2-[(4R,6S)-8-Chloro-6-(2,3-dimethoxy-phenyl)-1-isopropyl-4H,6H-2,5-dioxa-3-aza-benzo[e]azulen-4-yl]-1-((R)-3-hydroxy-pyrrolidin-1-yl)-ethanone

ID: ALA1778341

PubChem CID: 54585587

Max Phase: Preclinical

Molecular Formula: C28H31ClN2O6

Molecular Weight: 527.02

Molecule Type: Small molecule

This compound is available for customization.

Associated Items:

Names and Identifiers

Canonical SMILES:  COc1cccc([C@H]2O[C@H](CC(=O)N3CC[C@@H](O)C3)c3noc(C(C)C)c3-c3ccc(Cl)cc32)c1OC

Standard InChI:  InChI=1S/C28H31ClN2O6/c1-15(2)26-24-18-9-8-16(29)12-20(18)27(19-6-5-7-21(34-3)28(19)35-4)36-22(25(24)30-37-26)13-23(33)31-11-10-17(32)14-31/h5-9,12,15,17,22,27,32H,10-11,13-14H2,1-4H3/t17-,22-,27-/m1/s1

Standard InChI Key:  YFAKJQUXFPONEV-UKPISFLSSA-N

Molfile:  

     RDKit          2D

 37 41  0  0  0  0  0  0  0  0999 V2000
   -5.0815   -7.0814    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -5.0826   -7.8795    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -4.3930   -8.2778    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -4.3948   -6.6833    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.8492   -7.4566    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -2.2577   -6.6930    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   -3.0660   -6.5559    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -3.6997   -7.8817    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -3.7048   -7.0780    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -0.9839   -7.4282    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -0.5756   -6.6645    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.2897   -6.6363    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   -1.0330   -5.9292    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   -2.1985   -8.2259    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -3.0123   -8.4200    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -3.0793   -9.2541    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -2.3067   -9.5755    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   -1.7623   -8.9399    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   -3.7933   -9.6902    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -4.5281   -9.2898    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -3.7727  -10.5267    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -5.7706   -6.6837    0.0000 Cl  0  0  0  0  0  0  0  0  0  0  0  0
   -3.2694   -5.7911    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -2.7032   -5.2305    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -2.9061   -4.4618    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -3.6749   -4.2527    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -4.2405   -4.8183    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -4.0346   -5.5849    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.9353   -5.4397    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   -1.3704   -4.8794    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -2.3414   -3.9012    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   -1.5734   -4.1100    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.8218   -7.3187    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.6360   -7.0243    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.6077   -6.1589    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.7760   -5.9185    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.2913   -5.6272    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
 17 18  1  0
 18 14  2  0
 15  8  1  0
 16 19  1  0
  8  9  1  0
 19 20  1  0
  9  7  1  0
 19 21  1  0
  4  1  1  0
  1 22  1  0
  5 10  1  6
 23 24  2  0
 10 11  1  0
 24 25  1  0
  2  3  1  0
 25 26  2  0
 11 12  1  0
 26 27  1  0
  3  8  2  0
 27 28  2  0
 28 23  1  0
  7 23  1  1
 11 13  2  0
 24 29  1  0
 14 15  1  0
 29 30  1  0
  1  2  2  0
 25 31  1  0
  9  4  2  0
 31 32  1  0
 12 33  1  0
  5  6  1  0
  6  7  1  0
  5 14  1  0
 15 16  2  0
 33 34  1  0
 34 35  1  0
 35 36  1  0
 36 12  1  0
 16 17  1  0
 35 37  1  6
M  END

Associated Targets(Human)

Liver microsomes (16955 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID
FDFT1 Tchem Squalene synthetase (333 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Associated Targets(non-human)

Rattus norvegicus (775804 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Molecule Features

Natural Product: NoOral: NoChemical Probe: NoParenteral: No
Molecule Type: Small moleculeTopical: NoFirst In Class: NoBlack Box: No
Chirality: NoAvailability: NoProdrug: No

Drug Indications

MESH IDMESH Heading EFO IDsEFO TermsMax Phase for IndicationReferences

Mechanisms of Action

Mechanism of ActionAction Typetarget IDTarget NameTarget TypeTarget OrganismBinding Site NameReferences

Biocomponents

Calculated Properties

Molecular Weight: 527.02Molecular Weight (Monoisotopic): 526.1871AlogP: 5.28#Rotatable Bonds: 6
Polar Surface Area: 94.26Molecular Species: NEUTRALHBA: 7HBD: 1
#RO5 Violations: 2HBA (Lipinski): 8HBD (Lipinski): 1#RO5 Violations (Lipinski): 2
CX Acidic pKa: CX Basic pKa: CX LogP: 3.68CX LogD: 3.68
Aromatic Rings: 3Heavy Atoms: 37QED Weighted: 0.47Np Likeness Score: -0.43

References

1. Griebenow N, Buchmueller A, Kolkhof P, Schamberger J, Bischoff H..  (2011)  Identification of 4H,6H-[2]benzoxepino[4,5-c][1,2]oxazoles as novel squalene synthase inhibitors.,  21  (12): [PMID:21576018] [10.1016/j.bmcl.2011.04.092]

Source