The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
2-[(4R,6S)-8-Chloro-6-(2,3-dimethoxy-phenyl)-1-isopropyl-4H,6H-2,5-dioxa-3-aza-benzo[e]azulen-4-yl]-1-((R)-3-hydroxy-pyrrolidin-1-yl)-ethanone ID: ALA1778341
PubChem CID: 54585587
Max Phase: Preclinical
Molecular Formula: C28H31ClN2O6
Molecular Weight: 527.02
Molecule Type: Small molecule
This compound is available for customization.
Associated Items:
Names and Identifiers Canonical SMILES: COc1cccc([C@H]2O[C@H](CC(=O)N3CC[C@@H](O)C3)c3noc(C(C)C)c3-c3ccc(Cl)cc32)c1OC
Standard InChI: InChI=1S/C28H31ClN2O6/c1-15(2)26-24-18-9-8-16(29)12-20(18)27(19-6-5-7-21(34-3)28(19)35-4)36-22(25(24)30-37-26)13-23(33)31-11-10-17(32)14-31/h5-9,12,15,17,22,27,32H,10-11,13-14H2,1-4H3/t17-,22-,27-/m1/s1
Standard InChI Key: YFAKJQUXFPONEV-UKPISFLSSA-N
Molfile:
RDKit 2D
37 41 0 0 0 0 0 0 0 0999 V2000
-5.0815 -7.0814 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-5.0826 -7.8795 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-4.3930 -8.2778 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-4.3948 -6.6833 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.8492 -7.4566 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-2.2577 -6.6930 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
-3.0660 -6.5559 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-3.6997 -7.8817 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-3.7048 -7.0780 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-0.9839 -7.4282 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-0.5756 -6.6645 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.2897 -6.6363 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
-1.0330 -5.9292 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
-2.1985 -8.2259 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-3.0123 -8.4200 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-3.0793 -9.2541 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-2.3067 -9.5755 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
-1.7623 -8.9399 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
-3.7933 -9.6902 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-4.5281 -9.2898 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-3.7727 -10.5267 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-5.7706 -6.6837 0.0000 Cl 0 0 0 0 0 0 0 0 0 0 0 0
-3.2694 -5.7911 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-2.7032 -5.2305 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-2.9061 -4.4618 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-3.6749 -4.2527 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-4.2405 -4.8183 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-4.0346 -5.5849 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.9353 -5.4397 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
-1.3704 -4.8794 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-2.3414 -3.9012 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
-1.5734 -4.1100 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.8218 -7.3187 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.6360 -7.0243 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.6077 -6.1589 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.7760 -5.9185 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.2913 -5.6272 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
17 18 1 0
18 14 2 0
15 8 1 0
16 19 1 0
8 9 1 0
19 20 1 0
9 7 1 0
19 21 1 0
4 1 1 0
1 22 1 0
5 10 1 6
23 24 2 0
10 11 1 0
24 25 1 0
2 3 1 0
25 26 2 0
11 12 1 0
26 27 1 0
3 8 2 0
27 28 2 0
28 23 1 0
7 23 1 1
11 13 2 0
24 29 1 0
14 15 1 0
29 30 1 0
1 2 2 0
25 31 1 0
9 4 2 0
31 32 1 0
12 33 1 0
5 6 1 0
6 7 1 0
5 14 1 0
15 16 2 0
33 34 1 0
34 35 1 0
35 36 1 0
36 12 1 0
16 17 1 0
35 37 1 6
M END Associated Targets(Human) Associated Targets(non-human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: Small moleculeTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 527.02Molecular Weight (Monoisotopic): 526.1871AlogP: 5.28#Rotatable Bonds: 6Polar Surface Area: 94.26Molecular Species: NEUTRALHBA: 7HBD: 1#RO5 Violations: 2HBA (Lipinski): 8HBD (Lipinski): 1#RO5 Violations (Lipinski): 2CX Acidic pKa: ┄CX Basic pKa: ┄CX LogP: 3.68CX LogD: 3.68Aromatic Rings: 3Heavy Atoms: 37QED Weighted: 0.47Np Likeness Score: -0.43
References 1. Griebenow N, Buchmueller A, Kolkhof P, Schamberger J, Bischoff H.. (2011) Identification of 4H,6H-[2]benzoxepino[4,5-c][1,2]oxazoles as novel squalene synthase inhibitors., 21 (12): [PMID:21576018 ] [10.1016/j.bmcl.2011.04.092 ]