[(4R,6S)-8-Chloro-6-(2,3-dimethoxy-phenyl)-1-isopropyl-4H,6H-2,5-dioxa-3-aza-benzo[e]azulen-4-yl]-acetic acid

ID: ALA1778340

PubChem CID: 54583685

Max Phase: Preclinical

Molecular Formula: C24H24ClNO6

Molecular Weight: 457.91

Molecule Type: Small molecule

This compound is available for customization.

Associated Items:

Names and Identifiers

Canonical SMILES:  COc1cccc([C@H]2O[C@H](CC(=O)O)c3noc(C(C)C)c3-c3ccc(Cl)cc32)c1OC

Standard InChI:  InChI=1S/C24H24ClNO6/c1-12(2)22-20-14-9-8-13(25)10-16(14)23(15-6-5-7-17(29-3)24(15)30-4)31-18(11-19(27)28)21(20)26-32-22/h5-10,12,18,23H,11H2,1-4H3,(H,27,28)/t18-,23-/m1/s1

Standard InChI Key:  WRADIXPKOCXFKO-WZONZLPQSA-N

Molfile:  

     RDKit          2D

 32 35  0  0  0  0  0  0  0  0999 V2000
   16.7820   -0.7917    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   16.7808   -1.6148    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   17.4920   -2.0255    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   17.4902   -0.3810    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   20.1156   -1.1785    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   19.6944   -0.3911    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   18.8606   -0.2495    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   18.2071   -1.6171    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   18.2018   -0.7881    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   21.0081   -1.1493    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   21.4291   -0.3617    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   22.3216   -0.3325    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   20.9575    0.3966    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   19.7555   -1.9720    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   18.9160   -2.1722    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   18.8470   -3.0324    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   19.6438   -3.3639    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   20.2052   -2.7085    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   18.1105   -3.4822    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   17.3528   -3.0692    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   18.1318   -4.3449    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   16.0711   -0.3815    0.0000 Cl  0  0  0  0  0  0  0  0  0  0  0  0
   18.6509    0.5391    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   19.2349    1.1174    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   19.0256    1.9102    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   18.2327    2.1258    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   17.6493    1.5425    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   17.8617    0.7519    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   20.0267    0.9016    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   20.6095    1.4795    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   19.6080    2.4883    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   20.4000    2.2731    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
  5  6  1  0
  6  7  1  0
  5 14  1  0
 15 16  2  0
 16 17  1  0
 17 18  1  0
 18 14  2  0
 15  8  1  0
 16 19  1  0
  8  9  1  0
 19 20  1  0
  9  7  1  0
 19 21  1  0
  4  1  1  0
  1 22  1  0
  5 10  1  6
 23 24  2  0
 10 11  1  0
 24 25  1  0
  2  3  1  0
 25 26  2  0
 11 12  1  0
 26 27  1  0
  3  8  2  0
 27 28  2  0
 28 23  1  0
  7 23  1  1
 11 13  2  0
 24 29  1  0
 14 15  1  0
 29 30  1  0
  1  2  2  0
 25 31  1  0
  9  4  2  0
 31 32  1  0
M  END

Associated Targets(Human)

FDFT1 Tchem Squalene synthetase (333 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID
Liver microsomes (16955 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Associated Targets(non-human)

Rattus norvegicus (775804 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Molecule Features

Natural Product: NoOral: NoChemical Probe: NoParenteral: No
Molecule Type: Small moleculeTopical: NoFirst In Class: NoBlack Box: No
Chirality: NoAvailability: NoProdrug: No

Drug Indications

MESH IDMESH Heading EFO IDsEFO TermsMax Phase for IndicationReferences

Mechanisms of Action

Mechanism of ActionAction Typetarget IDTarget NameTarget TypeTarget OrganismBinding Site NameReferences

Biocomponents

Calculated Properties

Molecular Weight: 457.91Molecular Weight (Monoisotopic): 457.1292AlogP: 5.77#Rotatable Bonds: 6
Polar Surface Area: 91.02Molecular Species: ACIDHBA: 6HBD: 1
#RO5 Violations: 1HBA (Lipinski): 7HBD (Lipinski): 1#RO5 Violations (Lipinski): 1
CX Acidic pKa: 4.48CX Basic pKa: CX LogP: 4.78CX LogD: 1.96
Aromatic Rings: 3Heavy Atoms: 32QED Weighted: 0.50Np Likeness Score: -0.03

References

1. Griebenow N, Buchmueller A, Kolkhof P, Schamberger J, Bischoff H..  (2011)  Identification of 4H,6H-[2]benzoxepino[4,5-c][1,2]oxazoles as novel squalene synthase inhibitors.,  21  (12): [PMID:21576018] [10.1016/j.bmcl.2011.04.092]

Source