit 2D
32 35 0 0 0 0 0 0 0 0999 V2000
16.7820 -0.7917 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
16.7808 -1.6148 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
17.4920 -2.0255 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
17.4902 -0.3810 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
20.1156 -1.1785 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
19.6944 -0.3911 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
18.8606 -0.2495 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
18.2071 -1.6171 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
18.2018 -0.7881 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
21.0081 -1.1493 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
21.4291 -0.3617 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
22.3216 -0.3325 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
20.9575 0.3966 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
19.7555 -1.9720 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
18.9160 -2.1722 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
18.8470 -3.0324 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
19.6438 -3.3639 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
20.2052 -2.7085 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
18.1105 -3.4822 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
17.3528 -3.0692 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
18.1318 -4.3449 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
16.0711 -0.3815 0.0000 Cl 0 0 0 0 0 0 0 0 0 0 0 0
18.6509 0.5391 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
19.2349 1.1174 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
19.0256 1.9102 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
18.2327 2.1258 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
17.6493 1.5425 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
17.8617 0.7519 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
20.0267 0.9016 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
20.6095 1.4795 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
19.6080 2.4883 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
20.4000 2.2731 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5 6 1 0
6 7 1 0
5 14 1 0
15 16 2 0
16 17 1 0
17 18 1 0
18 14 2 0
15 8 1 0
16 19 1 0
8 9 1 0
19 20 1 0
9 7 1 0
19 21 1 0
4 1 1 0
1 22 1 0
5 10 1 6
23 24 2 0
10 11 1 0
24 25 1 0
2 3 1 0
25 26 2 0
11 12 1 0
26 27 1 0
3 8 2 0
27 28 2 0
28 23 1 0
7 23 1 1
11 13 2 0
24 29 1 0
14 15 1 0
29 30 1 0
1 2 2 0
25 31 1 0
9 4 2 0
31 32 1 0
M END Associated Targets(Human) Associated Targets(non-human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: Small moleculeTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 457.91Molecular Weight (Monoisotopic): 457.1292AlogP: 5.77#Rotatable Bonds: 6Polar Surface Area: 91.02Molecular Species: ACIDHBA: 6HBD: 1#RO5 Violations: 1HBA (Lipinski): 7HBD (Lipinski): 1#RO5 Violations (Lipinski): 1CX Acidic pKa: 4.48CX Basic pKa: ┄CX LogP: 4.78CX LogD: 1.96Aromatic Rings: 3Heavy Atoms: 32QED Weighted: 0.50Np Likeness Score: -0.03
References 1. Griebenow N, Buchmueller A, Kolkhof P, Schamberger J, Bischoff H.. (2011) Identification of 4H,6H-[2]benzoxepino[4,5-c][1,2]oxazoles as novel squalene synthase inhibitors., 21 (12): [PMID:21576018 ] [10.1016/j.bmcl.2011.04.092 ]